![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | characters.yaml | 2022-01-31 18:31 | 840 | |
![[TXT]](/icons/text.gif) | makechars.py | 2022-01-31 18:31 | 111 | |
![[DIR]](/icons/folder.gif) | light being/ | 2022-01-31 20:30 | - | |
![[DIR]](/icons/folder.gif) | psyche locks/ | 2022-01-31 21:15 | - | |
![[DIR]](/icons/folder.gif) | trucypro/ | 2022-01-31 21:54 | - | |
![[DIR]](/icons/folder.gif) | tsubaki yayoi/ | 2022-01-31 21:55 | - | |
![[DIR]](/icons/folder.gif) | updateprova/ | 2022-01-31 21:56 | - | |
![[DIR]](/icons/folder.gif) | vera (sevensirens)/ | 2022-01-31 21:58 | - | |
![[DIR]](/icons/folder.gif) | vincent brooks/ | 2022-01-31 21:58 | - | |
![[DIR]](/icons/folder.gif) | viridi (hd) (uprising)/ | 2022-01-31 21:58 | - | |
![[DIR]](/icons/folder.gif) | yokorcg/ | 2022-01-31 22:02 | - | |
![[DIR]](/icons/folder.gif) | yukari/ | 2022-01-31 22:04 | - | |
![[DIR]](/icons/folder.gif) | yusuke kitagawa/ | 2022-01-31 22:04 | - | |
![[DIR]](/icons/folder.gif) | yuugo/ | 2022-01-31 22:04 | - | |
![[DIR]](/icons/folder.gif) | zenitsu gbf/ | 2022-01-31 22:06 | - | |
![[DIR]](/icons/folder.gif) | aboborcg/ | 2022-01-31 22:07 | - | |
![[DIR]](/icons/folder.gif) | ace/ | 2022-01-31 22:07 | - | |
![[DIR]](/icons/folder.gif) | acro/ | 2022-01-31 22:07 | - | |
![[DIR]](/icons/folder.gif) | adachi/ | 2022-01-31 22:08 | - | |
![[DIR]](/icons/folder.gif) | add (elsword)/ | 2022-01-31 22:08 | - | |
![[DIR]](/icons/folder.gif) | ahlbi/ | 2022-01-31 22:09 | - | |
![[DIR]](/icons/folder.gif) | aigis (godot)/ | 2022-01-31 22:10 | - | |
![[DIR]](/icons/folder.gif) | ain (elsword)/ | 2022-01-31 22:10 | - | |
![[DIR]](/icons/folder.gif) | aisha (elsword)/ | 2022-01-31 22:10 | - | |
![[DIR]](/icons/folder.gif) | akane/ | 2022-01-31 22:10 | - | |
![[DIR]](/icons/folder.gif) | alfendi/ | 2022-01-31 22:11 | - | |
![[DIR]](/icons/folder.gif) | alice/ | 2022-01-31 22:11 | - | |
![[DIR]](/icons/folder.gif) | alice (yttdbeta)/ | 2022-01-31 22:11 | - | |
![[DIR]](/icons/folder.gif) | alice vlr/ | 2022-01-31 22:12 | - | |
![[DIR]](/icons/folder.gif) | alita tiala/ | 2022-01-31 22:12 | - | |
![[DIR]](/icons/folder.gif) | allenatori pokemon/ | 2022-01-31 22:12 | - | |
![[DIR]](/icons/folder.gif) | alm (echoes)/ | 2022-01-31 22:13 | - | |
![[DIR]](/icons/folder.gif) | alma/ | 2022-01-31 22:13 | - | |
![[DIR]](/icons/folder.gif) | altamont/ | 2022-01-31 22:13 | - | |
![[DIR]](/icons/folder.gif) | amane/ | 2022-01-31 22:14 | - | |
![[DIR]](/icons/folder.gif) | amara/ | 2022-01-31 22:14 | - | |
![[DIR]](/icons/folder.gif) | andistandhin/ | 2022-01-31 22:14 | - | |
![[DIR]](/icons/folder.gif) | angel starr/ | 2022-01-31 22:15 | - | |
![[DIR]](/icons/folder.gif) | angie/ | 2022-01-31 22:15 | - | |
![[DIR]](/icons/folder.gif) | ann takamaki/ | 2022-01-31 22:15 | - | |
![[DIR]](/icons/folder.gif) | anzu/ | 2022-01-31 22:15 | - | |
![[DIR]](/icons/folder.gif) | apollo/ | 2022-01-31 22:16 | - | |
![[DIR]](/icons/folder.gif) | apollodd wit/ | 2022-01-31 22:16 | - | |
![[DIR]](/icons/folder.gif) | apollopro/ | 2022-01-31 22:17 | - | |
![[DIR]](/icons/folder.gif) | april/ | 2022-01-31 22:18 | - | |
![[DIR]](/icons/folder.gif) | ara (elsword)/ | 2022-01-31 22:18 | - | |
![[DIR]](/icons/folder.gif) | archer/ | 2022-01-31 22:18 | - | |
![[DIR]](/icons/folder.gif) | armstrong/ | 2022-01-31 22:18 | - | |
![[DIR]](/icons/folder.gif) | arthur pendragon/ | 2022-01-31 22:19 | - | |
![[DIR]](/icons/folder.gif) | asahina/ | 2022-01-31 22:19 | - | |
![[DIR]](/icons/folder.gif) | ashe (3h)/ | 2022-01-31 22:19 | - | |
![[DIR]](/icons/folder.gif) | asougipro/ | 2022-01-31 22:20 | - | |
![[DIR]](/icons/folder.gif) | astolfo/ | 2022-01-31 22:21 | - | |
![[DIR]](/icons/folder.gif) | atmey/ | 2022-01-31 22:23 | - | |
![[DIR]](/icons/folder.gif) | aubrey (omori)/ | 2022-01-31 22:23 | - | |
![[DIR]](/icons/folder.gif) | auchi/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | aura/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | azazel/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | azrael/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | azura (fates)/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | bailiff/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | bailiff gb/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | bailiff jp/ | 2022-01-31 22:24 | - | |
![[DIR]](/icons/folder.gif) | barghest (s3)/ | 2022-01-31 22:25 | - | |
![[DIR]](/icons/folder.gif) | barnham/ | 2022-01-31 22:25 | - | |
![[DIR]](/icons/folder.gif) | barok/ | 2022-01-31 22:26 | - | |
![[DIR]](/icons/folder.gif) | basilio (awakening)/ | 2022-01-31 22:27 | - | |
![[DIR]](/icons/folder.gif) | bb/ | 2022-01-31 22:27 | - | |
![[DIR]](/icons/folder.gif) | beat frx/ | 2022-01-31 22:27 | - | |
![[DIR]](/icons/folder.gif) | beatrice/ | 2022-01-31 22:28 | - | |
![[DIR]](/icons/folder.gif) | beatrice rezero/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | beelzebub/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | behleeb/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | bellboy/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | ben/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | beppo/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | berkut (echoes)/ | 2022-01-31 22:29 | - | |
![[DIR]](/icons/folder.gif) | bernadetta (3h)/ | 2022-01-31 22:30 | - | |
![[DIR]](/icons/folder.gif) | betty de famme/ | 2022-01-31 22:30 | - | |
![[DIR]](/icons/folder.gif) | bikini/ | 2022-01-31 22:30 | - | |
![[DIR]](/icons/folder.gif) | blackquill/ | 2022-01-31 22:30 | - | |
![[DIR]](/icons/folder.gif) | blaise debeste/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | blake belladonna/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | bloodis (disgaea 5)/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | bolo/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | bolo (sevensirens)/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | bonnie_karin/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | bonny de famme/ | 2022-01-31 22:31 | - | |
![[DIR]](/icons/folder.gif) | bowl/ | 2022-01-31 22:32 | - | |
![[DIR]](/icons/folder.gif) | brisbane/ | 2022-01-31 22:32 | - | |
![[DIR]](/icons/folder.gif) | bucky/ | 2022-01-31 22:32 | - | |
![[DIR]](/icons/folder.gif) | burnovrcg/ | 2022-01-31 22:32 | - | |
![[DIR]](/icons/folder.gif) | butch browning/ | 2022-01-31 22:33 | - | |
![[DIR]](/icons/folder.gif) | butzsoj/ | 2022-01-31 22:33 | - | |
![[DIR]](/icons/folder.gif) | byakuya/ | 2022-01-31 22:33 | - | |
![[DIR]](/icons/folder.gif) | byleth (f) (3h)/ | 2022-01-31 22:33 | - | |
![[DIR]](/icons/folder.gif) | byleth (m) (3h)/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | byrne/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | camilla (fe)/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | cammy/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | caster/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | cc/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | celestia/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | celica (echoes)/ | 2022-01-31 22:34 | - | |
![[DIR]](/icons/folder.gif) | celica a mercury/ | 2022-01-31 22:35 | - | |
![[DIR]](/icons/folder.gif) | cenobia/ | 2022-01-31 22:35 | - | |
![[DIR]](/icons/folder.gif) | cerberus/ | 2022-01-31 22:35 | - | |
![[DIR]](/icons/folder.gif) | charles/ | 2022-01-31 22:36 | - | |
![[DIR]](/icons/folder.gif) | chefrcg/ | 2022-01-31 22:36 | - | |
![[DIR]](/icons/folder.gif) | chiaki/ | 2022-01-31 22:36 | - | |
![[DIR]](/icons/folder.gif) | chidouin/ | 2022-01-31 22:36 | - | |
![[DIR]](/icons/folder.gif) | chie/ | 2022-01-31 22:36 | - | |
![[DIR]](/icons/folder.gif) | chihiro/ | 2022-01-31 22:37 | - | |
![[DIR]](/icons/folder.gif) | chiyo (tpb)/ | 2022-01-31 22:37 | - | |
![[DIR]](/icons/folder.gif) | chris/ | 2022-01-31 22:37 | - | |
![[DIR]](/icons/folder.gif) | chrom (awakening)/ | 2022-01-31 22:37 | - | |
![[DIR]](/icons/folder.gif) | cicciogamer89/ | 2022-01-31 22:37 | - | |
![[DIR]](/icons/folder.gif) | ciel (elsword)/ | 2022-01-31 22:37 | - | |
![[DIR]](/icons/folder.gif) | cindy/ | 2022-01-31 22:38 | - | |
![[DIR]](/icons/folder.gif) | claire/ | 2022-01-31 22:38 | - | |
![[DIR]](/icons/folder.gif) | claude (3h)/ | 2022-01-31 22:38 | - | |
![[DIR]](/icons/folder.gif) | claus/ | 2022-01-31 22:38 | - | |
![[DIR]](/icons/folder.gif) | clover/ | 2022-01-31 22:39 | - | |
![[DIR]](/icons/folder.gif) | clover vlr/ | 2022-01-31 22:39 | - | |
![[DIR]](/icons/folder.gif) | coco atarashi frx/ | 2022-01-31 22:39 | - | |
![[DIR]](/icons/folder.gif) | coco nty/ | 2022-01-31 22:39 | - | |
![[DIR]](/icons/folder.gif) | cody/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | colias palaeno/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | conan edogawa/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | conciergercg/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | corrin (f) (fates)/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | corrin (m) (fates)/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | crab/ | 2022-01-31 22:40 | - | |
![[DIR]](/icons/folder.gif) | crogrey/ | 2022-01-31 22:41 | - | |
![[DIR]](/icons/folder.gif) | cyanea/ | 2022-01-31 22:42 | - | |
![[DIR]](/icons/folder.gif) | dabi/ | 2022-01-31 22:42 | - | |
![[DIR]](/icons/folder.gif) | daddy dearest/ | 2022-01-31 22:42 | - | |
![[DIR]](/icons/folder.gif) | dahlia/ | 2022-01-31 22:42 | - | |
![[DIR]](/icons/folder.gif) | dane gustavia/ | 2022-01-31 22:42 | - | |
![[DIR]](/icons/folder.gif) | darklaw/ | 2022-01-31 22:43 | - | |
![[DIR]](/icons/folder.gif) | daru/ | 2022-01-31 22:43 | - | |
![[DIR]](/icons/folder.gif) | daryan crescend/ | 2022-01-31 22:43 | - | |
![[DIR]](/icons/folder.gif) | datz/ | 2022-01-31 22:43 | - | |
![[DIR]](/icons/folder.gif) | dave strider/ | 2022-01-31 22:43 | - | |
![[DIR]](/icons/folder.gif) | de killer/ | 2022-01-31 22:44 | - | |
![[DIR]](/icons/folder.gif) | death the kid/ | 2022-01-31 22:44 | - | |
![[DIR]](/icons/folder.gif) | decargo/ | 2022-01-31 22:44 | - | |
![[DIR]](/icons/folder.gif) | delicia/ | 2022-01-31 22:44 | - | |
![[DIR]](/icons/folder.gif) | demi-fiend/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | deplume/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | derek stilles/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | descole/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | desiree/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | dhurke/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | dhurke d/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | di-jun huang/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | diego/ | 2022-01-31 22:45 | - | |
![[DIR]](/icons/folder.gif) | dimitri (3h)/ | 2022-01-31 22:46 | - | |
![[DIR]](/icons/folder.gif) | dio/ | 2022-01-31 22:46 | - | |
![[DIR]](/icons/folder.gif) | dio brando vn/ | 2022-01-31 22:46 | - | |
![[DIR]](/icons/folder.gif) | dmitri/ | 2022-01-31 22:47 | - | |
![[DIR]](/icons/folder.gif) | dobinbough/ | 2022-01-31 22:48 | - | |
![[DIR]](/icons/folder.gif) | donnabella/ | 2022-01-31 22:48 | - | |
![[DIR]](/icons/folder.gif) | dreamhero_omori/ | 2022-01-31 22:49 | - | |
![[DIR]](/icons/folder.gif) | drebber/ | 2022-01-31 22:49 | - | |
![[DIR]](/icons/folder.gif) | drew/ | 2022-01-31 22:49 | - | |
![[DIR]](/icons/folder.gif) | drhotti/ | 2022-01-31 22:49 | - | |
![[DIR]](/icons/folder.gif) | edelgard (3h)/ | 2022-01-31 22:49 | - | |
![[DIR]](/icons/folder.gif) | edgeworthhd/ | 2022-01-31 22:50 | - | |
![[DIR]](/icons/folder.gif) | elesis (elsword)/ | 2022-01-31 22:50 | - | |
![[DIR]](/icons/folder.gif) | elise/ | 2022-01-31 22:50 | - | |
![[DIR]](/icons/folder.gif) | elizabeth/ | 2022-01-31 22:51 | - | |
![[DIR]](/icons/folder.gif) | ellen/ | 2022-01-31 22:52 | - | |
![[DIR]](/icons/folder.gif) | elsword (elsword)/ | 2022-01-31 22:52 | - | |
![[DIR]](/icons/folder.gif) | eltnum/ | 2022-01-31 22:52 | - | |
![[DIR]](/icons/folder.gif) | emaaai/ | 2022-01-31 22:53 | - | |
![[DIR]](/icons/folder.gif) | emaaj/ | 2022-01-31 22:53 | - | |
![[DIR]](/icons/folder.gif) | emasoj/ | 2022-01-31 22:53 | - | |
![[DIR]](/icons/folder.gif) | emmy/ | 2022-01-31 22:54 | - | |
![[DIR]](/icons/folder.gif) | empresssiren (sevensirens)/ | 2022-01-31 22:54 | - | |
![[DIR]](/icons/folder.gif) | ena_hd/ | 2022-01-31 22:54 | - | |
![[DIR]](/icons/folder.gif) | enju yoinara (ayakashiakashi)/ | 2022-01-31 22:55 | - | |
![[DIR]](/icons/folder.gif) | ernest amano/ | 2022-01-31 22:55 | - | |
![[DIR]](/icons/folder.gif) | es/ | 2022-01-31 22:55 | - | |
![[DIR]](/icons/folder.gif) | espella/ | 2022-01-31 22:55 | - | |
![[DIR]](/icons/folder.gif) | everyday/ | 2022-01-31 22:56 | - | |
![[DIR]](/icons/folder.gif) | fantozzi/ | 2022-01-31 22:56 | - | |
![[DIR]](/icons/folder.gif) | favij/ | 2022-01-31 22:56 | - | |
![[DIR]](/icons/folder.gif) | fawles/ | 2022-01-31 22:56 | - | |
![[DIR]](/icons/folder.gif) | felix white/ | 2022-01-31 22:57 | - | |
![[DIR]](/icons/folder.gif) | filch/ | 2022-01-31 22:57 | - | |
![[DIR]](/icons/folder.gif) | finn/ | 2022-01-31 22:57 | - | |
![[DIR]](/icons/folder.gif) | fishazama/ | 2022-01-31 22:57 | - | |
![[DIR]](/icons/folder.gif) | flayn (3h)/ | 2022-01-31 22:58 | - | |
![[DIR]](/icons/folder.gif) | franken stein/ | 2022-01-31 22:59 | - | |
![[DIR]](/icons/folder.gif) | franziska/ | 2022-01-31 23:00 | - | |
![[DIR]](/icons/folder.gif) | fulbright/ | 2022-01-31 23:00 | - | |
![[DIR]](/icons/folder.gif) | furio/ | 2022-01-31 23:00 | - | |
![[DIR]](/icons/folder.gif) | fuwa (tpb)/ | 2022-01-31 23:00 | - | |
![[DIR]](/icons/folder.gif) | fuyuhiko/ | 2022-01-31 23:01 | - | |
![[DIR]](/icons/folder.gif) | gabibbo/ | 2022-01-31 23:01 | - | |
![[DIR]](/icons/folder.gif) | gant/ | 2022-01-31 23:01 | - | |
![[DIR]](/icons/folder.gif) | garan/ | 2022-01-31 23:01 | - | |
![[DIR]](/icons/folder.gif) | gardevoir/ | 2022-01-31 23:01 | - | |
![[DIR]](/icons/folder.gif) | gashu/ | 2022-01-31 23:02 | - | |
![[DIR]](/icons/folder.gif) | geiru/ | 2022-01-31 23:02 | - | |
![[DIR]](/icons/folder.gif) | gengar/ | 2022-01-31 23:02 | - | |
![[DIR]](/icons/folder.gif) | gerry scotti/ | 2022-01-31 23:03 | - | |
![[DIR]](/icons/folder.gif) | gilgamesh fgo/ | 2022-01-31 23:03 | - | |
![[DIR]](/icons/folder.gif) | gilgamesh(child) fgo/ | 2022-01-31 23:03 | - | |
![[DIR]](/icons/folder.gif) | gin/ | 2022-01-31 23:03 | - | |
![[DIR]](/icons/folder.gif) | giyu gbf/ | 2022-01-31 23:04 | - | |
![[DIR]](/icons/folder.gif) | godaircg/ | 2022-01-31 23:04 | - | |
![[DIR]](/icons/folder.gif) | godot/ | 2022-01-31 23:04 | - | |
![[DIR]](/icons/folder.gif) | goku (legends)/ | 2022-01-31 23:04 | - | |
![[DIR]](/icons/folder.gif) | goldie/ | 2022-01-31 23:05 | - | |
![[DIR]](/icons/folder.gif) | gonta/ | 2022-01-31 23:05 | - | |
![[DIR]](/icons/folder.gif) | goodman/ | 2022-01-31 23:06 | - | |
![[DIR]](/icons/folder.gif) | goro majima (y0)/ | 2022-01-31 23:06 | - | |
![[DIR]](/icons/folder.gif) | gregory aai/ | 2022-01-31 23:07 | - | |
![[DIR]](/icons/folder.gif) | grete/ | 2022-01-31 23:07 | - | |
![[DIR]](/icons/folder.gif) | grey/ | 2022-01-31 23:07 | - | |
![[DIR]](/icons/folder.gif) | grima (feh)/ | 2022-01-31 23:07 | - | |
![[DIR]](/icons/folder.gif) | grosky/ | 2022-01-31 23:08 | - | |
![[DIR]](/icons/folder.gif) | grossberg old/ | 2022-01-31 23:08 | - | |
![[DIR]](/icons/folder.gif) | gudako/ | 2022-01-31 23:08 | - | |
![[DIR]](/icons/folder.gif) | gundham/ | 2022-01-31 23:09 | - | |
![[DIR]](/icons/folder.gif) | guy/ | 2022-01-31 23:09 | - | |
![[DIR]](/icons/folder.gif) | hades izanami/ | 2022-01-31 23:09 | - | |
![[DIR]](/icons/folder.gif) | haida/ | 2022-01-31 23:10 | - | |
![[DIR]](/icons/folder.gif) | haito minai (ayakashiakashi)/ | 2022-01-31 23:10 | - | |
![[DIR]](/icons/folder.gif) | adrian/ | 2022-02-01 00:36 | - | |
![[DIR]](/icons/folder.gif) | anton/ | 2022-02-01 00:37 | - | |
![[DIR]](/icons/folder.gif) | apollosoj/ | 2022-02-01 00:38 | - | |
![[DIR]](/icons/folder.gif) | asougi/ | 2022-02-01 00:39 | - | |
![[DIR]](/icons/folder.gif) | athenasoj/ | 2022-02-01 00:41 | - | |
![[DIR]](/icons/folder.gif) | blackquillsoj/ | 2022-02-01 00:44 | - | |
![[DIR]](/icons/folder.gif) | chelmey/ | 2022-02-01 00:44 | - | |
![[DIR]](/icons/folder.gif) | clive/ | 2022-02-01 00:45 | - | |
![[DIR]](/icons/folder.gif) | dimitri/ | 2022-02-01 00:46 | - | |
![[DIR]](/icons/folder.gif) | disciple/ | 2022-02-01 00:46 | - | |
![[DIR]](/icons/folder.gif) | don/ | 2022-02-01 00:47 | - | |
![[DIR]](/icons/folder.gif) | ema/ | 2022-02-01 00:47 | - | |
![[DIR]](/icons/folder.gif) | faris/ | 2022-02-01 00:47 | - | |
![[DIR]](/icons/folder.gif) | flora/ | 2022-02-01 00:48 | - | |
![[DIR]](/icons/folder.gif) | gina/ | 2022-02-01 00:49 | - | |
![[DIR]](/icons/folder.gif) | gotts/ | 2022-02-01 00:49 | - | |
![[DIR]](/icons/folder.gif) | gumshoe/ | 2022-02-01 00:50 | - | |
![[DIR]](/icons/folder.gif) | judge's bro/ | 2022-02-01 00:51 | - | |
![[DIR]](/icons/folder.gif) | male_tsumugi/ | 2022-02-01 00:56 | - | |
![[DIR]](/icons/folder.gif) | marlon rimes/ | 2022-02-01 00:57 | - | |
![[DIR]](/icons/folder.gif) | phoenixsoj/ | 2022-02-01 01:00 | - | |
![[DIR]](/icons/folder.gif) | yosuke/ | 2022-02-01 01:07 | - | |
![[DIR]](/icons/folder.gif) | yu/ | 2022-02-01 01:08 | - | |
![[DIR]](/icons/folder.gif) | yukiko/ | 2022-02-01 01:08 | - | |
![[DIR]](/icons/folder.gif) | yuki/ | 2022-02-01 01:15 | - | |
![[DIR]](/icons/folder.gif) | hajime/ | 2022-02-01 06:05 | - | |
![[DIR]](/icons/folder.gif) | hans adult/ | 2022-02-01 06:05 | - | |
![[DIR]](/icons/folder.gif) | hanten (mogeko)/ | 2022-02-01 06:05 | - | |
![[DIR]](/icons/folder.gif) | haori/ | 2022-02-01 06:05 | - | |
![[DIR]](/icons/folder.gif) | harmony (sevensirens)/ | 2022-02-01 06:05 | - | |
![[DIR]](/icons/folder.gif) | hasebercg/ | 2022-02-01 06:06 | - | |
![[DIR]](/icons/folder.gif) | hatsune miku/ | 2022-02-01 06:06 | - | |
![[DIR]](/icons/folder.gif) | hayasaka/ | 2022-02-01 06:06 | - | |
![[DIR]](/icons/folder.gif) | hazama/ | 2022-02-01 06:06 | - | |
![[DIR]](/icons/folder.gif) | hazama (pink)/ | 2022-02-01 06:07 | - | |
![[DIR]](/icons/folder.gif) | hibarircg/ | 2022-02-01 06:07 | - | |
![[DIR]](/icons/folder.gif) | hifumi/ | 2022-02-01 06:07 | - | |
![[DIR]](/icons/folder.gif) | hilda/ | 2022-02-01 06:08 | - | |
![[DIR]](/icons/folder.gif) | himiko/ | 2022-02-01 06:08 | - | |
![[DIR]](/icons/folder.gif) | hinako/ | 2022-02-01 06:08 | - | |
![[DIR]](/icons/folder.gif) | hiroshircg/ | 2022-02-01 06:08 | - | |
![[DIR]](/icons/folder.gif) | hiyoko/ | 2022-02-01 06:08 | - | |
![[DIR]](/icons/folder.gif) | hobophoenix/ | 2022-02-01 06:09 | - | |
![[DIR]](/icons/folder.gif) | hosonaga/ | 2022-02-01 06:09 | - | |
![[DIR]](/icons/folder.gif) | houshou marine/ | 2022-02-01 06:09 | - | |
![[DIR]](/icons/folder.gif) | hugh/ | 2022-02-01 06:10 | - | |
![[DIR]](/icons/folder.gif) | hutch windibank/ | 2022-02-01 06:10 | - | |
![[DIR]](/icons/folder.gif) | ia shishibe (ayakashiakashi)/ | 2022-02-01 06:10 | - | |
![[DIR]](/icons/folder.gif) | ibuki/ | 2022-02-01 06:10 | - | |
![[DIR]](/icons/folder.gif) | ibuki mioda alternative/ | 2022-02-01 06:10 | - | |
![[DIR]](/icons/folder.gif) | ichigo/ | 2022-02-01 06:11 | - | |
![[DIR]](/icons/folder.gif) | imika yuhjima (mogeko)/ | 2022-02-01 06:11 | - | |
![[DIR]](/icons/folder.gif) | inga/ | 2022-02-01 06:12 | - | |
![[DIR]](/icons/folder.gif) | ini/ | 2022-02-01 06:12 | - | |
![[DIR]](/icons/folder.gif) | inoob/ | 2022-02-01 06:12 | - | |
![[DIR]](/icons/folder.gif) | inosuke gbf/ | 2022-02-01 06:12 | - | |
![[DIR]](/icons/folder.gif) | iris/ | 2022-02-01 06:12 | - | |
![[DIR]](/icons/folder.gif) | ishimaru/ | 2022-02-01 06:13 | - | |
![[DIR]](/icons/folder.gif) | ishtar (rider)/ | 2022-02-01 06:13 | - | |
![[DIR]](/icons/folder.gif) | jade harley/ | 2022-02-01 06:13 | - | |
![[DIR]](/icons/folder.gif) | james moriarty/ | 2022-02-01 06:14 | - | |
![[DIR]](/icons/folder.gif) | jay elbird/ | 2022-02-01 06:14 | - | |
![[DIR]](/icons/folder.gif) | jeanne d'arc/ | 2022-02-01 06:14 | - | |
![[DIR]](/icons/folder.gif) | jeanne d'arc (alter)/ | 2022-02-01 06:14 | - | |
![[DIR]](/icons/folder.gif) | jeffrey master/ | 2022-02-01 16:41 | - | |
![[DIR]](/icons/folder.gif) | jezail/ | 2022-02-01 16:41 | - | |
![[DIR]](/icons/folder.gif) | jill/ | 2022-02-01 16:41 | - | |
![[DIR]](/icons/folder.gif) | jin/ | 2022-02-01 16:41 | - | |
![[DIR]](/icons/folder.gif) | jin kisaragi/ | 2022-02-01 16:41 | - | |
![[DIR]](/icons/folder.gif) | jing ke/ | 2022-02-01 16:42 | - | |
![[DIR]](/icons/folder.gif) | jinxie/ | 2022-02-01 16:42 | - | |
![[DIR]](/icons/folder.gif) | joan/ | 2022-02-01 16:43 | - | |
![[DIR]](/icons/folder.gif) | joe/ | 2022-02-01 16:43 | - | |
![[DIR]](/icons/folder.gif) | john egbert/ | 2022-02-01 16:44 | - | |
![[DIR]](/icons/folder.gif) | john garrideb/ | 2022-02-01 16:44 | - | |
![[DIR]](/icons/folder.gif) | john marsh/ | 2022-02-01 16:44 | - | |
![[DIR]](/icons/folder.gif) | joker (p5gb)/ | 2022-02-01 16:44 | - | |
![[DIR]](/icons/folder.gif) | jokerp5/ | 2022-02-01 16:44 | - | |
![[DIR]](/icons/folder.gif) | josephine/ | 2022-02-01 16:45 | - | |
![[DIR]](/icons/folder.gif) | joshua frx/ | 2022-02-01 16:45 | - | |
![[DIR]](/icons/folder.gif) | jubei/ | 2022-02-01 16:45 | - | |
![[DIR]](/icons/folder.gif) | judge/ | 2022-02-01 16:46 | - | |
![[DIR]](/icons/folder.gif) | judge gb/ | 2022-02-01 16:46 | - | |
![[DIR]](/icons/folder.gif) | judge gk2/ | 2022-02-01 16:46 | - | |
![[DIR]](/icons/folder.gif) | judgecalifornia/ | 2022-02-01 16:46 | - | |
![[DIR]](/icons/folder.gif) | judgekhura'in/ | 2022-02-01 16:46 | - | |
![[DIR]](/icons/folder.gif) | judgement/ | 2022-02-01 16:47 | - | |
![[DIR]](/icons/folder.gif) | june/ | 2022-02-01 16:47 | - | |
![[DIR]](/icons/folder.gif) | juniper/ | 2022-02-01 16:47 | - | |
![[DIR]](/icons/folder.gif) | junko/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | justice/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | justin/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | justine courtney/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | juzo megure/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | k/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | kadoc zemlupus fgo/ | 2022-02-01 16:48 | - | |
![[DIR]](/icons/folder.gif) | kaede/ | 2022-02-01 16:49 | - | |
![[DIR]](/icons/folder.gif) | kagari/ | 2022-02-01 16:49 | - | |
![[DIR]](/icons/folder.gif) | kagero (fefateshd)/ | 2022-02-01 16:49 | - | |
![[DIR]](/icons/folder.gif) | kai/ | 2022-02-01 16:49 | - | |
![[DIR]](/icons/folder.gif) | kaito/ | 2022-02-01 16:50 | - | |
![[DIR]](/icons/folder.gif) | kanji/ | 2022-02-01 16:50 | - | |
![[DIR]](/icons/folder.gif) | kanna/ | 2022-02-01 16:51 | - | |
![[DIR]](/icons/folder.gif) | kanon nty/ | 2022-02-01 16:51 | - | |
![[DIR]](/icons/folder.gif) | kaorircg/ | 2022-02-01 16:51 | - | |
![[DIR]](/icons/folder.gif) | kariya/ | 2022-02-01 16:52 | - | |
![[DIR]](/icons/folder.gif) | karuta uruwashi (ayakashiakashi)/ | 2022-02-01 16:52 | - | |
![[DIR]](/icons/folder.gif) | kashima akebono (ayakashiakashi)/ | 2022-02-01 16:52 | - | |
![[DIR]](/icons/folder.gif) | katherine hall/ | 2022-02-01 16:52 | - | |
![[DIR]](/icons/folder.gif) | kato danzo fgo/ | 2022-02-01 16:52 | - | |
![[DIR]](/icons/folder.gif) | katrielle layton/ | 2022-02-01 16:52 | - | |
![[DIR]](/icons/folder.gif) | kay/ | 2022-02-01 16:53 | - | |
![[DIR]](/icons/folder.gif) | kazuichi/ | 2022-02-01 16:53 | - | |
![[DIR]](/icons/folder.gif) | kazuma/ | 2022-02-01 16:53 | - | |
![[DIR]](/icons/folder.gif) | keiji/ | 2022-02-01 16:54 | - | |
![[DIR]](/icons/folder.gif) | keiki haniyasushin/ | 2022-02-01 16:54 | - | |
![[DIR]](/icons/folder.gif) | ken/ | 2022-02-01 16:55 | - | |
![[DIR]](/icons/folder.gif) | kenjircg/ | 2022-02-01 16:55 | - | |
![[DIR]](/icons/folder.gif) | kiibo/ | 2022-02-01 16:56 | - | |
![[DIR]](/icons/folder.gif) | killuazoldyck_dr/ | 2022-02-01 16:56 | - | |
![[DIR]](/icons/folder.gif) | kingdom hearts/ | 2022-02-01 16:57 | - | |
![[DIR]](/icons/folder.gif) | kira/ | 2022-02-01 16:57 | - | |
![[DIR]](/icons/folder.gif) | kirigiri/ | 2022-02-01 16:57 | - | |
![[DIR]](/icons/folder.gif) | kirumi/ | 2022-02-01 16:57 | - | |
![[DIR]](/icons/folder.gif) | kiryu coco/ | 2022-02-01 16:57 | - | |
![[DIR]](/icons/folder.gif) | kiryu moeka/ | 2022-02-01 16:58 | - | |
![[DIR]](/icons/folder.gif) | klavier/ | 2022-02-01 16:58 | - | |
![[DIR]](/icons/folder.gif) | klavier dd pro/ | 2022-02-01 16:59 | - | |
![[DIR]](/icons/folder.gif) | klavier young/ | 2022-02-01 16:59 | - | |
![[DIR]](/icons/folder.gif) | klonoa/ | 2022-02-01 16:59 | - | |
![[DIR]](/icons/folder.gif) | knightley/ | 2022-02-01 16:59 | - | |
![[DIR]](/icons/folder.gif) | koishi komeiji/ | 2022-02-01 16:59 | - | |
![[DIR]](/icons/folder.gif) | kokichi/ | 2022-02-01 17:01 | - | |
![[DIR]](/icons/folder.gif) | kokonoe/ | 2022-02-01 17:01 | - | |
![[DIR]](/icons/folder.gif) | kokoro/ | 2022-02-01 17:01 | - | |
![[DIR]](/icons/folder.gif) | komaru/ | 2022-02-01 17:02 | - | |
![[DIR]](/icons/folder.gif) | korekiyo/ | 2022-02-01 17:03 | - | |
![[DIR]](/icons/folder.gif) | kotoko/ | 2022-02-01 17:03 | - | |
![[DIR]](/icons/folder.gif) | kristoph/ | 2022-02-01 17:03 | - | |
![[DIR]](/icons/folder.gif) | kronya (3h)/ | 2022-02-01 17:03 | - | |
![[DIR]](/icons/folder.gif) | kudo/ | 2022-02-01 17:03 | - | |
![[DIR]](/icons/folder.gif) | kuniorcg/ | 2022-02-01 17:03 | - | |
![[DIR]](/icons/folder.gif) | kurisu/ | 2022-02-01 17:04 | - | |
![[DIR]](/icons/folder.gif) | kurotsuno (mogeko)/ | 2022-02-01 17:05 | - | |
![[DIR]](/icons/folder.gif) | kusama (tpb)/ | 2022-02-01 17:05 | - | |
![[DIR]](/icons/folder.gif) | kyojuro gbf/ | 2022-02-01 17:05 | - | |
![[DIR]](/icons/folder.gif) | kyokorcg/ | 2022-02-01 17:05 | - | |
![[DIR]](/icons/folder.gif) | kyouji (tpb)/ | 2022-02-01 17:05 | - | |
![[DIR]](/icons/folder.gif) | l/ | 2022-02-01 17:05 | - | |
![[DIR]](/icons/folder.gif) | labrys/ | 2022-02-01 17:06 | - | |
![[DIR]](/icons/folder.gif) | laby (elsword)/ | 2022-02-01 17:06 | - | |
![[DIR]](/icons/folder.gif) | lamiroir/ | 2022-02-01 17:06 | - | |
![[DIR]](/icons/folder.gif) | lana/ | 2022-02-01 17:07 | - | |
![[DIR]](/icons/folder.gif) | lanap/ | 2022-02-01 17:07 | - | |
![[DIR]](/icons/folder.gif) | lance amano/ | 2022-02-01 17:07 | - | |
![[DIR]](/icons/folder.gif) | lara triton/ | 2022-02-01 17:07 | - | |
![[DIR]](/icons/folder.gif) | larry/ | 2022-02-01 17:08 | - | |
![[DIR]](/icons/folder.gif) | larryik/ | 2022-02-01 17:09 | - | |
![[DIR]](/icons/folder.gif) | lauren paups/ | 2022-02-01 17:09 | - | |
![[DIR]](/icons/folder.gif) | layton/ | 2022-02-01 17:09 | - | |
![[DIR]](/icons/folder.gif) | layton evil/ | 2022-02-01 17:09 | - | |
![[DIR]](/icons/folder.gif) | layton inquisitor/ | 2022-02-01 17:09 | - | |
![[DIR]](/icons/folder.gif) | layton winter/ | 2022-02-01 17:10 | - | |
![[DIR]](/icons/folder.gif) | layton young/ | 2022-02-01 17:10 | - | |
![[DIR]](/icons/folder.gif) | laytonp/ | 2022-02-01 17:10 | - | |
![[DIR]](/icons/folder.gif) | lbelle/ | 2022-02-01 17:11 | - | |
![[DIR]](/icons/folder.gif) | lelouch/ | 2022-02-01 17:11 | - | |
![[DIR]](/icons/folder.gif) | leon/ | 2022-02-01 17:11 | - | |
![[DIR]](/icons/folder.gif) | letouse/ | 2022-02-01 17:11 | - | |
![[DIR]](/icons/folder.gif) | lieze (disgaea 5)/ | 2022-02-01 17:11 | - | |
![[DIR]](/icons/folder.gif) | linhardt (3h)/ | 2022-02-01 17:11 | - | |
![[DIR]](/icons/folder.gif) | linne/ | 2022-02-01 17:12 | - | |
![[DIR]](/icons/folder.gif) | lisa/ | 2022-02-01 17:12 | - | |
![[DIR]](/icons/folder.gif) | litchi faye ling/ | 2022-02-01 17:12 | - | |
![[DIR]](/icons/folder.gif) | lobstersiren (sevensirens)/ | 2022-02-01 17:13 | - | |
![[DIR]](/icons/folder.gif) | long lang/ | 2022-02-01 17:13 | - | |
![[DIR]](/icons/folder.gif) | lopunny/ | 2022-02-01 17:13 | - | |
![[DIR]](/icons/folder.gif) | loremaster/ | 2022-02-01 17:13 | - | |
![[DIR]](/icons/folder.gif) | lotta/ | 2022-02-01 17:13 | - | |
![[DIR]](/icons/folder.gif) | lotus/ | 2022-02-01 17:14 | - | |
![[DIR]](/icons/folder.gif) | lucifer/ | 2022-02-01 17:14 | - | |
![[DIR]](/icons/folder.gif) | lucina (awakening)/ | 2022-02-01 17:14 | - | |
![[DIR]](/icons/folder.gif) | lucy/ | 2022-02-01 17:14 | - | |
![[DIR]](/icons/folder.gif) | luka/ | 2022-02-01 17:15 | - | |
![[DIR]](/icons/folder.gif) | luke/ | 2022-02-01 17:15 | - | |
![[DIR]](/icons/folder.gif) | luna/ | 2022-02-01 17:16 | - | |
![[DIR]](/icons/folder.gif) | machi tobaye/ | 2022-02-01 17:16 | - | |
![[DIR]](/icons/folder.gif) | mae/ | 2022-02-01 17:16 | - | |
![[DIR]](/icons/folder.gif) | mafuyu asahina/ | 2022-02-01 17:19 | - | |
![[DIR]](/icons/folder.gif) | maggey/ | 2022-02-01 17:19 | - | |
![[DIR]](/icons/folder.gif) | mahiru/ | 2022-02-01 17:19 | - | |
![[DIR]](/icons/folder.gif) | maho/ | 2022-02-01 17:19 | - | |
![[DIR]](/icons/folder.gif) | mai/ | 2022-02-01 17:20 | - | |
![[DIR]](/icons/folder.gif) | mai natsume/ | 2022-02-01 17:20 | - | |
![[DIR]](/icons/folder.gif) | majorita (disgaea 5)/ | 2022-02-01 17:21 | - | |
![[DIR]](/icons/folder.gif) | makepeace/ | 2022-02-01 17:21 | - | |
![[DIR]](/icons/folder.gif) | maki/ | 2022-02-01 17:22 | - | |
![[DIR]](/icons/folder.gif) | makoto/ | 2022-02-01 17:22 | - | |
![[DIR]](/icons/folder.gif) | makoto nanaya/ | 2022-02-01 17:22 | - | |
![[DIR]](/icons/folder.gif) | malina/ | 2022-02-01 17:22 | - | |
![[DIR]](/icons/folder.gif) | mamemomi/ | 2022-02-01 17:23 | - | |
![[DIR]](/icons/folder.gif) | mamircg/ | 2022-02-01 17:23 | - | |
![[DIR]](/icons/folder.gif) | manfred/ | 2022-02-01 17:23 | - | |
![[DIR]](/icons/folder.gif) | manfred evil/ | 2022-02-01 17:23 | - | |
![[DIR]](/icons/folder.gif) | margaret/ | 2022-02-01 17:24 | - | |
![[DIR]](/icons/folder.gif) | maria/ | 2022-02-01 17:25 | - | |
![[DIR]](/icons/folder.gif) | marie/ | 2022-02-01 17:25 | - | |
![[DIR]](/icons/folder.gif) | mario/ | 2022-02-01 17:26 | - | |
![[DIR]](/icons/folder.gif) | marshall/ | 2022-02-01 17:26 | - | |
![[DIR]](/icons/folder.gif) | mashu kyrielight/ | 2022-02-01 17:27 | - | |
![[DIR]](/icons/folder.gif) | matilda/ | 2022-02-01 17:28 | - | |
![[DIR]](/icons/folder.gif) | matilda headset/ | 2022-02-01 17:28 | - | |
![[DIR]](/icons/folder.gif) | matsuda/ | 2022-02-01 17:29 | - | |
![[DIR]](/icons/folder.gif) | matt/ | 2022-02-01 17:29 | - | |
![[DIR]](/icons/folder.gif) | maurice/ | 2022-02-01 17:29 | - | |
![[DIR]](/icons/folder.gif) | max/ | 2022-02-01 17:30 | - | |
![[DIR]](/icons/folder.gif) | maya/ | 2022-02-01 17:30 | - | |
![[DIR]](/icons/folder.gif) | mayakid/ | 2022-02-01 17:30 | - | |
![[DIR]](/icons/folder.gif) | mayaplvsaa/ | 2022-02-01 17:30 | - | |
![[DIR]](/icons/folder.gif) | mayasoj/ | 2022-02-01 17:30 | - | |
![[DIR]](/icons/folder.gif) | mayuri/ | 2022-02-01 17:31 | - | |
![[DIR]](/icons/folder.gif) | means/ | 2022-02-01 17:31 | - | |
![[DIR]](/icons/folder.gif) | meekins/ | 2022-02-01 17:31 | - | |
![[DIR]](/icons/folder.gif) | megumi/ | 2022-02-01 17:33 | - | |
![[DIR]](/icons/folder.gif) | megumi frx/ | 2022-02-01 17:33 | - | |
![[DIR]](/icons/folder.gif) | megumin/ | 2022-02-01 17:34 | - | |
![[DIR]](/icons/folder.gif) | megundal/ | 2022-02-01 17:34 | - | |
![[DIR]](/icons/folder.gif) | meira/ | 2022-02-01 17:34 | - | |
![[DIR]](/icons/folder.gif) | meowth/ | 2022-02-01 17:34 | - | |
![[DIR]](/icons/folder.gif) | merlin/ | 2022-02-01 17:35 | - | |
![[DIR]](/icons/folder.gif) | met (mogeko)/ | 2022-02-01 17:35 | - | |
![[DIR]](/icons/folder.gif) | mia/ | 2022-02-01 17:36 | - | |
![[DIR]](/icons/folder.gif) | mia young/ | 2022-02-01 17:36 | - | |
![[DIR]](/icons/folder.gif) | midori/ | 2022-02-01 17:36 | - | |
![[DIR]](/icons/folder.gif) | mihokorcg/ | 2022-02-01 17:36 | - | |
![[DIR]](/icons/folder.gif) | mikan/ | 2022-02-01 17:37 | - | |
![[DIR]](/icons/folder.gif) | mike/ | 2022-02-01 17:37 | - | |
![[DIR]](/icons/folder.gif) | mila (echoes)/ | 2022-02-01 17:37 | - | |
![[DIR]](/icons/folder.gif) | miles/ | 2022-02-01 17:37 | - | |
![[DIR]](/icons/folder.gif) | mileskid/ | 2022-02-01 17:38 | - | |
![[DIR]](/icons/folder.gif) | milessoj/ | 2022-02-01 17:38 | - | |
![[DIR]](/icons/folder.gif) | miley/ | 2022-02-01 17:38 | - | |
![[DIR]](/icons/folder.gif) | mima/ | 2022-02-01 17:38 | - | |
![[DIR]](/icons/folder.gif) | misakorcg/ | 2022-02-01 17:38 | - | |
![[DIR]](/icons/folder.gif) | mishima/ | 2022-02-01 17:39 | - | |
![[DIR]](/icons/folder.gif) | misuzurcg/ | 2022-02-01 17:40 | - | |
![[DIR]](/icons/folder.gif) | mitsuki frx/ | 2022-02-01 17:40 | - | |
![[DIR]](/icons/folder.gif) | mitsuru/ | 2022-02-01 17:40 | - | |
![[DIR]](/icons/folder.gif) | mittlemont/ | 2022-02-01 17:41 | - | |
![[DIR]](/icons/folder.gif) | miu/ | 2022-02-01 17:42 | - | |
![[DIR]](/icons/folder.gif) | modeus/ | 2022-02-01 17:42 | - | |
![[DIR]](/icons/folder.gif) | moe/ | 2022-02-01 17:42 | - | |
![[DIR]](/icons/folder.gif) | moeka/ | 2022-02-01 17:42 | - | |
![[DIR]](/icons/folder.gif) | moge ko (mogeko)/ | 2022-02-01 17:42 | - | |
![[DIR]](/icons/folder.gif) | mogekos (mogeko)/ | 2022-02-01 17:43 | - | |
![[DIR]](/icons/folder.gif) | monaca/ | 2022-02-01 17:43 | - | |
![[DIR]](/icons/folder.gif) | mondo/ | 2022-02-01 17:43 | - | |
![[DIR]](/icons/folder.gif) | monica (3h)/ | 2022-02-01 17:43 | - | |
![[DIR]](/icons/folder.gif) | monokuma/ | 2022-02-01 17:44 | - | |
![[DIR]](/icons/folder.gif) | mordred/ | 2022-02-01 17:44 | - | |
![[DIR]](/icons/folder.gif) | morgan/ | 2022-02-01 17:45 | - | |
![[DIR]](/icons/folder.gif) | morganap5/ | 2022-02-01 17:45 | - | |
![[DIR]](/icons/folder.gif) | mrhat/ | 2022-02-01 17:45 | - | |
![[DIR]](/icons/folder.gif) | mutantheart/ | 2022-02-01 17:45 | - | |
![[DIR]](/icons/folder.gif) | mysterious heroine x (alter) fgo/ | 2022-02-01 17:45 | - | |
![[DIR]](/icons/folder.gif) | mysterious heroine x fgo/ | 2022-02-01 17:45 | - | |
![[DIR]](/icons/folder.gif) | nae/ | 2022-02-01 17:46 | - | |
![[DIR]](/icons/folder.gif) | naegi/ | 2022-02-01 17:46 | - | |
![[DIR]](/icons/folder.gif) | nagi (tpb)/ | 2022-02-01 17:46 | - | |
![[DIR]](/icons/folder.gif) | nagi nty/ | 2022-02-01 17:46 | - | |
![[DIR]](/icons/folder.gif) | nagito/ | 2022-02-01 17:47 | - | |
![[DIR]](/icons/folder.gif) | nahyuta/ | 2022-02-01 17:47 | - | |
![[DIR]](/icons/folder.gif) | nakabachi/ | 2022-02-01 17:47 | - | |
![[DIR]](/icons/folder.gif) | naki kokuriko (ayakashiakashi)/ | 2022-02-01 17:47 | - | |
![[DIR]](/icons/folder.gif) | nana/ | 2022-02-01 17:48 | - | |
![[DIR]](/icons/folder.gif) | nao/ | 2022-02-01 17:48 | - | |
![[DIR]](/icons/folder.gif) | naomi/ | 2022-02-01 17:49 | - | |
![[DIR]](/icons/folder.gif) | naoto/ | 2022-02-01 17:49 | - | |
![[DIR]](/icons/folder.gif) | naoto kurogane/ | 2022-02-01 17:49 | - | |
![[DIR]](/icons/folder.gif) | naoya (tpb)/ | 2022-02-01 17:50 | - | |
![[DIR]](/icons/folder.gif) | naritakarcg/ | 2022-02-01 17:50 | - | |
![[DIR]](/icons/folder.gif) | narrator/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | narratordgs/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | nataka kurokawa (mogeko)/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | near/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | necos/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | neil/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | nekomaru/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | neku/ | 2022-02-01 17:51 | - | |
![[DIR]](/icons/folder.gif) | nemmy tinpillar/ | 2022-02-01 17:52 | - | |
![[DIR]](/icons/folder.gif) | nero claudius/ | 2022-02-01 17:53 | - | |
![[DIR]](/icons/folder.gif) | newman/ | 2022-02-01 17:53 | - | |
![[DIR]](/icons/folder.gif) | nezuko gbf/ | 2022-02-01 17:54 | - | |
![[DIR]](/icons/folder.gif) | nicole swift/ | 2022-02-01 17:54 | - | |
![[DIR]](/icons/folder.gif) | nikomina/ | 2022-02-01 17:54 | - | |
![[DIR]](/icons/folder.gif) | nine the phantom/ | 2022-02-01 17:54 | - | |
![[DIR]](/icons/folder.gif) | ninthman/ | 2022-02-01 17:54 | - | |
![[DIR]](/icons/folder.gif) | noah (elsword)/ | 2022-02-01 17:54 | - | |
![[DIR]](/icons/folder.gif) | nobunaga/ | 2022-02-01 17:56 | - | |
![[DIR]](/icons/folder.gif) | noel vermillion/ | 2022-02-01 17:56 | - | |
![[DIR]](/icons/folder.gif) | noizercg/ | 2022-02-01 17:56 | - | |
![[DIR]](/icons/folder.gif) | nue houjuu/ | 2022-02-01 17:56 | - | |
![[DIR]](/icons/folder.gif) | o'malley/ | 2022-02-01 17:57 | - | |
![[DIR]](/icons/folder.gif) | octopath traveler/ | 2022-02-01 17:57 | - | |
![[DIR]](/icons/folder.gif) | okabe/ | 2022-02-01 17:58 | - | |
![[DIR]](/icons/folder.gif) | okita souji/ | 2022-02-01 17:58 | - | |
![[DIR]](/icons/folder.gif) | okita souji (alter)/ | 2022-02-01 17:59 | - | |
![[DIR]](/icons/folder.gif) | oldbag/ | 2022-02-01 18:00 | - | |
![[DIR]](/icons/folder.gif) | olga marie/ | 2022-02-01 18:00 | - | |
![[DIR]](/icons/folder.gif) | olivia/ | 2022-02-01 18:00 | - | |
![[DIR]](/icons/folder.gif) | orca/ | 2022-02-01 18:00 | - | |
![[DIR]](/icons/folder.gif) | orla/ | 2022-02-01 18:00 | - | |
![[DIR]](/icons/folder.gif) | oscar fairplay/ | 2022-02-01 18:00 | - | |
![[DIR]](/icons/folder.gif) | oscar fairplay juror/ | 2022-02-01 18:01 | - | |
![[DIR]](/icons/folder.gif) | palutena (hd) (uprising)/ | 2022-02-01 18:01 | - | |
![[DIR]](/icons/folder.gif) | pandemonica/ | 2022-02-01 18:01 | - | |
![[DIR]](/icons/folder.gif) | paper mario/ | 2022-02-01 18:01 | - | |
![[DIR]](/icons/folder.gif) | parker/ | 2022-02-01 18:02 | - | |
![[DIR]](/icons/folder.gif) | patricia/ | 2022-02-01 18:02 | - | |
![[DIR]](/icons/folder.gif) | patrick/ | 2022-02-01 18:02 | - | |
![[DIR]](/icons/folder.gif) | paul atishon/ | 2022-02-01 18:02 | - | |
![[DIR]](/icons/folder.gif) | payne max/ | 2022-02-01 18:03 | - | |
![[DIR]](/icons/folder.gif) | payne soj/ | 2022-02-01 18:03 | - | |
![[DIR]](/icons/folder.gif) | payne train v2/ | 2022-02-01 18:03 | - | |
![[DIR]](/icons/folder.gif) | Payne3D/ | 2022-02-01 18:03 | - | |
![[DIR]](/icons/folder.gif) | pearl/ | 2022-02-01 18:03 | - | |
![[DIR]](/icons/folder.gif) | pearlsoj/ | 2022-02-01 18:04 | - | |
![[DIR]](/icons/folder.gif) | peko/ | 2022-02-01 18:04 | - | |
![[DIR]](/icons/folder.gif) | penny/ | 2022-02-01 18:04 | - | |
![[DIR]](/icons/folder.gif) | peppe vessicchio/ | 2022-02-01 18:04 | - | |
![[DIR]](/icons/folder.gif) | phi/ | 2022-02-01 18:05 | - | |
![[DIR]](/icons/folder.gif) | phoenix/ | 2022-02-01 18:05 | - | |
![[DIR]](/icons/folder.gif) | phoenix hobo def/ | 2022-02-01 18:06 | - | |
![[DIR]](/icons/folder.gif) | phoenix young/ | 2022-02-01 18:06 | - | |
![[DIR]](/icons/folder.gif) | phoenixhd/ | 2022-02-01 18:07 | - | |
![[DIR]](/icons/folder.gif) | pierce/ | 2022-02-01 18:09 | - | |
![[DIR]](/icons/folder.gif) | pit (hd) (uprising)/ | 2022-02-01 18:09 | - | |
![[DIR]](/icons/folder.gif) | pizzard/ | 2022-02-01 18:09 | - | |
![[DIR]](/icons/folder.gif) | platinum the trinity/ | 2022-02-01 18:09 | - | |
![[DIR]](/icons/folder.gif) | plink (sevensirens)/ | 2022-02-01 18:10 | - | |
![[DIR]](/icons/folder.gif) | plum kitaki/ | 2022-02-01 18:10 | - | |
![[DIR]](/icons/folder.gif) | polly/ | 2022-02-01 18:10 | - | |
![[DIR]](/icons/folder.gif) | ponco/ | 2022-02-01 18:10 | - | |
![[DIR]](/icons/folder.gif) | portsman/ | 2022-02-01 18:10 | - | |
![[DIR]](/icons/folder.gif) | postal dude/ | 2022-02-01 18:10 | - | |
![[DIR]](/icons/folder.gif) | professor guedes/ | 2022-02-01 18:11 | - | |
![[DIR]](/icons/folder.gif) | prove/ | 2022-02-01 18:12 | - | |
![[DIR]](/icons/folder.gif) | psychelocks/ | 2022-02-01 18:12 | - | |
![[DIR]](/icons/folder.gif) | q-taro/ | 2022-02-01 18:12 | - | |
![[DIR]](/icons/folder.gif) | quark/ | 2022-02-01 18:13 | - | |
![[DIR]](/icons/folder.gif) | queen/ | 2022-02-01 18:13 | - | |
![[DIR]](/icons/folder.gif) | rachel alucard/ | 2022-02-01 18:13 | - | |
![[DIR]](/icons/folder.gif) | ragna/ | 2022-02-01 18:14 | - | |
![[DIR]](/icons/folder.gif) | ramsey murdoch/ | 2022-02-01 18:14 | - | |
![[DIR]](/icons/folder.gif) | ran mouri/ | 2022-02-01 18:14 | - | |
![[DIR]](/icons/folder.gif) | ranger/ | 2022-02-01 18:15 | - | |
![[DIR]](/icons/folder.gif) | ranmaru/ | 2022-02-01 18:15 | - | |
![[DIR]](/icons/folder.gif) | ranpo edogawa/ | 2022-02-01 18:16 | - | |
![[DIR]](/icons/folder.gif) | rantaro/ | 2022-02-01 18:16 | - | |
![[DIR]](/icons/folder.gif) | raven (elsword)/ | 2022-02-01 18:16 | - | |
![[DIR]](/icons/folder.gif) | rayfa/ | 2022-02-01 18:16 | - | |
![[DIR]](/icons/folder.gif) | raymond/ | 2022-02-01 18:17 | - | |
![[DIR]](/icons/folder.gif) | re-l mayer/ | 2022-02-01 18:17 | - | |
![[DIR]](/icons/folder.gif) | red magnus (disgaea 5)/ | 2022-02-01 18:17 | - | |
![[DIR]](/icons/folder.gif) | regina/ | 2022-02-01 18:18 | - | |
![[DIR]](/icons/folder.gif) | reines/ | 2022-02-01 18:18 | - | |
![[DIR]](/icons/folder.gif) | reko/ | 2022-02-01 18:18 | - | |
![[DIR]](/icons/folder.gif) | relius-clover/ | 2022-02-01 18:19 | - | |
![[DIR]](/icons/folder.gif) | rem rezero/ | 2022-02-01 18:20 | - | |
![[DIR]](/icons/folder.gif) | rena (elsword)/ | 2022-02-01 18:20 | - | |
![[DIR]](/icons/folder.gif) | retinz/ | 2022-02-01 18:21 | - | |
![[DIR]](/icons/folder.gif) | rhea (3h)/ | 2022-02-01 18:21 | - | |
![[DIR]](/icons/folder.gif) | rhoda teneiro/ | 2022-02-01 18:21 | - | |
![[DIR]](/icons/folder.gif) | rhyme frx/ | 2022-02-01 18:22 | - | |
![[DIR]](/icons/folder.gif) | richard/ | 2022-02-01 18:22 | - | |
![[DIR]](/icons/folder.gif) | ridelle/ | 2022-02-01 18:22 | - | |
![[DIR]](/icons/folder.gif) | rikircg/ | 2022-02-01 18:22 | - | |
![[DIR]](/icons/folder.gif) | riku takasou (ayakashiakashi)/ | 2022-02-01 18:23 | - | |
![[DIR]](/icons/folder.gif) | rindo nty/ | 2022-02-01 18:23 | - | |
![[DIR]](/icons/folder.gif) | rinea (echoes)/ | 2022-02-01 18:24 | - | |
![[DIR]](/icons/folder.gif) | rinnosuke morichika/ | 2022-02-01 18:24 | - | |
![[DIR]](/icons/folder.gif) | rise/ | 2022-02-01 18:25 | - | |
![[DIR]](/icons/folder.gif) | riskyboots/ | 2022-02-01 18:26 | - | |
![[DIR]](/icons/folder.gif) | riskyboots (sevensirens)/ | 2022-02-01 18:26 | - | |
![[DIR]](/icons/folder.gif) | robin (f) (awakening)/ | 2022-02-01 18:27 | - | |
![[DIR]](/icons/folder.gif) | robin (m) (awakening)/ | 2022-02-01 18:27 | - | |
![[DIR]](/icons/folder.gif) | robin hood fgo/ | 2022-02-01 18:27 | - | |
![[DIR]](/icons/folder.gif) | rokuro yamaguchi (ayakashiakashi)/ | 2022-02-01 18:27 | - | |
![[DIR]](/icons/folder.gif) | romani fgo/ | 2022-02-01 18:28 | - | |
![[DIR]](/icons/folder.gif) | ron/ | 2022-02-01 18:28 | - | |
![[DIR]](/icons/folder.gif) | roscoe/ | 2022-02-01 18:29 | - | |
![[DIR]](/icons/folder.gif) | rose (elsword)/ | 2022-02-01 18:29 | - | |
![[DIR]](/icons/folder.gif) | rottytops/ | 2022-02-01 18:29 | - | |
![[DIR]](/icons/folder.gif) | rottytops (sevensirens)/ | 2022-02-01 18:29 | - | |
![[DIR]](/icons/folder.gif) | roylott/ | 2022-02-01 18:29 | - | |
![[DIR]](/icons/folder.gif) | rozaic/ | 2022-02-01 18:31 | - | |
![[DIR]](/icons/folder.gif) | ruby rose/ | 2022-02-01 18:31 | - | |
![[DIR]](/icons/folder.gif) | rufus/ | 2022-02-01 18:31 | - | |
![[DIR]](/icons/folder.gif) | rumba/ | 2022-02-01 18:32 | - | |
![[DIR]](/icons/folder.gif) | ryoma/ | 2022-02-01 18:32 | - | |
![[DIR]](/icons/folder.gif) | ryuji sakamoto/ | 2022-02-01 18:32 | - | |
![[DIR]](/icons/folder.gif) | ryuunosuke/ | 2022-02-01 18:33 | - | |
![[DIR]](/icons/folder.gif) | ryuutarou/ | 2022-02-01 18:34 | - | |
![[DIR]](/icons/folder.gif) | saber/ | 2022-02-01 18:34 | - | |
![[DIR]](/icons/folder.gif) | sabukorcg/ | 2022-02-01 18:35 | - | |
![[DIR]](/icons/folder.gif) | safalin/ | 2022-02-01 18:35 | - | |
![[DIR]](/icons/folder.gif) | sahwit/ | 2022-02-01 18:35 | - | |
![[DIR]](/icons/folder.gif) | sailor/ | 2022-02-01 18:35 | - | |
![[DIR]](/icons/folder.gif) | saki/ | 2022-02-01 18:35 | - | |
![[DIR]](/icons/folder.gif) | sakihata rimi/ | 2022-02-01 18:36 | - | |
![[DIR]](/icons/folder.gif) | sakura/ | 2022-02-01 18:37 | - | |
![[DIR]](/icons/folder.gif) | sal/ | 2022-02-01 18:37 | - | |
![[DIR]](/icons/folder.gif) | samekichi/ | 2022-02-01 18:37 | - | |
![[DIR]](/icons/folder.gif) | santa/ | 2022-02-01 18:38 | - | |
![[DIR]](/icons/folder.gif) | sara/ | 2022-02-01 18:39 | - | |
![[DIR]](/icons/folder.gif) | sarge/ | 2022-02-01 18:39 | - | |
![[DIR]](/icons/folder.gif) | sasha/ | 2022-02-01 18:39 | - | |
![[DIR]](/icons/folder.gif) | sayaka/ | 2022-02-01 18:40 | - | |
![[DIR]](/icons/folder.gif) | scuttlebutt/ | 2022-02-01 18:40 | - | |
![[DIR]](/icons/folder.gif) | sebastian/ | 2022-02-01 18:40 | - | |
![[DIR]](/icons/folder.gif) | seishirou/ | 2022-02-01 18:40 | - | |
![[DIR]](/icons/folder.gif) | senji muramasa/ | 2022-02-01 18:41 | - | |
![[DIR]](/icons/folder.gif) | seraphina (disgaea 5)/ | 2022-02-01 18:42 | - | |
![[DIR]](/icons/folder.gif) | sesena kanou (ayakashiakashi)/ | 2022-02-01 18:42 | - | |
![[DIR]](/icons/folder.gif) | seteth (3h)/ | 2022-02-01 18:42 | - | |
![[DIR]](/icons/folder.gif) | seth/ | 2022-02-01 18:44 | - | |
![[DIR]](/icons/folder.gif) | seven/ | 2022-02-01 18:45 | - | |
![[DIR]](/icons/folder.gif) | shantae/ | 2022-02-01 18:45 | - | |
![[DIR]](/icons/folder.gif) | shantae (sevensirens)/ | 2022-02-01 18:45 | - | |
![[DIR]](/icons/folder.gif) | sherlock/ | 2022-02-01 18:48 | - | |
![[DIR]](/icons/folder.gif) | sherlock fgo/ | 2022-02-01 18:49 | - | |
![[DIR]](/icons/folder.gif) | shido/ | 2022-02-01 18:49 | - | |
![[DIR]](/icons/folder.gif) | shih-na/ | 2022-02-01 18:49 | - | |
![[DIR]](/icons/folder.gif) | shiki frx/ | 2022-02-01 18:49 | - | |
![[DIR]](/icons/folder.gif) | shinichi kudo/ | 2022-02-01 18:49 | - | |
![[DIR]](/icons/folder.gif) | shinjiro aragaki/ | 2022-02-01 18:50 | - | |
![[DIR]](/icons/folder.gif) | shinobu gbf/ | 2022-02-01 18:50 | - | |
![[DIR]](/icons/folder.gif) | shinya kurai (mogeko)/ | 2022-02-01 18:50 | - | |
![[DIR]](/icons/folder.gif) | shiv/ | 2022-02-01 18:50 | - | |
![[DIR]](/icons/folder.gif) | sho minazuki/ | 2022-02-01 18:50 | - | |
![[DIR]](/icons/folder.gif) | shoka nty/ | 2022-02-01 18:50 | - | |
![[DIR]](/icons/folder.gif) | shominamimoto frx/ | 2022-02-01 18:51 | - | |
![[DIR]](/icons/folder.gif) | shuichi/ | 2022-02-01 18:52 | - | |
![[DIR]](/icons/folder.gif) | shuji ikutsuki/ | 2022-02-01 18:52 | - | |
![[DIR]](/icons/folder.gif) | sig/ | 2022-02-01 18:52 | - | |
![[DIR]](/icons/folder.gif) | simon/ | 2022-02-01 18:53 | - | |
![[DIR]](/icons/folder.gif) | sirhan dogen/ | 2022-02-01 18:53 | - | |
![[DIR]](/icons/folder.gif) | sithe/ | 2022-02-01 18:54 | - | |
![[DIR]](/icons/folder.gif) | skullmageddonrcg/ | 2022-02-01 18:54 | - | |
![[DIR]](/icons/folder.gif) | sky/ | 2022-02-01 18:54 | - | |
![[DIR]](/icons/folder.gif) | sky (sevensirens)/ | 2022-02-01 18:54 | - | |
![[DIR]](/icons/folder.gif) | smiles/ | 2022-02-01 18:54 | - | |
![[DIR]](/icons/folder.gif) | snake/ | 2022-02-01 18:55 | - | |
![[DIR]](/icons/folder.gif) | snow/ | 2022-02-01 18:55 | - | |
![[DIR]](/icons/folder.gif) | sonia/ | 2022-02-01 18:55 | - | |
![[DIR]](/icons/folder.gif) | sonohigurashi/ | 2022-02-01 18:56 | - | |
![[DIR]](/icons/folder.gif) | sora/ | 2022-02-01 18:56 | - | |
![[DIR]](/icons/folder.gif) | sorin/ | 2022-02-01 18:56 | - | |
![[DIR]](/icons/folder.gif) | sothis (3h)/ | 2022-02-01 18:56 | - | |
![[DIR]](/icons/folder.gif) | sou/ | 2022-02-01 18:56 | - | |
![[DIR]](/icons/folder.gif) | souseki/ | 2022-02-01 18:57 | - | |
![[DIR]](/icons/folder.gif) | spark/ | 2022-02-01 18:57 | - | |
![[DIR]](/icons/folder.gif) | squidsmith (sevensirens)/ | 2022-02-01 18:58 | - | |
![[DIR]](/icons/folder.gif) | starbuck/ | 2022-02-01 18:58 | - | |
![[DIR]](/icons/folder.gif) | stroganov/ | 2022-02-01 18:58 | - | |
![[DIR]](/icons/folder.gif) | suisei hoshimachi/ | 2022-02-01 18:58 | - | |
![[DIR]](/icons/folder.gif) | sumire (tpb)/ | 2022-02-01 18:59 | - | |
![[DIR]](/icons/folder.gif) | sunny (omori)/ | 2022-02-01 18:59 | - | |
![[DIR]](/icons/folder.gif) | supportreaper/ | 2022-02-01 18:59 | - | |
![[DIR]](/icons/folder.gif) | susano'o/ | 2022-02-01 18:59 | - | |
![[DIR]](/icons/folder.gif) | susato/ | 2022-02-01 19:00 | - | |
![[DIR]](/icons/folder.gif) | suzuha/ | 2022-02-01 19:01 | - | |
![[DIR]](/icons/folder.gif) | tahrust/ | 2022-02-01 19:02 | - | |
![[DIR]](/icons/folder.gif) | taiga (toradora)/ | 2022-02-01 19:02 | - | |
![[DIR]](/icons/folder.gif) | tanjiro gbf/ | 2022-02-01 19:02 | - | |
![[DIR]](/icons/folder.gif) | taokaka/ | 2022-02-01 19:02 | - | |
![[DIR]](/icons/folder.gif) | tatsuya suou/ | 2022-02-01 19:02 | - | |
![[DIR]](/icons/folder.gif) | ted/ | 2022-02-01 19:02 | - | |
![[DIR]](/icons/folder.gif) | teddie/ | 2022-02-01 19:03 | - | |
![[DIR]](/icons/folder.gif) | tenko/ | 2022-02-01 19:03 | - | |
![[DIR]](/icons/folder.gif) | tenma/ | 2022-02-01 19:03 | - | |
![[DIR]](/icons/folder.gif) | tenmyouji/ | 2022-02-01 19:04 | - | |
![[DIR]](/icons/folder.gif) | teruteru/ | 2022-02-01 19:04 | - | |
![[DIR]](/icons/folder.gif) | tetsu (tpb)/ | 2022-02-01 19:04 | - | |
![[DIR]](/icons/folder.gif) | the batter/ | 2022-02-01 19:04 | - | |
![[DIR]](/icons/folder.gif) | the king/ | 2022-02-01 19:04 | - | |
![[DIR]](/icons/folder.gif) | thomas/ | 2022-02-01 19:05 | - | |
![[DIR]](/icons/folder.gif) | tina etuprika (ayakashiakashi)/ | 2022-02-01 19:05 | - | |
![[DIR]](/icons/folder.gif) | yuyuko saigyouji/ | 2022-02-01 19:37 | - | |
![[DIR]](/icons/folder.gif) | battle/ | 2022-02-01 19:38 | - | |
![[DIR]](/icons/folder.gif) | aradia/ | 2022-02-10 22:27 | - | |
![[DIR]](/icons/folder.gif) | ayinlc/ | 2022-02-10 22:28 | - | |
![[DIR]](/icons/folder.gif) | binahlc/ | 2022-02-10 22:28 | - | |
![[DIR]](/icons/folder.gif) | carmenlc/ | 2022-02-10 22:28 | - | |
![[DIR]](/icons/folder.gif) | chesedlc/ | 2022-02-10 22:28 | - | |
![[DIR]](/icons/folder.gif) | eiru_neo/ | 2022-02-10 22:28 | - | |
![[DIR]](/icons/folder.gif) | geburalc/ | 2022-02-10 22:29 | - | |
![[DIR]](/icons/folder.gif) | hanekoma frx/ | 2022-02-10 22:30 | - | |
![[DIR]](/icons/folder.gif) | hodlc/ | 2022-02-10 22:30 | - | |
![[DIR]](/icons/folder.gif) | hokmalc/ | 2022-02-10 22:31 | - | |
![[DIR]](/icons/folder.gif) | kanon_neo/ | 2022-02-10 22:31 | - | |
![[DIR]](/icons/folder.gif) | laetitialc/ | 2022-02-10 22:31 | - | |
![[DIR]](/icons/folder.gif) | malkuthlc/ | 2022-02-10 22:31 | - | |
![[DIR]](/icons/folder.gif) | melita cavallo/ | 2022-02-10 22:32 | - | |
![[DIR]](/icons/folder.gif) | mona/ | 2022-02-10 22:32 | - | |
![[DIR]](/icons/folder.gif) | myolc/ | 2022-02-10 22:32 | - | |
![[DIR]](/icons/folder.gif) | netzachlc/ | 2022-02-10 22:32 | - | |
![[DIR]](/icons/folder.gif) | phoenixwit/ | 2022-02-10 22:32 | - | |
![[DIR]](/icons/folder.gif) | tipherethalc/ | 2022-02-10 22:33 | - | |
![[DIR]](/icons/folder.gif) | tipherethblc/ | 2022-02-10 22:33 | - | |
![[DIR]](/icons/folder.gif) | tyzias entykk (hsf)/ | 2022-02-10 22:33 | - | |
![[DIR]](/icons/folder.gif) | yesodlc/ | 2022-02-10 22:33 | - | |
![[DIR]](/icons/folder.gif) | abellc/ | 2022-02-10 22:34 | - | |
![[DIR]](/icons/folder.gif) | abramlc/ | 2022-02-10 22:34 | - | |
![[DIR]](/icons/folder.gif) | adamlc/ | 2022-02-10 22:34 | - | |
![[DIR]](/icons/folder.gif) | angelalc/ | 2022-02-10 22:34 | - | |
![[DIR]](/icons/folder.gif) | watanabe you/ | 2022-02-15 20:33 | - | |
![[DIR]](/icons/folder.gif) | urumi ushizaki/ | 2022-02-15 20:35 | - | |
![[DIR]](/icons/folder.gif) | yuuka kazami/ | 2022-02-15 20:36 | - | |
![[DIR]](/icons/folder.gif) | tokiko/ | 2022-02-15 20:37 | - | |
![[DIR]](/icons/folder.gif) | zach/ | 2022-02-15 20:40 | - | |
![[DIR]](/icons/folder.gif) | zero/ | 2022-02-15 20:43 | - | |
![[DIR]](/icons/folder.gif) | weiss/ | 2022-02-15 20:44 | - | |
![[DIR]](/icons/folder.gif) | wagner/ | 2022-02-15 20:45 | - | |
![[DIR]](/icons/folder.gif) | yang/ | 2022-02-15 20:46 | - | |
![[DIR]](/icons/folder.gif) | yuuki terumi/ | 2022-02-15 20:46 | - | |
![[DIR]](/icons/folder.gif) | yuzuriha/ | 2022-02-15 20:47 | - | |
![[DIR]](/icons/folder.gif) | tsumugi/ | 2022-02-15 20:48 | - | |
![[DIR]](/icons/folder.gif) | zdrada/ | 2022-02-15 20:51 | - | |
![[DIR]](/icons/folder.gif) | yodai frx/ | 2022-02-15 20:52 | - | |
![[DIR]](/icons/folder.gif) | uzuki frx/ | 2022-02-15 20:53 | - | |
![[DIR]](/icons/folder.gif) | touko/ | 2022-02-15 20:55 | - | |
![[DIR]](/icons/folder.gif) | twogami/ | 2022-02-15 20:55 | - | |
![[DIR]](/icons/folder.gif) | toko/ | 2022-02-15 20:56 | - | |
![[DIR]](/icons/folder.gif) | yasuhiro/ | 2022-02-15 20:56 | - | |
![[DIR]](/icons/folder.gif) | zero manzanka (ayakashiakashi)/ | 2022-02-15 20:57 | - | |
![[DIR]](/icons/folder.gif) | white/ | 2022-02-15 20:57 | - | |
![[DIR]](/icons/folder.gif) | willp/ | 2022-02-15 20:58 | - | |
![[DIR]](/icons/folder.gif) | vasquez/ | 2022-02-15 20:58 | - | |
![[DIR]](/icons/folder.gif) | yanni/ | 2022-02-15 20:59 | - | |
![[DIR]](/icons/folder.gif) | wellington/ | 2022-02-15 20:59 | - | |
![[DIR]](/icons/folder.gif) | viola/ | 2022-02-15 21:00 | - | |
![[DIR]](/icons/folder.gif) | trucy/ | 2022-02-15 21:01 | - | |
![[DIR]](/icons/folder.gif) | trucy young/ | 2022-02-15 21:01 | - | |
![[DIR]](/icons/folder.gif) | zak/ | 2022-02-15 21:03 | - | |
![[DIR]](/icons/folder.gif) | winfred kitaki/ | 2022-02-15 21:04 | - | |
![[DIR]](/icons/folder.gif) | wocky kitaki/ | 2022-02-15 21:04 | - | |
![[DIR]](/icons/folder.gif) | wesley stickler/ | 2022-02-15 21:05 | - | |
![[DIR]](/icons/folder.gif) | valant/ | 2022-02-15 21:05 | - | |
![[DIR]](/icons/folder.gif) | vinnie/ | 2022-02-15 21:05 | - | |
![[DIR]](/icons/folder.gif) | vulper/ | 2022-02-15 21:06 | - | |
![[DIR]](/icons/folder.gif) | yonaka kurai (mogeko)/ | 2022-02-15 21:06 | - | |
![[DIR]](/icons/folder.gif) | waver velvet/ | 2022-02-15 21:07 | - | |
![[DIR]](/icons/folder.gif) | vera/ | 2022-02-15 21:08 | - | |
![[DIR]](/icons/folder.gif) | zapple (sevensirens)/ | 2022-02-15 21:08 | - | |
![[DIR]](/icons/folder.gif) | usalia (disgaea 5)/ | 2022-02-15 21:08 | - | |
![[DIR]](/icons/folder.gif) | zeroken (disgaea 5)/ | 2022-02-15 21:10 | - | |
![[DIR]](/icons/folder.gif) | treat/ | 2022-02-15 21:10 | - | |
![[DIR]](/icons/folder.gif) | yakuzarcg/ | 2022-02-15 21:11 | - | |
![[DIR]](/icons/folder.gif) | yamadarcg/ | 2022-02-15 21:11 | - | |
![[DIR]](/icons/folder.gif) | zangetsu (bleach)/ | 2022-02-15 21:12 | - | |
![[DIR]](/icons/folder.gif) | violet evergarden/ | 2022-02-15 21:13 | - | |
![[DIR]](/icons/folder.gif) | zeroapz/ | 2022-02-15 21:13 | - | |
![[DIR]](/icons/folder.gif) | yotobi/ | 2022-02-15 21:14 | - | |
![[DIR]](/icons/folder.gif) | void dark (disgaea 5)/ | 2022-02-15 21:20 | - | |
![[DIR]](/icons/folder.gif) | zhuge liang/ | 2022-02-15 21:23 | - | |
![[DIR]](/icons/folder.gif) | akihiko/ | 2022-02-22 21:43 | - | |
![[DIR]](/icons/folder.gif) | aigis/ | 2022-02-22 21:47 | - | |
![[DIR]](/icons/folder.gif) | arcueid/ | 2022-02-22 21:49 | - | |
![[DIR]](/icons/folder.gif) | tobias gregson/ | 2022-03-07 15:01 | - | |
![[DIR]](/icons/folder.gif) | tully tinpillar/ | 2022-03-07 15:02 | - | |
![[DIR]](/icons/folder.gif) | uzukumaru/ | 2022-03-07 15:03 | - | |
![[DIR]](/icons/folder.gif) | venus/ | 2022-03-07 15:06 | - | |
![[DIR]](/icons/folder.gif) | viridian/ | 2022-03-07 15:06 | - | |
![[DIR]](/icons/folder.gif) | vortex/ | 2022-03-07 15:06 | - | |
![[DIR]](/icons/folder.gif) | vortex judge/ | 2022-03-07 15:07 | - | |
![[DIR]](/icons/folder.gif) | william/ | 2022-03-07 15:09 | - | |
![[DIR]](/icons/folder.gif) | yuujin mikotoba/ | 2022-03-07 15:10 | - | |
![[DIR]](/icons/folder.gif) | (pc) akira mosakuji/ | 2022-03-19 21:03 | - | |
![[DIR]](/icons/folder.gif) | (pc) aoi futaba/ | 2022-03-19 21:03 | - | |
![[DIR]](/icons/folder.gif) | (pc) djeeta/ | 2022-03-19 21:03 | - | |
![[DIR]](/icons/folder.gif) | (pc) eriko/ | 2022-03-19 21:04 | - | |
![[DIR]](/icons/folder.gif) | (pc) io hasekura/ | 2022-03-19 21:04 | - | |
![[DIR]](/icons/folder.gif) | (pc) mitsuki yoigahama/ | 2022-03-19 21:04 | - | |
![[DIR]](/icons/folder.gif) | (pc) ninon/ | 2022-03-19 21:05 | - | |
![[DIR]](/icons/folder.gif) | (pc) nozomi sakurai/ | 2022-03-19 21:05 | - | |
![[DIR]](/icons/folder.gif) | (pc) pecorine/ | 2022-03-19 21:06 | - | |
![[DIR]](/icons/folder.gif) | (pc) ruuka tomi/ | 2022-03-19 21:07 | - | |
![[DIR]](/icons/folder.gif) | (pc) saren sasaki/ | 2022-03-19 21:07 | - | |
![[DIR]](/icons/folder.gif) | (pc) shinobu kamiki/ | 2022-03-19 21:08 | - | |
![[DIR]](/icons/folder.gif) | (pc) shiori kashiwazaki/ | 2022-03-19 21:08 | - | |
![[DIR]](/icons/folder.gif) | (pc) shizuru hoshino/ | 2022-03-19 21:08 | - | |
![[DIR]](/icons/folder.gif) | (pc) yukari ayase/ | 2022-03-19 21:09 | - | |
![[DIR]](/icons/folder.gif) | adell/ | 2022-03-19 21:09 | - | |
![[DIR]](/icons/folder.gif) | apollowit/ | 2022-03-19 21:09 | - | |
![[DIR]](/icons/folder.gif) | athena2d/ | 2022-03-19 21:10 | - | |
![[DIR]](/icons/folder.gif) | bruno/ | 2022-03-19 21:10 | - | |
![[DIR]](/icons/folder.gif) | ciel/ | 2022-03-19 21:11 | - | |
![[DIR]](/icons/folder.gif) | cloud/ | 2022-03-19 21:11 | - | |
![[DIR]](/icons/folder.gif) | cu chulainn (smt)/ | 2022-03-19 21:11 | - | |
![[DIR]](/icons/folder.gif) | demon (smt)/ | 2022-03-19 21:11 | - | |
![[DIR]](/icons/folder.gif) | etna/ | 2022-03-19 21:13 | - | |
![[DIR]](/icons/folder.gif) | flonne/ | 2022-03-19 21:13 | - | |
![[DIR]](/icons/folder.gif) | momoyo (majikoi)/ | 2022-03-19 21:13 | - | |
![[DIR]](/icons/folder.gif) | prinny/ | 2022-03-19 21:15 | - | |
![[DIR]](/icons/folder.gif) | rozalin/ | 2022-03-19 21:15 | - | |
![[DIR]](/icons/folder.gif) | sweetheart/ | 2022-03-19 21:15 | - | |
![[DIR]](/icons/folder.gif) | tatsuya shiba/ | 2022-03-19 21:15 | - | |
![[DIR]](/icons/folder.gif) | tifa/ | 2022-03-19 21:15 | - | |
![[DIR]](/icons/folder.gif) | titania (smt)/ | 2022-03-19 21:16 | - | |
![[DIR]](/icons/folder.gif) | vyers/ | 2022-03-19 21:16 | - | |
![[DIR]](/icons/folder.gif) | yukimaru/ | 2022-03-19 21:16 | - | |
![[DIR]](/icons/folder.gif) | mary/ | 2022-04-15 21:39 | - | |
![[DIR]](/icons/folder.gif) | mysterious girl/ | 2022-04-15 21:45 | - | |
![[DIR]](/icons/folder.gif) | misaki shokuhou/ | 2022-04-18 09:32 | - | |
![[DIR]](/icons/folder.gif) | ai ootori/ | 2022-04-18 09:33 | - | |
![[DIR]](/icons/folder.gif) | antinomy/ | 2022-04-18 09:33 | - | |
![[DIR]](/icons/folder.gif) | elsa (r;z)/ | 2022-04-18 09:34 | - | |
![[DIR]](/icons/folder.gif) | garry/ | 2022-04-18 09:34 | - | |
![[DIR]](/icons/folder.gif) | joey claire/ | 2022-04-18 09:34 | - | |
![[DIR]](/icons/folder.gif) | magilou/ | 2022-04-18 09:34 | - | |
![[DIR]](/icons/folder.gif) | mallek adalov/ | 2022-04-18 09:34 | - | |
![[DIR]](/icons/folder.gif) | raphael/ | 2022-04-18 09:35 | - | |
![[DIR]](/icons/folder.gif) | swat/ | 2022-04-18 09:35 | - | |
![[DIR]](/icons/folder.gif) | tegiri kalbur/ | 2022-04-18 09:35 | - | |
![[DIR]](/icons/folder.gif) | xiaolor/ | 2022-04-18 09:35 | - | |
![[DIR]](/icons/folder.gif) | yusei (yugioh)/ | 2022-04-18 09:35 | - | |
![[DIR]](/icons/folder.gif) | dr. arach/ | 2022-04-18 18:40 | - | |
![[DIR]](/icons/folder.gif) | aki/ | 2022-04-19 20:48 | - | |
![[DIR]](/icons/folder.gif) | nagi su ragarl/ | 2022-05-19 19:49 | - | |
![[DIR]](/icons/folder.gif) | kugie/ | 2022-05-22 12:11 | - | |
![[DIR]](/icons/folder.gif) | neopolitan/ | 2022-05-22 12:12 | - | |
![[DIR]](/icons/folder.gif) | alice liddell/ | 2022-05-22 12:16 | - | |
![[DIR]](/icons/folder.gif) | angela sephirah (lor)/ | 2022-05-22 12:18 | - | |
![[DIR]](/icons/folder.gif) | cathy/ | 2022-05-22 12:19 | - | |
![[DIR]](/icons/folder.gif) | copandon dott/ | 2022-05-22 12:19 | - | |
![[DIR]](/icons/folder.gif) | hazuki nty/ | 2022-05-22 12:19 | - | |
![[DIR]](/icons/folder.gif) | honoka nty/ | 2022-05-22 12:19 | - | |
![[DIR]](/icons/folder.gif) | joshua nty/ | 2022-05-22 12:19 | - | |
![[DIR]](/icons/folder.gif) | kaie nty/ | 2022-05-22 12:19 | - | |
![[DIR]](/icons/folder.gif) | komi shouko/ | 2022-05-22 12:20 | - | |
![[DIR]](/icons/folder.gif) | lia leazas/ | 2022-05-22 12:20 | - | |
![[DIR]](/icons/folder.gif) | oliver/ | 2022-05-22 12:24 | - | |
![[DIR]](/icons/folder.gif) | richard miller/ | 2022-05-22 12:24 | - | |
![[DIR]](/icons/folder.gif) | rizna lanfbitt/ | 2022-05-22 12:25 | - | |
![[DIR]](/icons/folder.gif) | setsuna/ | 2022-05-22 12:25 | - | |
![[DIR]](/icons/folder.gif) | shizuka masou/ | 2022-05-22 12:25 | - | |
![[DIR]](/icons/folder.gif) | tsugumi nty/ | 2022-05-22 12:25 | - | |
![[DIR]](/icons/folder.gif) | wolfgang schreiber/ | 2022-05-22 12:25 | - | |
![[DIR]](/icons/folder.gif) | yan (lor)/ | 2022-05-22 12:25 | - | |
![[DIR]](/icons/folder.gif) | emi/ | 2022-06-09 19:42 | - | |
![[DIR]](/icons/folder.gif) | caren hortensia (fgo)/ | 2022-06-27 23:14 | - | |
![[DIR]](/icons/folder.gif) | anastasia nikolaevna romanova (fgo)/ | 2022-06-27 23:15 | - | |
![[DIR]](/icons/folder.gif) | tamamo no mae (fgo)/ | 2022-06-29 20:02 | - | |
![[DIR]](/icons/folder.gif) | blanc (spirit pledge)/ | 2022-06-30 10:06 | - | |
![[DIR]](/icons/folder.gif) | dana/ | 2022-06-30 10:08 | - | |
![[DIR]](/icons/folder.gif) | dorothy/ | 2022-06-30 10:08 | - | |
![[DIR]](/icons/folder.gif) | emiya (fgo)/ | 2022-06-30 10:10 | - | |
![[DIR]](/icons/folder.gif) | ereshkigal (fgo)/ | 2022-06-30 10:12 | - | |
![[DIR]](/icons/folder.gif) | fujino asagami (fgo)/ | 2022-06-30 10:13 | - | |
![[DIR]](/icons/folder.gif) | gawain (fgo)/ | 2022-06-30 10:14 | - | |
![[DIR]](/icons/folder.gif) | gillian/ | 2022-06-30 10:15 | - | |
![[DIR]](/icons/folder.gif) | gordon/ | 2022-06-30 10:15 | - | |
![[DIR]](/icons/folder.gif) | jennifer/ | 2022-06-30 10:15 | - | |
![[DIR]](/icons/folder.gif) | kurumi tokisaki (spirit pledge)/ | 2022-06-30 10:16 | - | |
![[DIR]](/icons/folder.gif) | mamiya takuji/ | 2022-06-30 10:17 | - | |
![[DIR]](/icons/folder.gif) | maria arusu (spirit pledge)/ | 2022-06-30 10:18 | - | |
![[DIR]](/icons/folder.gif) | marina arusu (spirit pledge)/ | 2022-06-30 10:18 | - | |
![[DIR]](/icons/folder.gif) | miku izayoi (spirit pledge)/ | 2022-06-30 10:19 | - | |
![[DIR]](/icons/folder.gif) | morgan le fay (fgo)/ | 2022-06-30 10:22 | - | |
![[DIR]](/icons/folder.gif) | natsumi (spirit pledge)/ | 2022-06-30 10:23 | - | |
![[DIR]](/icons/folder.gif) | neptune (spirit pledge)/ | 2022-06-30 10:24 | - | |
![[DIR]](/icons/folder.gif) | noire (spirit pledge)/ | 2022-06-30 10:25 | - | |
![[DIR]](/icons/folder.gif) | otonashi ayana/ | 2022-06-30 10:27 | - | |
![[DIR]](/icons/folder.gif) | parvati (fgo)/ | 2022-06-30 10:31 | - | |
![[DIR]](/icons/folder.gif) | queen medb (fgo)/ | 2022-06-30 10:33 | - | |
![[DIR]](/icons/folder.gif) | scathach (fgo)/ | 2022-06-30 10:35 | - | |
![[DIR]](/icons/folder.gif) | stella/ | 2022-06-30 10:36 | - | |
![[DIR]](/icons/folder.gif) | streaming-chan/ | 2022-06-30 10:37 | - | |
![[DIR]](/icons/folder.gif) | vert (spirit pledge)/ | 2022-06-30 10:41 | - | |
![[DIR]](/icons/folder.gif) | yamamoto rangi/ | 2022-06-30 10:41 | - | |
![[DIR]](/icons/folder.gif) | aizome noel/ | 2022-06-30 10:41 | - | |
![[DIR]](/icons/folder.gif) | aozaki aoko/ | 2022-06-30 10:43 | - | |
![[DIR]](/icons/folder.gif) | barghest (fgo)/ | 2022-06-30 10:44 | - | |
![[DIR]](/icons/folder.gif) | nezha fgo/ | 2022-07-02 22:23 | - | |
![[DIR]](/icons/folder.gif) | nitocris fgo/ | 2022-07-02 22:24 | - | |
![[DIR]](/icons/folder.gif) | shuten douji/ | 2022-07-02 22:25 | - | |
![[DIR]](/icons/folder.gif) | skadi fgo/ | 2022-07-02 22:26 | - | |
![[DIR]](/icons/folder.gif) | tomoe gozen fgo/ | 2022-07-02 22:27 | - | |
![[DIR]](/icons/folder.gif) | anne bonny and mary read/ | 2022-07-02 22:28 | - | |
![[DIR]](/icons/folder.gif) | artoria pendragon/ | 2022-07-02 22:31 | - | |
![[DIR]](/icons/folder.gif) | artoria pendragon (lancer alter)/ | 2022-07-02 22:33 | - | |
![[DIR]](/icons/folder.gif) | artoria pendragon (alter)/ | 2022-07-02 22:34 | - | |
![[DIR]](/icons/folder.gif) | artoria pendragon (lancer)/ | 2022-07-02 22:35 | - | |
![[DIR]](/icons/folder.gif) | bradamante fgo/ | 2022-07-02 22:36 | - | |
![[DIR]](/icons/folder.gif) | brynhildr fgo/ | 2022-07-02 22:37 | - | |
![[DIR]](/icons/folder.gif) | kama fgo/ | 2022-07-02 22:39 | - | |
![[DIR]](/icons/folder.gif) | kiara sessyoin fgo/ | 2022-07-02 22:40 | - | |
![[DIR]](/icons/folder.gif) | kiyohime (fgo)/ | 2022-07-02 22:42 | - | |
![[DIR]](/icons/folder.gif) | koyanskaya fgo/ | 2022-07-02 22:43 | - | |
![[DIR]](/icons/folder.gif) | murasaki shikibu fgo/ | 2022-07-02 22:45 | - | |
![[DIR]](/icons/folder.gif) | nagao kagetora fgo/ | 2022-07-02 22:46 | - | |
![[DIR]](/icons/folder.gif) | vritra fgo/ | 2022-08-23 20:40 | - | |
![[DIR]](/icons/folder.gif) | xefros/ | 2023-05-07 16:05 | - | |
![[DIR]](/icons/folder.gif) | zebede/ | 2023-05-07 16:05 | - | |
![[DIR]](/icons/folder.gif) | zoe_ex/ | 2023-05-07 16:05 | - | |
![[DIR]](/icons/folder.gif) | amy (tmosth)/ | 2023-05-07 16:05 | - | |
![[DIR]](/icons/folder.gif) | blaze (tmosth)/ | 2023-05-07 16:05 | - | |
![[DIR]](/icons/folder.gif) | brian/ | 2023-05-07 16:06 | - | |
![[DIR]](/icons/folder.gif) | calculester/ | 2023-05-07 16:06 | - | |
![[DIR]](/icons/folder.gif) | chixie/ | 2023-05-07 16:06 | - | |
![[DIR]](/icons/folder.gif) | cirava/ | 2023-05-07 16:06 | - | |
![[DIR]](/icons/folder.gif) | conductor (tmosth)/ | 2023-05-07 16:06 | - | |
![[DIR]](/icons/folder.gif) | damien lavey/ | 2023-05-07 16:07 | - | |
![[DIR]](/icons/folder.gif) | doc/ | 2023-05-07 16:07 | - | |
![[DIR]](/icons/folder.gif) | dojima/ | 2023-05-07 16:07 | - | |
![[DIR]](/icons/folder.gif) | dunning/ | 2023-05-07 16:07 | - | |
![[DIR]](/icons/folder.gif) | espio (tmosth)/ | 2023-05-07 16:07 | - | |
![[DIR]](/icons/folder.gif) | galekh/ | 2023-05-07 16:07 | - | |
![[DIR]](/icons/folder.gif) | katsushika hokusai/ | 2023-05-07 16:08 | - | |
![[DIR]](/icons/folder.gif) | knuckles (tmosth)/ | 2023-05-07 16:08 | - | |
![[DIR]](/icons/folder.gif) | kurumada/ | 2023-05-07 16:09 | - | |
![[DIR]](/icons/folder.gif) | kyle/ | 2023-05-07 16:10 | - | |
![[DIR]](/icons/folder.gif) | liam/ | 2023-05-07 16:10 | - | |
![[DIR]](/icons/folder.gif) | mallek adalov (fs2)/ | 2023-05-07 16:11 | - | |
![[DIR]](/icons/folder.gif) | marsti/ | 2023-05-07 16:11 | - | |
![[DIR]](/icons/folder.gif) | mila/ | 2023-05-07 16:11 | - | |
![[DIR]](/icons/folder.gif) | miranda/ | 2023-05-07 16:11 | - | |
![[DIR]](/icons/folder.gif) | mspa/ | 2023-05-07 16:12 | - | |
![[DIR]](/icons/folder.gif) | oz/ | 2023-05-07 16:12 | - | |
![[DIR]](/icons/folder.gif) | polly (monster prom)/ | 2023-05-07 16:12 | - | |
![[DIR]](/icons/folder.gif) | polypa goezee (fs2)/ | 2023-05-07 16:12 | - | |
![[DIR]](/icons/folder.gif) | rin tohsaka/ | 2023-05-07 16:13 | - | |
![[DIR]](/icons/folder.gif) | rouge (tmosth)/ | 2023-05-07 16:13 | - | |
![[DIR]](/icons/folder.gif) | scott/ | 2023-05-07 16:13 | - | |
![[DIR]](/icons/folder.gif) | shadow (tmosth)/ | 2023-05-07 16:13 | - | |
![[DIR]](/icons/folder.gif) | skylla/ | 2023-05-07 16:13 | - | |
![[DIR]](/icons/folder.gif) | sonic (tmosth)/ | 2023-05-07 16:13 | - | |
![[DIR]](/icons/folder.gif) | tagora/ | 2023-05-07 16:14 | - | |
![[DIR]](/icons/folder.gif) | tanaka/ | 2023-05-07 16:14 | - | |
![[DIR]](/icons/folder.gif) | tegiri/ | 2023-05-07 16:14 | - | |
![[DIR]](/icons/folder.gif) | vector (tmosth)/ | 2023-05-07 16:14 | - | |
![[DIR]](/icons/folder.gif) | vera (monster prom)/ | 2023-05-07 16:14 | - | |
![[DIR]](/icons/folder.gif) | vicky/ | 2023-05-07 16:15 | - | |
![[DIR]](/icons/folder.gif) | solaria/ | 2023-05-07 16:16 | - | |
![[DIR]](/icons/folder.gif) | tails (tmosth)/ | 2023-07-08 16:05 | - | |
![[DIR]](/icons/folder.gif) | tavros nitram (pq)/ | 2023-08-04 15:05 | - | |
![[DIR]](/icons/folder.gif) | valtel gurtea (pq)/ | 2023-08-04 15:06 | - | |
![[DIR]](/icons/folder.gif) | cr-s01/ | 2023-08-04 15:06 | - | |
![[DIR]](/icons/folder.gif) | eridan ampora (pq)/ | 2023-08-04 15:07 | - | |
![[DIR]](/icons/folder.gif) | helen parker/ | 2023-08-04 15:22 | - | |
![[DIR]](/icons/folder.gif) | iris (hd)/ | 2023-08-04 15:23 | - | |
![[DIR]](/icons/folder.gif) | jeff angel/ | 2023-08-04 15:24 | - | |
![[DIR]](/icons/folder.gif) | kanaya maryam (pq)/ | 2023-08-04 15:25 | - | |
![[DIR]](/icons/folder.gif) | louis denonno/ | 2023-08-04 15:30 | - | |
![[DIR]](/icons/folder.gif) | maria torres/ | 2023-08-04 15:31 | - | |
![[DIR]](/icons/folder.gif) | martin summer/ | 2023-08-04 15:31 | - | |
![[DIR]](/icons/folder.gif) | marvus xoloto (hsf)/ | 2023-08-04 15:32 | - | |
![[DIR]](/icons/folder.gif) | melissa woodward/ | 2023-08-04 15:32 | - | |
![[DIR]](/icons/folder.gif) | navel/ | 2023-08-04 15:33 | - | |
![[DIR]](/icons/folder.gif) | nemo (libraryofruina)/ | 2023-08-04 15:33 | - | |
![[DIR]](/icons/folder.gif) | neon violet/ | 2023-08-04 15:33 | - | |
![[DIR]](/icons/folder.gif) | neon white/ | 2023-08-04 15:33 | - | |
![[DIR]](/icons/folder.gif) | rosa fox/ | 2023-08-04 15:34 | - | |
![[DIR]](/icons/folder.gif) | sollux captor (pq)/ | 2023-08-04 15:34 | - | |
![[DIR]](/icons/folder.gif) | rose lalonde (pq)/ | 2023-08-04 15:34 | - | |
![[DIR]](/icons/folder.gif) | akiha tohno (tsukihime)/ | 2023-08-04 16:11 | - | |
![[DIR]](/icons/folder.gif) | karkat vantas (pq)/ | 2023-08-04 16:59 | - | |
![[DIR]](/icons/folder.gif) | Lara Triton/ | 2023-08-18 19:28 | - | |
![[DIR]](/icons/folder.gif) | chahut maenad (hsf)/ | 2023-08-24 19:48 | - | |
![[DIR]](/icons/folder.gif) | amekangeldevil/ | 2023-08-24 19:49 | - | |
![[DIR]](/icons/folder.gif) | asougimaskhd/ | 2023-08-24 19:51 | - | |
![[DIR]](/icons/folder.gif) | asougiprohd/ | 2023-08-24 19:52 | - | |
![[DIR]](/icons/folder.gif) | aumtzi maught/ | 2023-08-24 19:53 | - | |
![[DIR]](/icons/folder.gif) | azdaja knelax (hsf)/ | 2023-08-24 19:53 | - | |
![[DIR]](/icons/folder.gif) | fozzer velyes (hsf)/ | 2023-08-24 19:53 | - | |
![[DIR]](/icons/folder.gif) | gerbat batrav/ | 2023-08-24 19:53 | - | |
![[DIR]](/icons/folder.gif) | glomer hicner/ | 2023-08-24 19:53 | - | |
![[DIR]](/icons/folder.gif) | ingram/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | charun krojib (hsf)/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | chixie roixmr (hsf)/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | cirava hermod (hsf)/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | darklawhd/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | diemen xicali (hsf)/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | elwurd (hsf)/ | 2023-08-24 19:54 | - | |
![[DIR]](/icons/folder.gif) | jeanboy/ | 2023-08-24 19:55 | - | |
![[DIR]](/icons/folder.gif) | jeangirl/ | 2023-08-24 19:55 | - | |
![[DIR]](/icons/folder.gif) | karako pierot (hsf)/ | 2023-08-24 19:55 | - | |
![[DIR]](/icons/folder.gif) | kuprum maxlol (hsf)/ | 2023-08-24 19:55 | - | |
![[DIR]](/icons/folder.gif) | lanque bombyx (hsf)/ | 2023-08-24 19:56 | - | |
![[DIR]](/icons/folder.gif) | leo shishigami hd/ | 2023-08-24 19:56 | - | |
![[DIR]](/icons/folder.gif) | lettie/ | 2023-08-24 19:56 | - | |
![[DIR]](/icons/folder.gif) | madeline hd/ | 2023-08-24 19:57 | - | |
![[DIR]](/icons/folder.gif) | milkchan/ | 2023-08-24 19:57 | - | |
![[DIR]](/icons/folder.gif) | vikare ratite (hsf)/ | 2023-08-24 19:57 | - | |
![[DIR]](/icons/folder.gif) | morshu rtx/ | 2023-08-24 19:58 | - | |
![[DIR]](/icons/folder.gif) | nahyutahd/ | 2023-08-24 19:59 | - | |
![[DIR]](/icons/folder.gif) | occeus coliad/ | 2023-08-24 19:59 | - | |
![[DIR]](/icons/folder.gif) | rayfahd/ | 2023-08-24 20:00 | - | |
![[DIR]](/icons/folder.gif) | ryunosukehd/ | 2023-08-24 20:00 | - | |
![[DIR]](/icons/folder.gif) | ryunosukewitness/ | 2023-08-24 20:01 | - | |
![[DIR]](/icons/folder.gif) | sherlockhd/ | 2023-08-24 20:01 | - | |
![[DIR]](/icons/folder.gif) | tagora gorjek (hsf)/ | 2023-08-24 20:02 | - | |
![[DIR]](/icons/folder.gif) | theodore (p3)/ | 2023-08-24 20:02 | - | |
![[DIR]](/icons/folder.gif) | xefros tritoh (hs) ex/ | 2023-08-24 20:02 | - | |
![[DIR]](/icons/folder.gif) | yukari takeba (p3)/ | 2023-08-24 20:02 | - | |
![[DIR]](/icons/folder.gif) | zebruh codakk (hsf)/ | 2023-08-24 20:02 | - | |
![[DIR]](/icons/folder.gif) | vortexjud/ | 2023-08-24 20:03 | - | |
![[DIR]](/icons/folder.gif) | vortexwit/ | 2023-08-24 20:04 | - | |
![[DIR]](/icons/folder.gif) | morshu/ | 2023-08-24 20:52 | - | |
![[DIR]](/icons/folder.gif) | asougidefhd/ | 2023-08-24 20:53 | - | |
![[DIR]](/icons/folder.gif) | susatohd/ | 2023-09-16 15:50 | - | |
![[DIR]](/icons/folder.gif) | tomoe tachibana (traumateam)/ | 2023-09-16 15:51 | - | |
![[DIR]](/icons/folder.gif) | zenin maki (gbf)/ | 2023-09-16 15:51 | - | |
![[DIR]](/icons/folder.gif) | aoi todo (gbf)/ | 2023-09-16 15:51 | - | |
![[DIR]](/icons/folder.gif) | fushiguro megumi (gbf)/ | 2023-09-16 15:51 | - | |
![[DIR]](/icons/folder.gif) | gabriel cunningham (traumateam)/ | 2023-09-16 15:51 | - | |
![[DIR]](/icons/folder.gif) | hank freebird (traumateam)/ | 2023-09-16 15:52 | - | |
![[DIR]](/icons/folder.gif) | itadori yuji (gbf)/ | 2023-09-16 15:52 | - | |
![[DIR]](/icons/folder.gif) | ivel/ | 2023-09-16 15:52 | - | |
![[DIR]](/icons/folder.gif) | joebiden/ | 2023-09-16 15:52 | - | |
![[DIR]](/icons/folder.gif) | kaiji itou/ | 2023-09-16 15:52 | - | |
![[DIR]](/icons/folder.gif) | kugisaki nobara (gbf)/ | 2023-09-16 15:53 | - | |
![[DIR]](/icons/folder.gif) | naomi kimishima (traumateam)/ | 2023-09-16 15:53 | - | |
![[DIR]](/icons/folder.gif) | niko/ | 2023-09-16 15:54 | - | |
![[DIR]](/icons/folder.gif) | satoru gojo (gbf)/ | 2023-09-16 15:55 | - | |
![[DIR]](/icons/folder.gif) | seiya ichijou/ | 2023-09-16 15:55 | - | |
![[DIR]](/icons/folder.gif) | susatodlchd/ | 2023-09-16 15:56 | - | |
![[DIR]](/icons/folder.gif) | neon yellow/ | 2023-09-16 15:59 | - | |
![[DIR]](/icons/folder.gif) | neon green/ | 2023-09-16 16:00 | - | |
![[DIR]](/icons/folder.gif) | saul goodman/ | 2023-09-16 16:51 | - | |
![[DIR]](/icons/folder.gif) | moxxie/ | 2023-09-18 19:29 | - | |
![[DIR]](/icons/folder.gif) | relativo/ | 2023-09-18 19:30 | - | |
![[DIR]](/icons/folder.gif) | norton campbell (idv)/ | 2023-10-28 20:20 | - | |
![[DIR]](/icons/folder.gif) | robbie white (idv)/ | 2023-10-28 20:20 | - | |
![[DIR]](/icons/folder.gif) | saya/ | 2023-10-28 20:20 | - | |
![[DIR]](/icons/folder.gif) | sei/ | 2023-10-28 20:21 | - | |
![[DIR]](/icons/folder.gif) | victor grantz (idv)/ | 2023-10-28 20:21 | - | |
![[DIR]](/icons/folder.gif) | virgilio/ | 2023-10-28 20:22 | - | |
![[DIR]](/icons/folder.gif) | anna/ | 2023-10-28 20:22 | - | |
![[DIR]](/icons/folder.gif) | art/ | 2023-10-28 20:22 | - | |
![[DIR]](/icons/folder.gif) | beatrice(va11)/ | 2023-10-28 20:22 | - | |
![[DIR]](/icons/folder.gif) | deal/ | 2023-10-28 20:23 | - | |
![[DIR]](/icons/folder.gif) | donovan/ | 2023-10-28 20:23 | - | |
![[DIR]](/icons/folder.gif) | eli clark (idv)/ | 2023-10-28 20:23 | - | |
![[DIR]](/icons/folder.gif) | emma woods (idv)/ | 2023-10-28 20:23 | - | |
![[DIR]](/icons/folder.gif) | gabriella/ | 2023-10-28 20:23 | - | |
![[DIR]](/icons/folder.gif) | jamie/ | 2023-10-28 20:23 | - | |
![[DIR]](/icons/folder.gif) | joseph desaulniers (idv)/ | 2023-10-28 20:24 | - | |
![[DIR]](/icons/folder.gif) | kimberly/ | 2023-10-28 20:24 | - | |
![[DIR]](/icons/folder.gif) | kira miki/ | 2023-10-28 20:24 | - | |
![[DIR]](/icons/folder.gif) | lenore/ | 2023-10-28 20:24 | - | |
![[DIR]](/icons/folder.gif) | luca balsa (idv)/ | 2023-10-28 20:25 | - | |
![[DIR]](/icons/folder.gif) | marie antoinette (idv)/ | 2023-10-28 20:25 | - | |
![[DIR]](/icons/folder.gif) | mario(va11)/ | 2023-10-28 20:25 | - | |
![[DIR]](/icons/folder.gif) | bully maguire/ | 2024-01-28 02:36 | - | |
![[DIR]](/icons/folder.gif) | kevin woodward/ | 2024-01-28 02:37 | - | |
![[DIR]](/icons/folder.gif) | popee/ | 2024-01-28 02:38 | - | |
![[DIR]](/icons/folder.gif) | felicity/ | 2024-01-28 02:45 | - | |
![[DIR]](/icons/folder.gif) | laytonhd/ | 2024-01-28 02:51 | - | |
![[DIR]](/icons/folder.gif) | shinji matou/ | 2024-01-28 02:53 | - | |
![[DIR]](/icons/folder.gif) | wadanohara/ | 2024-01-28 03:26 | - | |
![[DIR]](/icons/folder.gif) | trucy pro/ | 2024-04-19 16:11 | - | |
![[DIR]](/icons/folder.gif) | olga orly/ | 2024-04-19 16:35 | - | |
![[DIR]](/icons/folder.gif) | trucy soj/ | 2024-04-20 10:57 | - | |
![[DIR]](/icons/folder.gif) | yuri/ | 2024-04-20 10:59 | - | |
![[DIR]](/icons/folder.gif) | uendo/ | 2024-04-20 11:04 | - | |
![[DIR]](/icons/folder.gif) | armie/ | 2024-04-20 11:06 | - | |
![[DIR]](/icons/folder.gif) | zinc lablanc/ | 2024-04-20 11:07 | - | |
![[DIR]](/icons/folder.gif) | yew/ | 2024-04-20 11:08 | - | |
![[DIR]](/icons/folder.gif) | tyrell badd/ | 2024-04-20 11:09 | - | |
![[DIR]](/icons/folder.gif) | quercus alba/ | 2024-04-20 11:16 | - | |
![[DIR]](/icons/folder.gif) | iris watson/ | 2024-04-20 11:21 | - | |
|