![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1-blacklock-break.opus | 2022-02-01 01:35 | 32K | |
| 1-blacklock-end.opus | 2022-02-01 01:35 | 31K | |
| 1-lock-break.opus | 2022-02-01 01:35 | 7.2K | |
| 1-lock-end.opus | 2022-02-01 01:35 | 18K | |
| 1-lock-start.opus | 2022-02-01 01:35 | 11K | |
| 1.opus | 2022-02-01 01:35 | 3.3K | |
| 2-lock-break.opus | 2022-02-01 01:35 | 10K | |
| 2-lock-end.opus | 2022-02-01 01:35 | 20K | |
| 2-lock-start.opus | 2022-02-01 01:35 | 14K | |
| 3-lock-break.opus | 2022-02-01 01:35 | 12K | |
| 3-lock-end.opus | 2022-02-01 01:35 | 21K | |
| 3-lock-start.opus | 2022-02-01 01:35 | 15K | |
| 4-lock-break.opus | 2022-02-01 01:35 | 15K | |
| 4-lock-end.opus | 2022-02-01 01:35 | 25K | |
| 4-lock-start.opus | 2022-02-01 01:35 | 16K | |
| 5-blacklock-end.opus | 2022-02-01 01:35 | 59K | |
| 5-lock-end.opus | 2022-02-01 01:35 | 66K | |
| 5-lock-start.opus | 2022-02-01 01:35 | 17K | |
| 999-redcount.opus | 2022-02-01 01:35 | 3.3K | |
| Ichigo/ | 2022-02-01 02:01 | - | |
| aa-april-wryfemale.opus | 2022-02-01 01:35 | 28K | |
| aa-crackle.opus | 2022-02-01 01:35 | 4.1K | |
| aa-redd-bling.opus | 2022-02-01 01:35 | 12K | |
| aaaaaaaaagh.mp3 | 2024-01-28 02:54 | 51K | |
| aai-alba-breakdown.opus | 2022-02-01 01:35 | 62K | |
| aai-alba-damage.opus | 2022-02-01 01:35 | 10K | |
| aai-alba-transform.opus | 2022-02-01 01:35 | 25K | |
| aai-begininvestigation.opus | 2022-02-01 01:35 | 14K | |
| aai-cammy-breakdown.opus | 2022-02-01 01:35 | 34K | |
| aai-cammy-bubble.opus | 2022-02-01 01:35 | 1.2K | |
| aai-cammy-bubbles.opus | 2022-02-01 01:35 | 4.6K | |
| aai-franziska-angriest.opus | 2022-02-01 01:35 | 34K | |
| aai-investigationend.opus | 2022-02-01 01:35 | 7.4K | |
| aai-lang-scroll.opus | 2022-02-01 01:35 | 2.7K | |
| aai-logicconnect.opus | 2022-02-01 01:35 | 11K | |
| aai-logicconnection.opus | 2022-02-01 01:35 | 17K | |
| aai-miles-eureka.opus | 2022-02-01 01:35 | 8.5K | |
| aai-portsman-breakdown.opus | 2022-02-01 01:35 | 33K | |
| aai-portsman-coat.opus | 2022-02-01 01:35 | 3.9K | |
| aai-portsman-showoff.opus | 2022-02-01 01:35 | 46K | |
| aai-rebuttal.opus | 2022-02-01 01:35 | 15K | |
| aai-zinc-breakdown.opus | 2022-02-01 01:35 | 17K | |
| aai2-debeste-damage.opus | 2022-02-01 01:35 | 17K | |
| aai2-gallery-goddess.opus | 2022-02-01 01:35 | 18K | |
| aai2-gregory-chili.opus | 2022-02-01 01:35 | 62K | |
| aai2-gregory-koreda.opus | 2022-02-01 01:35 | 7.9K | |
| aai2-jay-break.opus | 2022-02-01 01:35 | 15K | |
| aai2-jay-punchpunch.opus | 2022-02-01 01:35 | 7.3K | |
| aai2-justine-gavel-gallery.opus | 2022-02-01 01:35 | 17K | |
| aai2-justine-gavel-in.opus | 2022-02-01 01:35 | 6.2K | |
| aai2-justine-gavel-out.opus | 2022-02-01 01:35 | 5.4K | |
| aai2-justine-gavel.opus | 2022-02-01 01:35 | 11K | |
| aai2-justine-guilty.opus | 2022-02-01 01:35 | 45K | |
| aai2-justine-notguilty.opus | 2022-02-01 01:35 | 52K | |
| aai2-justine-opening.opus | 2022-02-01 01:35 | 85K | |
| aai2-knightley-breakdown.opus | 2022-02-01 01:35 | 60K | |
| aai2-knightley-gun-load.opus | 2022-02-01 01:35 | 2.6K | |
| aai2-knightley-gun-shot.opus | 2022-02-01 01:35 | 7.3K | |
| aai2-knightley-gun-spin.opus | 2022-02-01 01:35 | 54K | |
| aai2-knightley-reload.opus | 2022-02-01 01:35 | 12K | |
| aai2-pullout.opus | 2022-02-01 01:35 | 4.4K | |
| aai2-simon-rest.opus | 2022-02-01 01:35 | 38K | |
| aai2-simon-transform.opus | 2022-02-01 01:35 | 89K | |
| abigail/ | 2022-02-01 01:59 | - | |
| adachi/ | 2022-02-01 01:59 | - | |
| aigis/ | 2022-02-01 01:59 | - | |
| aj-alita-flap-2.opus | 2022-02-01 01:35 | 6.1K | |
| aj-alita-flap.opus | 2022-02-01 01:35 | 4.3K | |
| aj-apollo-gotcha.opus | 2022-02-01 01:35 | 7.9K | |
| aj-apollo-percieve.opus | 2022-02-01 01:35 | 16K | |
| aj-apollo-pre-percieve.opus | 2022-02-01 01:35 | 15K | |
| aj-eldoon-harmonica-2.opus | 2022-02-01 01:35 | 50K | |
| aj-eldoon-harmonica.opus | 2022-02-01 01:35 | 38K | |
| aj-ema-munch.opus | 2022-02-01 01:35 | 22K | |
| aj-klavier-damage-2.opus | 2022-02-01 01:35 | 8.9K | |
| aj-klavier-damage.opus | 2022-02-01 01:35 | 8.5K | |
| aj-klavier-guitar.opus | 2022-02-01 01:35 | 26K | |
| aj-kristoph-slam.opus | 2022-02-01 01:35 | 34K | |
| aj-olga-breakdown-2.opus | 2022-02-01 01:35 | 19K | |
| aj-olga-breakdown.opus | 2022-02-01 01:35 | 29K | |
| aj-olga-damage.opus | 2022-02-01 01:35 | 18K | |
| aj-vera-sketch.opus | 2022-02-01 01:35 | 5.4K | |
| alita/ | 2022-02-01 01:59 | - | |
| all_out.opus | 2022-02-01 01:35 | 61K | |
| altamont/ | 2022-02-01 01:59 | - | |
| amara/ | 2022-02-01 01:59 | - | |
| angry.opus | 2022-02-01 01:35 | 226K | |
| angrysenpai.opus | 2022-02-01 01:35 | 26K | |
| anna/ | 2022-02-01 01:59 | - | |
| arcueidmbtl_burst.wav | 2022-03-19 21:16 | 196K | |
| arcueidmbtl_charge.wav | 2022-03-19 21:16 | 326K | |
| arcueidmbtl_cutin1.wav | 2022-03-19 21:16 | 242K | |
| arcueidmbtl_cutin2.wav | 2022-03-19 21:16 | 184K | |
| arcueidmbtl_heavyhurt.wav | 2022-03-19 21:16 | 86K | |
| arcueidmbtl_hurt.wav | 2022-03-19 21:16 | 87K | |
| arcueidmbtl_magicburst.wav | 2022-03-19 21:16 | 327K | |
| arcueidmbtl_point.wav | 2022-03-19 21:16 | 108K | |
| arcueidmbtl_swing.wav | 2022-03-19 21:16 | 85K | |
| arcueidmbtl_wall.wav | 2022-03-19 21:16 | 157K | |
| armie/ | 2022-02-01 01:59 | - | |
| artoria.opus | 2022-02-01 01:35 | 286K | |
| aura/ | 2022-02-01 02:00 | - | |
| b-sideblammed.opus | 2022-02-01 01:35 | 1.1M | |
| b-sidephilly.opus | 2022-02-01 01:35 | 1.3M | |
| b-sidepico.opus | 2022-02-01 01:35 | 1.0M | |
| ballistic.opus | 2022-02-01 01:36 | 2.0M | |
| barnham/ | 2022-02-01 02:00 | - | |
| bb-celica-aww.opus | 2022-02-01 01:35 | 9.4K | |
| bb-celica-breakdown.opus | 2022-02-01 01:35 | 39K | |
| bb-celica-cannonboom.opus | 2022-02-01 01:35 | 15K | |
| bb-celica-cannonfull.opus | 2022-02-01 01:35 | 13K | |
| bb-celica-cuteattack.opus | 2022-02-01 01:36 | 3.3K | |
| bb-celica-damagea.opus | 2022-02-01 01:36 | 4.4K | |
| bb-celica-damageb.opus | 2022-02-01 01:36 | 3.8K | |
| bb-celica-dizzy.opus | 2022-02-01 01:36 | 13K | |
| bb-celica-eek.opus | 2022-02-01 01:36 | 4.8K | |
| bb-celica-enoughgun.opus | 2022-02-01 01:36 | 13K | |
| bb-celica-intro1.opus | 2022-02-01 01:36 | 41K | |
| bb-celica-intro2.opus | 2022-02-01 01:36 | 34K | |
| bb-celica-map.opus | 2022-02-01 01:36 | 14K | |
| bb-celica-minervacannon.opus | 2022-02-01 01:36 | 4.2K | |
| bb-celica-minervakick.opus | 2022-02-01 01:36 | 6.8K | |
| bb-celica-minervattack.opus | 2022-02-01 01:36 | 8.4K | |
| bb-celica-onetwo.opus | 2022-02-01 01:36 | 10K | |
| bb-celica-owo.opus | 2022-02-01 01:36 | 21K | |
| bb-celica-point.opus | 2022-02-01 01:36 | 8.8K | |
| bb-celica-rise.opus | 2022-02-01 01:36 | 8.7K | |
| bb-celica-shock.opus | 2022-02-01 01:36 | 4.6K | |
| bb-celica-suppercut.opus | 2022-02-01 01:36 | 11K | |
| bb-celica-uppercut.opus | 2022-02-01 01:36 | 8.4K | |
| bb-celica-whenufall.opus | 2022-02-01 01:36 | 8.6K | |
| bb-celica-whenurise.opus | 2022-02-01 01:36 | 8.1K | |
| bb-celica-whereami.opus | 2022-02-01 01:36 | 6.0K | |
| bb-celica-woopsie.opus | 2022-02-01 01:36 | 22K | |
| bb-celica-yamete.opus | 2022-02-01 01:36 | 7.3K | |
| bb-hazama-breakdown-2.opus | 2022-02-01 01:36 | 36K | |
| bb-hazama-breakdown.opus | 2022-02-01 01:36 | 22K | |
| bb-hazama-damage1.opus | 2022-02-01 01:36 | 5.0K | |
| bb-hazama-damage2.opus | 2022-02-01 01:36 | 7.9K | |
| bb-hazama-damage3.opus | 2022-02-01 01:36 | 6.5K | |
| bb-hazama-dynamic.opus | 2022-02-01 01:36 | 24K | |
| bb-hazama-evillaugh.opus | 2022-02-01 01:36 | 17K | |
| bb-hazama-giggle.opus | 2022-02-01 01:36 | 23K | |
| bb-hazama-goeasy.opus | 2022-02-01 01:36 | 17K | |
| bb-hazama-gotcha.opus | 2022-02-01 01:36 | 13K | |
| bb-hazama-greetings.opus | 2022-02-01 01:36 | 19K | |
| bb-hazama-haha.opus | 2022-02-01 01:36 | 7.3K | |
| bb-hazama-laugh.opus | 2022-02-01 01:36 | 13K | |
| bb-hazama-notime.opus | 2022-02-01 01:36 | 17K | |
| bb-hazama-rest.opus | 2022-02-01 01:36 | 11K | |
| bb-hazama-rudun.opus | 2022-02-01 01:36 | 7.2K | |
| bb-hazama-shocking.opus | 2022-02-01 01:36 | 8.5K | |
| bb-hazama-sosoon.opus | 2022-02-01 01:36 | 20K | |
| bb-hazama-superdamage.opus | 2022-02-01 01:36 | 19K | |
| bb-hazama-trip.opus | 2022-02-01 01:36 | 31K | |
| bb-hazama-victory.opus | 2022-02-01 01:36 | 9.5K | |
| bb-hazama.opus | 2022-02-01 01:36 | 18K | |
| bb-hibiki-breakdown.opus | 2022-02-01 01:36 | 35K | |
| bb-hibiki-damagea.opus | 2022-02-01 01:36 | 5.9K | |
| bb-hibiki-damageb.opus | 2022-02-01 01:36 | 8.4K | |
| bb-hibiki-heavyslash.opus | 2022-02-01 01:36 | 4.1K | |
| bb-hibiki-laff.opus | 2022-02-01 01:36 | 5.7K | |
| bb-hibiki-rise.opus | 2022-02-01 01:36 | 6.8K | |
| bb-hibiki-shock.opus | 2022-02-01 01:36 | 6.9K | |
| bb-hibiki-slice.opus | 2022-02-01 01:36 | 4.2K | |
| bb-hibiki-superdamage.opus | 2022-02-01 01:36 | 16K | |
| bb-hibiki-superdamage.wav | 2022-02-01 01:36 | 162K | |
| bb-jubei-angry.opus | 2022-02-01 01:36 | 8.9K | |
| bb-jubei-astral.opus | 2022-02-01 01:36 | 197K | |
| bb-jubei-attack.opus | 2022-02-01 01:36 | 10K | |
| bb-jubei-block.opus | 2022-02-01 01:36 | 6.5K | |
| bb-jubei-damage-2.opus | 2022-02-01 01:36 | 6.7K | |
| bb-jubei-damage.opus | 2022-02-01 01:36 | 7.3K | |
| bb-jubei-dies.opus | 2022-02-01 01:36 | 18K | |
| bb-jubei-doshda.opus | 2022-02-01 01:36 | 18K | |
| bb-jubei-hmm-2.opus | 2022-02-01 01:36 | 5.4K | |
| bb-jubei-hmm.opus | 2022-02-01 01:36 | 7.7K | |
| bb-jubei-intro.opus | 2022-02-01 01:36 | 23K | |
| bb-jubei-kisama.opus | 2022-02-01 01:36 | 9.2K | |
| bb-jubei-kono.opus | 2022-02-01 01:36 | 5.6K | |
| bb-jubei-kuso.opus | 2022-02-01 01:36 | 10K | |
| bb-jubei-lotus.opus | 2022-02-01 01:36 | 30K | |
| bb-jubei-misjudged.opus | 2022-02-01 01:36 | 7.2K | |
| bb-jubei-nani.opus | 2022-02-01 01:36 | 6.0K | |
| bb-jubei-nya.opus | 2022-02-01 01:36 | 13K | |
| bb-jubei-oof.opus | 2022-02-01 01:36 | 9.3K | |
| bb-jubei-osoi.opus | 2022-02-01 01:36 | 6.6K | |
| bb-jubei-overdrive.opus | 2022-02-01 01:36 | 22K | |
| bb-jubei-owarida.opus | 2022-02-01 01:36 | 41K | |
| bb-jubei-ph-2.opus | 2022-02-01 01:36 | 32K | |
| bb-jubei-ph-3.opus | 2022-02-01 01:36 | 12K | |
| bb-jubei-ph.opus | 2022-02-01 01:36 | 42K | |
| bb-jubei-sheathe.opus | 2022-02-01 01:36 | 7.3K | |
| bb-jubei-shitmatta.opus | 2022-02-01 01:36 | 6.9K | |
| bb-jubei-slash.opus | 2022-02-01 01:36 | 3.6K | |
| bb-jubei-taunt.opus | 2022-02-01 01:36 | 26K | |
| bb-jubei-victory-1.opus | 2022-02-01 01:36 | 8.7K | |
| bb-jubei-victory-2.opus | 2022-02-01 01:36 | 24K | |
| bb-jubei-yareyare-2 (1).opus | 2022-02-01 01:36 | 9.8K | |
| bb-jubei-yareyare-2.opus | 2022-02-01 01:36 | 9.8K | |
| bb-jubei-yareyare.opus | 2022-02-01 01:36 | 11K | |
| bb-kurogane-astral.opus | 2022-02-01 01:36 | 209K | |
| bb-kurogane-awman.opus | 2022-02-01 01:36 | 25K | |
| bb-kurogane-block.opus | 2022-02-01 01:36 | 4.4K | |
| bb-kurogane-block2.opus | 2022-02-01 01:36 | 4.6K | |
| bb-kurogane-bloodypunch.opus | 2022-02-01 01:36 | 4.2K | |
| bb-kurogane-breakdown.opus | 2022-02-01 01:36 | 41K | |
| bb-kurogane-dagger.opus | 2022-02-01 01:36 | 5.1K | |
| bb-kurogane-damagea.opus | 2022-02-01 01:36 | 6.9K | |
| bb-kurogane-damageb.opus | 2022-02-01 01:36 | 6.4K | |
| bb-kurogane-fist.opus | 2022-02-01 01:36 | 21K | |
| bb-kurogane-getup.opus | 2022-02-01 01:36 | 12K | |
| bb-kurogane-gutpunch.opus | 2022-02-01 01:36 | 4.6K | |
| bb-kurogane-intro.opus | 2022-02-01 01:36 | 20K | |
| bb-kurogane-kick.opus | 2022-02-01 01:36 | 5.0K | |
| bb-kurogane-meemed.opus | 2022-02-01 01:36 | 23K | |
| bb-kurogane-nosweat.opus | 2022-02-01 01:36 | 22K | |
| bb-kurogane-orenokashida.opus | 2022-02-01 01:36 | 15K | |
| bb-kurogane-outoftheway.opus | 2022-02-01 01:36 | 8.0K | |
| bb-kurogane-overdrive.opus | 2022-02-01 01:36 | 23K | |
| bb-kurogane-punch.opus | 2022-02-01 01:36 | 4.4K | |
| bb-kurogane-rage.opus | 2022-02-01 01:36 | 16K | |
| bb-kurogane-ready.opus | 2022-02-01 01:36 | 5.4K | |
| bb-kurogane-rise.opus | 2022-02-01 01:36 | 8.8K | |
| bb-kurogane-roundhousekick.opus | 2022-02-01 01:36 | 6.4K | |
| bb-kurogane-shitmatta.opus | 2022-02-01 01:36 | 10K | |
| bb-kurogane-shock.opus | 2022-02-01 01:36 | 8.1K | |
| bb-kurogane-shocker.opus | 2022-02-01 01:36 | 16K | |
| bb-kurogane-superdamage.opus | 2022-02-01 01:36 | 10K | |
| bb-kurogane-sword.opus | 2022-02-01 01:36 | 9.2K | |
| bb-kurogane-trip.opus | 2022-02-01 01:36 | 22K | |
| bb-mai-blush.opus | 2022-02-01 01:36 | 9.1K | |
| bb-mai-damage.opus | 2022-02-01 01:36 | 5.9K | |
| bb-mai-damage2.opus | 2022-02-01 01:36 | 6.0K | |
| bb-mai-drop.opus | 2022-02-01 01:36 | 13K | |
| bb-mai-hm.opus | 2022-02-01 01:36 | 9.2K | |
| bb-mai-intro.opus | 2022-02-01 01:36 | 22K | |
| bb-mai-intro2.opus | 2022-02-01 01:36 | 10K | |
| bb-mai-intro3.opus | 2022-02-01 01:36 | 25K | |
| bb-mai-overdrive.opus | 2022-02-01 01:36 | 18K | |
| bb-mai-recover.opus | 2022-02-01 01:36 | 7.6K | |
| bb-mai-shock.opus | 2022-02-01 01:36 | 7.7K | |
| bb-mai-slash.opus | 2022-02-01 01:36 | 7.3K | |
| bb-mai-superyeet1.opus | 2022-02-01 01:36 | 12K | |
| bb-mai-superyeet2.opus | 2022-02-01 01:36 | 12K | |
| bb-mai-throw.opus | 2022-02-01 01:36 | 14K | |
| bb-mai-tired.opus | 2022-02-01 01:36 | 11K | |
| bb-mai-walkin.opus | 2022-02-01 01:36 | 11K | |
| bb-mai-walkout.opus | 2022-02-01 01:36 | 14K | |
| bb-mai-yay.opus | 2022-02-01 01:36 | 10K | |
| bb-nine-flamesofpurgatory.opus | 2022-02-01 01:36 | 47K | |
| bb-nine-giggle.opus | 2022-02-01 01:36 | 6.7K | |
| bb-nine-ihaventseenyouinawhile.opus | 2022-02-01 01:36 | 30K | |
| bb-nine-trash.opus | 2022-02-01 01:36 | 12K | |
| bb-nine-wouldyouliketo.opus | 2022-02-01 01:36 | 34K | |
| bb-rachel-abuse.opus | 2022-02-01 01:36 | 13K | |
| bb-rachel-astral.opus | 2022-02-01 01:36 | 77K | |
| bb-rachel-baden.opus | 2022-02-01 01:36 | 27K | |
| bb-rachel-bitchslap.opus | 2022-02-01 01:36 | 9.5K | |
| bb-rachel-damage-2.opus | 2022-02-01 01:36 | 16K | |
| bb-rachel-damage.opus | 2022-02-01 01:36 | 11K | |
| bb-rachel-hentai.opus | 2022-02-01 01:36 | 7.6K | |
| bb-rachel-humor.opus | 2022-02-01 01:36 | 8.8K | |
| bb-rachel-jojo.opus | 2022-02-01 01:36 | 8.7K | |
| bb-rachel-kneel.opus | 2022-02-01 01:36 | 9.6K | |
| bb-rachel-pathetic.opus | 2022-02-01 01:36 | 7.4K | |
| bb-rachel-slash.opus | 2022-02-01 01:36 | 21K | |
| bb-rachel-spin.opus | 2022-02-01 01:36 | 26K | |
| bb-rachel-stab.opus | 2022-02-01 01:36 | 5.3K | |
| bb-rachel-standup.opus | 2022-02-01 01:36 | 28K | |
| bb-rachel-yawn.opus | 2022-02-01 01:36 | 21K | |
| bb-taokaka-dizzy.opus | 2022-02-01 01:36 | 7.0K | |
| bb-taokaka-explode.opus | 2022-02-01 01:36 | 15K | |
| bb-taokaka-heh.opus | 2022-02-01 01:36 | 2.5K | |
| bb-taokaka-o.opus | 2022-02-01 01:36 | 2.7K | |
| bb-taokaka-youredonealready.opus | 2022-02-01 01:36 | 8.6K | |
| bb-terumi-breakdown.opus | 2022-02-01 01:36 | 18K | |
| bb-terumi-burst.opus | 2022-02-01 01:36 | 16K | |
| bb-terumi-casual-hz.opus | 2022-02-01 01:36 | 14K | |
| bb-terumi-damage-drop.opus | 2022-02-01 01:36 | 16K | |
| bb-terumi-damage-heavy.opus | 2022-02-01 01:36 | 17K | |
| bb-terumi-damage-light-2.opus | 2022-02-01 01:36 | 8.7K | |
| bb-terumi-deskslam-2.opus | 2022-02-01 01:36 | 13K | |
| bb-terumi-deskslam.opus | 2022-02-01 01:36 | 12K | |
| bb-terumi-dynamic-1.opus | 2022-02-01 01:36 | 10K | |
| bb-terumi-dynamic-2.opus | 2022-02-01 01:36 | 24K | |
| bb-terumi-dynamic-4.opus | 2022-02-01 01:36 | 12K | |
| bb-terumi-evillaugh-2.opus | 2022-02-01 01:36 | 40K | |
| bb-terumi-fuenjin-jb.opus | 2022-02-01 01:36 | 68K | |
| bb-terumi-fusefail.opus | 2022-02-01 01:36 | 32K | |
| bb-terumi-garengeki.opus | 2022-02-01 01:36 | 35K | |
| bb-terumi-hand.opus | 2022-02-01 01:36 | 24K | |
| bb-terumi-hentai.opus | 2022-02-01 01:36 | 19K | |
| bb-terumi-intro-2alt.opus | 2022-02-01 01:36 | 33K | |
| bb-terumi-intro-hk.opus | 2022-02-01 01:36 | 48K | |
| bb-terumi-intro-rg.opus | 2022-02-01 01:36 | 54K | |
| bb-terumi-intro.opus | 2022-02-01 01:36 | 38K | |
| bb-terumi-kick-2.opus | 2022-02-01 01:36 | 12K | |
| bb-terumi-knee.opus | 2022-02-01 01:36 | 7.7K | |
| bb-terumi-knifespin.opus | 2022-02-01 01:36 | 27K | |
| bb-terumi-knifespinend.opus | 2022-02-01 01:36 | 30K | |
| bb-terumi-konamondara.opus | 2022-02-01 01:36 | 16K | |
| bb-terumi-laugh-2.opus | 2022-02-01 01:36 | 20K | |
| bb-terumi-laugh-3.opus | 2022-02-01 01:36 | 14K | |
| bb-terumi-laugh.opus | 2022-02-01 01:36 | 8.8K | |
| bb-terumi-orochi-baka.opus | 2022-02-01 01:36 | 40K | |
| bb-terumi-orochi.opus | 2022-02-01 01:36 | 44K | |
| bb-terumi-ouroboros.opus | 2022-02-01 01:36 | 58K | |
| bb-terumi-overdrive-rg.opus | 2022-02-01 01:36 | 19K | |
| bb-terumi-really.opus | 2022-02-01 01:36 | 13K | |
| bb-terumi-recover.opus | 2022-02-01 01:36 | 12K | |
| bb-terumi-shine.opus | 2022-02-01 01:36 | 42K | |
| bb-terumi-shock.opus | 2022-02-01 01:36 | 7.6K | |
| bb-terumi-slash.opus | 2022-02-01 01:36 | 13K | |
| bb-terumi-snakebite.opus | 2022-02-01 01:36 | 14K | |
| bb-terumi-snakebite4.opus | 2022-02-01 01:36 | 14K | |
| bb-terumi-stomp.opus | 2022-02-01 01:36 | 9.8K | |
| bb-terumi-taunt-2.opus | 2022-02-01 01:36 | 34K | |
| bb-terumi-ugh.opus | 2022-02-01 01:36 | 12K | |
| bb-terumi-victory-hz.opus | 2022-02-01 01:36 | 48K | |
| bb-terumi-victory.opus | 2022-02-01 01:36 | 61K | |
| bb-terumi-victory2.opus | 2022-02-01 01:36 | 25K | |
| bb-terumi-zanroga.opus | 2022-02-01 01:36 | 36K | |
| birdly/ | 2022-02-01 02:00 | - | |
| blackquill/ | 2022-02-01 02:00 | - | |
| blaise/ | 2022-02-01 02:00 | - | |
| blake-collapse.opus | 2022-02-01 01:36 | 14K | |
| blake-faceplant.opus | 2022-02-01 01:36 | 13K | |
| blake-getup.opus | 2022-02-01 01:36 | 14K | |
| blake-gun.opus | 2022-02-01 01:36 | 5.3K | |
| blake-gunshot.opus | 2022-02-01 01:36 | 6.9K | |
| blake-leap.opus | 2022-02-01 01:36 | 11K | |
| blake-slash.opus | 2022-02-01 01:36 | 6.7K | |
| blake-vanish.opus | 2022-02-01 01:36 | 24K | |
| blake-yeet.opus | 2022-02-01 01:36 | 17K | |
| blammed.opus | 2022-02-01 01:36 | 1.5M | |
| bobby/ | 2022-02-01 02:00 | - | |
| bongo/ | 2022-02-01 02:00 | - | |
| bucky/ | 2022-02-01 02:00 | - | |
| bullymaguire.mp3 | 2024-01-28 02:54 | 1.9M | |
| burley/ | 2022-02-01 02:00 | - | |
| bzzt.opus | 2022-02-01 01:36 | 60K | |
| cabanela/ | 2022-02-01 02:00 | - | |
| celestia/ | 2022-02-01 02:00 | - | |
| char/ | 2023-08-24 19:38 | - | |
| charles/ | 2022-02-01 02:00 | - | |
| claus/ | 2022-02-01 02:00 | - | |
| clonco/ | 2022-02-01 02:00 | - | |
| coffeeslam.opus | 2022-02-01 01:36 | 21K | |
| consume.opus | 2022-02-01 01:36 | 19K | |
| courtney/ | 2022-02-01 02:00 | - | |
| crogrey/ | 2022-02-01 02:00 | - | |
| cutscene.opus | 2022-02-01 01:36 | 285K | |
| dahlia and iris/ | 2022-02-01 02:00 | - | |
| darklaw/ | 2022-02-01 02:05 | - | |
| datz/ | 2022-02-01 02:00 | - | |
| dd-apollo-gotcha.opus | 2022-02-01 01:36 | 14K | |
| dd-apollo-percieve.opus | 2022-02-01 01:36 | 26K | |
| dd-apollo-slap.opus | 2022-02-01 01:36 | 5.3K | |
| dd-athena-fist.opus | 2022-02-01 01:36 | 4.5K | |
| dd-athena-gotit.opus | 2022-02-01 01:36 | 15K | |
| dd-athena-matrix-op.opus | 2022-02-01 01:36 | 7.0K | |
| dd-athena-matrix-swipe.opus | 2022-02-01 01:36 | 10K | |
| dd-athena-peace.opus | 2022-02-01 01:36 | 5.3K | |
| dd-aura-bop.opus | 2022-02-01 01:36 | 3.9K | |
| dd-aura-closelid.opus | 2022-02-01 01:36 | 7.2K | |
| dd-aura-laugh-2.opus | 2022-02-01 01:36 | 10K | |
| dd-aura-laugh.opus | 2022-02-01 01:36 | 3.9K | |
| dd-aura-openlid.opus | 2022-02-01 01:36 | 5.6K | |
| dd-aura-smack.opus | 2022-02-01 01:36 | 15K | |
| dd-aura-squirt.opus | 2022-02-01 01:36 | 10K | |
| dd-aura-zap.opus | 2022-02-01 01:36 | 16K | |
| dd-belle-breakdown-2.opus | 2022-02-01 01:36 | 60K | |
| dd-belle-breakdown-3.opus | 2022-02-01 01:36 | 97K | |
| dd-belle-breakdown.opus | 2022-02-01 01:36 | 114K | |
| dd-belle-flippage.opus | 2022-02-01 01:36 | 40K | |
| dd-belle-hit.opus | 2022-02-01 01:36 | 6.6K | |
| dd-belle-parfume-2.opus | 2022-02-01 01:36 | 18K | |
| dd-belle-parfume.opus | 2022-02-01 01:36 | 3.2K | |
| dd-belle-rebuttal.opus | 2022-02-01 01:36 | 21K | |
| dd-belle-writing.opus | 2022-02-01 01:36 | 15K | |
| dd-blackquill-attack.opus | 2022-02-01 01:36 | 11K | |
| dd-blackquill-break.opus | 2022-02-01 01:36 | 21K | |
| dd-blackquill-clink.opus | 2022-02-01 01:36 | 5.5K | |
| dd-blackquill-cocky.opus | 2022-02-01 01:36 | 6.9K | |
| dd-blackquill-damage-2.opus | 2022-02-01 01:36 | 19K | |
| dd-blackquill-damage.opus | 2022-02-01 01:36 | 11K | |
| dd-blackquill-deskslam-2.opus | 2022-02-01 01:36 | 16K | |
| dd-blackquill-deskslam.opus | 2022-02-01 01:36 | 13K | |
| dd-blackquill-headtap-2.opus | 2022-02-01 01:36 | 19K | |
| dd-blackquill-headtap.opus | 2022-02-01 01:36 | 19K | |
| dd-blackquill-laughing-2.opus | 2022-02-01 01:36 | 13K | |
| dd-blackquill-laughing.opus | 2022-02-01 01:36 | 14K | |
| dd-blackquill-prepare.opus | 2022-02-01 01:36 | 4.1K | |
| dd-blackquill-shacklebreak.opus | 2022-02-01 01:36 | 18K | |
| dd-blackquill-silence.opus | 2022-02-01 01:36 | 16K | |
| dd-blackquill-taka-call.opus | 2022-02-01 01:36 | 10K | |
| dd-blackquill-taka-land.opus | 2022-02-01 01:36 | 6.4K | |
| dd-blackquill-taka-leave.opus | 2022-02-01 01:36 | 11K | |
| dd-blackquill-taka-scratch.opus | 2022-02-01 01:36 | 25K | |
| dd-blackquill-taka-screech.opus | 2022-02-01 01:36 | 7.8K | |
| dd-blackquill-taze.opus | 2022-02-01 01:36 | 21K | |
| dd-blackquill-untaze.opus | 2022-02-01 01:36 | 6.7K | |
| dd-crab-anger.opus | 2022-02-01 01:36 | 5.5K | |
| dd-crab-distraction.opus | 2022-02-01 01:36 | 19K | |
| dd-crab-sniper-disappear.opus | 2022-02-01 01:36 | 4.7K | |
| dd-crab-surprised.opus | 2022-02-01 01:36 | 25K | |
| dd-damage-2.opus | 2022-02-01 01:36 | 8.7K | |
| dd-damage-3.opus | 2022-02-01 01:36 | 7.2K | |
| dd-damage.opus | 2022-02-01 01:36 | 6.1K | |
| dd-deplume-breakdown.opus | 2022-02-01 01:36 | 36K | |
| dd-deplume-gunblow.opus | 2022-02-01 01:36 | 7.8K | |
| dd-deplume-gunshot.opus | 2022-02-01 01:36 | 11K | |
| dd-deplume-lipstick.opus | 2022-02-01 01:36 | 4.1K | |
| dd-deplume-shootblow.opus | 2022-02-01 01:36 | 26K | |
| dd-deplume-skirtblow.opus | 2022-02-01 01:36 | 22K | |
| dd-deskslam.opus | 2022-02-01 01:36 | 5.2K | |
| dd-dispose.opus | 2022-02-01 01:36 | 10K | |
| dd-dramapound.opus | 2022-02-01 01:36 | 6.5K | |
| dd-fulbright-badgepull-short.opus | 2022-02-01 01:36 | 10K | |
| dd-fulbright-badgepull.opus | 2022-02-01 01:36 | 21K | |
| dd-fulbright-fist.opus | 2022-02-01 01:36 | 4.2K | |
| dd-fwashing.opus | 2022-02-01 01:37 | 25K | |
| dd-gallery-cheer.opus | 2022-02-01 01:37 | 43K | |
| dd-gameover.opus | 2022-02-01 01:37 | 83K | |
| dd-gavel.opus | 2022-02-01 01:37 | 6.8K | |
| dd-guilty.opus | 2022-02-01 01:37 | 32K | |
| dd-gunshot-2.opus | 2022-02-01 01:37 | 5.7K | |
| dd-gunshot.opus | 2022-02-01 01:37 | 5.7K | |
| dd-hugh-arrow.opus | 2022-02-01 01:37 | 14K | |
| dd-hugh-chew.opus | 2022-02-01 01:37 | 7.4K | |
| dd-hugh-damage.opus | 2022-02-01 01:37 | 11K | |
| dd-hugh-glasses.opus | 2022-02-01 01:37 | 7.1K | |
| dd-hugh-neckclasp.opus | 2022-02-01 01:37 | 3.1K | |
| dd-hugh-read.opus | 2022-02-01 01:37 | 48K | |
| dd-hugh-screech.opus | 2022-02-01 01:37 | 61K | |
| dd-jinxie-charm.opus | 2022-02-01 01:37 | 4.1K | |
| dd-jinxie-crack.opus | 2022-02-01 01:37 | 6.9K | |
| dd-jinxie-threaten.opus | 2022-02-01 01:37 | 9.9K | |
| dd-judge-opening.opus | 2022-02-01 01:37 | 110K | |
| dd-juniper-breath.opus | 2022-02-01 01:37 | 17K | |
| dd-juniper-breathe.opus | 2022-02-01 01:37 | 28K | |
| dd-juniper-cough-double.opus | 2022-02-01 01:37 | 3.8K | |
| dd-juniper-cough.opus | 2022-02-01 01:37 | 2.1K | |
| dd-juniper-knit.opus | 2022-02-01 01:37 | 18K | |
| dd-klavier-fingersnap.opus | 2022-02-01 01:37 | 2.3K | |
| dd-klavier-snap.opus | 2022-02-01 01:37 | 2.3K | |
| dd-knife-2.opus | 2022-02-01 01:37 | 4.1K | |
| dd-knife.opus | 2022-02-01 01:37 | 4.2K | |
| dd-lightbulb.opus | 2022-02-01 01:37 | 10K | |
| dd-luminol.opus | 2022-02-01 01:37 | 3.7K | |
| dd-magatama.opus | 2022-02-01 01:37 | 65K | |
| dd-magic.opus | 2022-02-01 01:37 | 18K | |
| dd-means-board.opus | 2022-02-01 01:37 | 45K | |
| dd-means-breakdown.opus | 2022-02-01 01:37 | 383K | |
| dd-means-chalk1.opus | 2022-02-01 01:37 | 39K | |
| dd-means-chalk2.opus | 2022-02-01 01:37 | 37K | |
| dd-means-chalk4.opus | 2022-02-01 01:37 | 25K | |
| dd-means-chalk6.opus | 2022-02-01 01:37 | 48K | |
| dd-means-chalk7.opus | 2022-02-01 01:37 | 50K | |
| dd-means-chalktn.opus | 2022-02-01 01:37 | 26K | |
| dd-means-clean.opus | 2022-02-01 01:37 | 9.3K | |
| dd-means-damage.opus | 2022-02-01 01:37 | 14K | |
| dd-means-globe.opus | 2022-02-01 01:37 | 52K | |
| dd-means-globetn.opus | 2022-02-01 01:37 | 4.7K | |
| dd-means-guilty.opus | 2022-02-01 01:37 | 51K | |
| dd-means-hands.opus | 2022-02-01 01:37 | 8.4K | |
| dd-means-normal.opus | 2022-02-01 01:37 | 17K | |
| dd-means-notguilty.opus | 2022-02-01 01:37 | 102K | |
| dd-means-preglobe.opus | 2022-02-01 01:37 | 9.6K | |
| dd-means-prepoint.opus | 2022-02-01 01:37 | 5.0K | |
| dd-means-throw.opus | 2022-02-01 01:37 | 29K | |
| dd-means-trans.opus | 2022-02-01 01:37 | 80K | |
| dd-means-transform.opus | 2022-02-01 01:37 | 94K | |
| dd-means-writing.opus | 2022-02-01 01:37 | 15K | |
| dd-newman-faint.opus | 2022-02-01 01:37 | 10K | |
| dd-newman-faintfull.opus | 2022-02-01 01:37 | 25K | |
| dd-newman-normal.opus | 2022-02-01 01:37 | 8.1K | |
| dd-newman-roar.opus | 2022-02-01 01:37 | 17K | |
| dd-newman-shatter.opus | 2022-02-01 01:37 | 11K | |
| dd-newman-shoe.opus | 2022-02-01 01:37 | 23K | |
| dd-newman-transform.opus | 2022-02-01 01:37 | 72K | |
| dd-objection-super.opus | 2022-02-01 01:37 | 20K | |
| dd-objection.opus | 2022-02-01 01:37 | 11K | |
| dd-payne-run.opus | 2022-02-01 01:37 | 35K | |
| dd-percieve-intro.opus | 2022-02-01 01:37 | 12K | |
| dd-phoenix-gotit.opus | 2022-02-01 01:37 | 15K | |
| dd-punch.opus | 2022-02-01 01:37 | 5.0K | |
| dd-realization.opus | 2022-02-01 01:37 | 11K | |
| dd-rimes-pirate-breakdown.opus | 2022-02-01 01:37 | 334K | |
| dd-rimes-pirate-devour.opus | 2022-02-01 01:37 | 17K | |
| dd-rimes-pirate-rap-loop.opus | 2022-02-01 01:37 | 45K | |
| dd-rimes-pirate-rap-mic.opus | 2022-02-01 01:37 | 8.3K | |
| dd-rimes-pirate-rap-pose.opus | 2022-02-01 01:37 | 14K | |
| dd-rimes-pirate-shaken.opus | 2022-02-01 01:37 | 31K | |
| dd-rimes-rap-loop.opus | 2022-02-01 01:37 | 75K | |
| dd-rimes-rap-mic.opus | 2022-02-01 01:37 | 3.7K | |
| dd-rimes-rap-pose.opus | 2022-02-01 01:37 | 15K | |
| dd-rimes-transform.opus | 2022-02-01 01:37 | 146K | |
| dd-sasha-blow.opus | 2022-02-01 01:37 | 8.0K | |
| dd-sasha-draw.opus | 2022-02-01 01:37 | 19K | |
| dd-sasha-inflate.opus | 2022-02-01 01:37 | 18K | |
| dd-sasha-pop.opus | 2022-02-01 01:37 | 4.9K | |
| dd-sasha-push.opus | 2022-02-01 01:37 | 8.2K | |
| dd-sasha-sheath.opus | 2022-02-01 01:37 | 9.3K | |
| dd-sasha-whistle-grab.opus | 2022-02-01 01:37 | 7.2K | |
| dd-scuttlebutt-anger.opus | 2022-02-01 01:37 | 18K | |
| dd-scuttlebutt-break-2.opus | 2022-02-01 01:37 | 57K | |
| dd-scuttlebutt-break.opus | 2022-02-01 01:37 | 55K | |
| dd-scuttlebutt-camera-away.opus | 2022-02-01 01:37 | 7.9K | |
| dd-scuttlebutt-camera-snap.opus | 2022-02-01 01:37 | 7.8K | |
| dd-scuttlebutt-camera-start.opus | 2022-02-01 01:37 | 5.5K | |
| dd-scuttlebutt-damage-2.opus | 2022-02-01 01:37 | 27K | |
| dd-scuttlebutt-damage.opus | 2022-02-01 01:37 | 29K | |
| dd-scuttlebutt-drop.opus | 2022-02-01 01:37 | 7.5K | |
| dd-scuttlebutt-present.opus | 2022-02-01 01:37 | 18K | |
| dd-selectjingle.opus | 2022-02-01 01:37 | 17K | |
| dd-shatter.opus | 2022-02-01 01:37 | 13K | |
| dd-shock.opus | 2022-02-01 01:37 | 7.8K | |
| dd-stab.opus | 2022-02-01 01:37 | 5.7K | |
| dd-starbuck-breakdown.opus | 2022-02-01 01:37 | 22K | |
| dd-starbuck-gasping.opus | 2022-02-01 01:37 | 38K | |
| dd-starbuck-liftoff.opus | 2022-02-01 01:37 | 166K | |
| dd-surprised.opus | 2022-02-01 01:37 | 15K | |
| dd-swoop.opus | 2022-02-01 01:37 | 6.7K | |
| dd-tenma-damage.opus | 2022-02-01 01:37 | 13K | |
| dd-tenma-evil.opus | 2022-02-01 01:37 | 41K | |
| dd-thoughtroute-choicein.opus | 2022-02-01 01:37 | 8.3K | |
| dd-thoughtroute-cutin.opus | 2022-02-01 01:37 | 5.8K | |
| dd-thoughtroute-dash.opus | 2022-02-01 01:37 | 7.9K | |
| dd-thoughtroute-end.opus | 2022-02-01 01:37 | 28K | |
| dd-thoughtroute-endbq.opus | 2022-02-01 01:37 | 20K | |
| dd-thoughtroute-evidence.opus | 2022-02-01 01:37 | 39K | |
| dd-thoughtroute-flash.opus | 2022-02-01 01:37 | 16K | |
| dd-thoughtroute-kettei.opus | 2022-02-01 01:37 | 26K | |
| dd-thoughtroute-key.opus | 2022-02-01 01:37 | 18K | |
| dd-thoughtroute-moji.opus | 2022-02-01 01:37 | 17K | |
| dd-thoughtroute-split.opus | 2022-02-01 01:37 | 10K | |
| dd-thoughtroute-thumb.opus | 2022-02-01 01:37 | 5.3K | |
| dd-thoughtroute-vanish.opus | 2022-02-01 01:37 | 5.5K | |
| dd-thoughtroute.opus | 2022-02-01 01:37 | 14K | |
| dd-thud.opus | 2022-02-01 01:37 | 15K | |
| dd-tonate-angry.opus | 2022-02-01 01:37 | 9.4K | |
| dd-tonate-assemble.opus | 2022-02-01 01:37 | 14K | |
| dd-tonate-bomb-set.opus | 2022-02-01 01:37 | 6.3K | |
| dd-tonate-breakdown-1.opus | 2022-02-01 01:37 | 112K | |
| dd-tonate-breakdown-2.opus | 2022-02-01 01:37 | 70K | |
| dd-tonate-breakdown-3.opus | 2022-02-01 01:37 | 82K | |
| dd-tonate-damage-goggles.opus | 2022-02-01 01:37 | 17K | |
| dd-tonate-damage-visor.opus | 2022-02-01 01:37 | 14K | |
| dd-tonate-disassemble.opus | 2022-02-01 01:37 | 13K | |
| dd-tonate-goggles.opus | 2022-02-01 01:37 | 31K | |
| dd-tonate-look-pose.opus | 2022-02-01 01:37 | 7.4K | |
| dd-tonate-pose.opus | 2022-02-01 01:37 | 2.7K | |
| dd-tonate-slam.opus | 2022-02-01 01:37 | 8.3K | |
| dd-tonate-sparking.opus | 2022-02-01 01:37 | 29K | |
| dd-tonate-struggle-cord.opus | 2022-02-01 01:37 | 25K | |
| dd-tonate-type-short.opus | 2022-02-01 01:37 | 5.9K | |
| dd-tonate-type.opus | 2022-02-01 01:37 | 12K | |
| dd-tonate-visor-down.opus | 2022-02-01 01:37 | 4.3K | |
| dd-tonate-visor-up.opus | 2022-02-01 01:37 | 9.1K | |
| dd-update.opus | 2022-02-01 01:37 | 16K | |
| dd-whack.opus | 2022-02-01 01:37 | 4.3K | |
| dd-wham.opus | 2022-02-01 01:37 | 7.6K | |
| dd-yuri-hang-up.opus | 2022-02-01 01:37 | 3.4K | |
| dd-yuri-pick-up.opus | 2022-02-01 01:37 | 2.9K | |
| dd-yuri-rev.opus | 2022-02-01 01:37 | 17K | |
| dd-yuri-rocketman.opus | 2022-02-01 01:37 | 201K | |
| decargo/ | 2022-02-01 02:00 | - | |
| defeat.opus | 2022-02-01 01:37 | 404K | |
| dgs-archie-doc-muzai.opus | 2022-02-01 01:37 | 9.9K | |
| dgs-archie-doc-yuzai.opus | 2022-02-01 01:37 | 11K | |
| dgs-archie-muzai.opus | 2022-02-01 01:37 | 10K | |
| dgs-archie-yuzai.opus | 2022-02-01 01:37 | 11K | |
| dgs-asougi-katana.opus | 2022-02-01 01:37 | 2.4K | |
| dgs-asougi-slash.opus | 2022-02-01 01:37 | 9.7K | |
| dgs-asougi-threaten-short.opus | 2022-02-01 01:37 | 2.0K | |
| dgs-asougi-threaten.opus | 2022-02-01 01:37 | 2.1K | |
| dgs-auchi-breakdown.opus | 2022-02-01 01:37 | 12K | |
| dgs-auchi-confidentslam.opus | 2022-02-01 01:37 | 8.6K | |
| dgs-auchi-cut.opus | 2022-02-01 01:37 | 12K | |
| dgs-auchi-damage.opus | 2022-02-01 01:37 | 5.2K | |
| dgs-auchi-desk.opus | 2022-02-01 01:37 | 3.2K | |
| dgs-auchi-fan.opus | 2022-02-01 01:37 | 2.9K | |
| dgs-auchi-slam.opus | 2022-02-01 01:37 | 2.7K | |
| dgs-barok-cloak.opus | 2022-02-01 01:37 | 12K | |
| dgs-barok-glass-break.opus | 2022-02-01 01:37 | 12K | |
| dgs-barok-glass-throw.opus | 2022-02-01 01:37 | 10K | |
| dgs-barok-legslam.opus | 2022-02-01 01:37 | 24K | |
| dgs-barok-shatter.opus | 2022-02-01 01:37 | 14K | |
| dgs-barok-wine-c.opus | 2022-02-01 01:37 | 20K | |
| dgs-barok-wine-catch.opus | 2022-02-01 01:37 | 10K | |
| dgs-barok-wine-pour.opus | 2022-02-01 01:37 | 20K | |
| dgs-barok-wine-throw.opus | 2022-02-01 01:37 | 25K | |
| dgs-barok-wine.opus | 2022-02-01 01:37 | 20K | |
| dgs-butch-muzai.opus | 2022-02-01 01:37 | 9.4K | |
| dgs-butch-toitsume.opus | 2022-02-01 01:37 | 7.6K | |
| dgs-butch-yuzai.opus | 2022-02-01 01:37 | 9.3K | |
| dgs-connor-3d.opus | 2022-02-01 01:37 | 1.8K | |
| dgs-connor-crosseye.opus | 2022-02-01 01:37 | 3.4K | |
| dgs-connor-damage.opus | 2022-02-01 01:37 | 7.2K | |
| dgs-connor-muzai.opus | 2022-02-01 01:37 | 12K | |
| dgs-connor-slam.opus | 2022-02-01 01:37 | 8.1K | |
| dgs-connor-toitsume.opus | 2022-02-01 01:37 | 7.3K | |
| dgs-connor-tug.opus | 2022-02-01 01:37 | 5.7K | |
| dgs-connor-yuzai.opus | 2022-02-01 01:37 | 12K | |
| dgs-crogrey-aggressive.opus | 2022-02-01 01:37 | 10K | |
| dgs-crogrey-attack-tobias.opus | 2022-02-01 01:37 | 94K | |
| dgs-crogrey-attack-tobias1.opus | 2022-02-01 01:37 | 24K | |
| dgs-crogrey-attack-tobias2.opus | 2022-02-01 01:37 | 68K | |
| dgs-crogrey-breakdown.opus | 2022-02-01 01:37 | 30K | |
| dgs-crogrey-cane-hold.opus | 2022-02-01 01:37 | 1.7K | |
| dgs-crogrey-cane-hurt.opus | 2022-02-01 01:37 | 6.8K | |
| dgs-crogrey-cane-point.opus | 2022-02-01 01:37 | 6.5K | |
| dgs-crogrey-cane-right.opus | 2022-02-01 01:37 | 5.8K | |
| dgs-crogrey-greetings.opus | 2022-02-01 01:37 | 50K | |
| dgs-crogrey-gun.opus | 2022-02-01 01:37 | 1.6K | |
| dgs-crogrey-handout.opus | 2022-02-01 01:37 | 7.9K | |
| dgs-crogrey-hatoff.opus | 2022-02-01 01:37 | 16K | |
| dgs-crogrey-hurtslam.opus | 2022-02-01 01:37 | 16K | |
| dgs-crogrey-outside.opus | 2022-02-01 01:37 | 24K | |
| dgs-crogrey-point.opus | 2022-02-01 01:37 | 21K | |
| dgs-crogrey-pose.opus | 2022-02-01 01:37 | 25K | |
| dgs-crogrey-present.opus | 2022-02-01 01:37 | 18K | |
| dgs-crogrey-problem.opus | 2022-02-01 01:37 | 7.5K | |
| dgs-crogrey-shimmy.opus | 2022-02-01 01:37 | 4.7K | |
| dgs-crogrey-spinpose.opus | 2022-02-01 01:37 | 47K | |
| dgs-crogrey-superdamage.opus | 2022-02-01 01:37 | 8.6K | |
| dgs-crogrey-toitsume.opus | 2022-02-01 01:37 | 7.5K | |
| dgs-crogrey-vogue.opus | 2022-02-01 01:37 | 31K | |
| dgs-damage.opus | 2022-02-01 01:37 | 6.3K | |
| dgs-deskslam-juror.opus | 2022-02-01 01:37 | 6.2K | |
| dgs-dmitri-bookopen-old.opus | 2022-02-01 01:37 | 5.4K | |
| dgs-dmitri-bookopen.opus | 2022-02-01 01:37 | 12K | |
| dgs-dmitri-mousegrab.opus | 2022-02-01 01:37 | 3.6K | |
| dgs-dmitri-muzai.opus | 2022-02-01 01:37 | 16K | |
| dgs-dmitri-sad.opus | 2022-02-01 01:37 | 3.5K | |
| dgs-dmitri-slam.opus | 2022-02-01 01:37 | 4.8K | |
| dgs-dmitri-yuzai.opus | 2022-02-01 01:37 | 16K | |
| dgs-donnabella-compact-close.opus | 2022-02-01 01:37 | 1.3K | |
| dgs-donnabella-compact-open.opus | 2022-02-01 01:37 | 1.7K | |
| dgs-donnabella-compact.opus | 2022-02-01 01:37 | 17K | |
| dgs-donnabella-muzai.opus | 2022-02-01 01:37 | 18K | |
| dgs-donnabella-yuzai.opus | 2022-02-01 01:37 | 19K | |
| dgs-garrideb-teaoverflow.opus | 2022-02-01 01:37 | 17K | |
| dgs-gina-clang.opus | 2022-02-01 01:37 | 3.4K | |
| dgs-gina-coat-2.opus | 2022-02-01 01:37 | 4.3K | |
| dgs-gina-coat.opus | 2022-02-01 01:37 | 2.8K | |
| dgs-gina-coin.opus | 2022-02-01 01:37 | 1.6K | |
| dgs-gina-gun-aim.opus | 2022-02-01 01:37 | 2.2K | |
| dgs-gina-gun-click.opus | 2022-02-01 01:37 | 5.0K | |
| dgs-gina-gun-fire.opus | 2022-02-01 01:37 | 8.7K | |
| dgs-gina-gun-insert.opus | 2022-02-01 01:37 | 2.2K | |
| dgs-gina-gun-lock.opus | 2022-02-01 01:37 | 48K | |
| dgs-gina-gun-lockfire.opus | 2022-02-01 01:37 | 71K | |
| dgs-gina-gun-open.opus | 2022-02-01 01:37 | 3.1K | |
| dgs-gina-gun-ring.opus | 2022-02-01 01:37 | 9.6K | |
| dgs-gina-gun-shell.opus | 2022-02-01 01:37 | 8.0K | |
| dgs-gina-gun-stance.opus | 2022-02-01 01:37 | 5.0K | |
| dgs-gina-run.opus | 2022-02-01 01:37 | 8.3K | |
| dgs-gina-tantrum.opus | 2022-02-01 01:37 | 3.3K | |
| dgs-gina-toitsume.opus | 2022-02-01 01:37 | 7.8K | |
| dgs-gregson-catch.opus | 2022-02-01 01:37 | 3.4K | |
| dgs-gregson-damage.opus | 2022-02-01 01:37 | 9.2K | |
| dgs-gregson-eat-fast.opus | 2022-02-01 01:37 | 6.2K | |
| dgs-gregson-eat-slow.opus | 2022-02-01 01:37 | 2.4K | |
| dgs-gregson-food-crash.opus | 2022-02-01 01:37 | 3.8K | |
| dgs-gregson-food-hold.opus | 2022-02-01 01:37 | 12K | |
| dgs-gregson-shake.opus | 2022-02-01 01:37 | 2.1K | |
| dgs-gregson-tea.opus | 2022-02-01 01:37 | 2.0K | |
| dgs-hobbes-muzai.opus | 2022-02-01 01:37 | 11K | |
| dgs-hobbes-yuzai.opus | 2022-02-01 01:37 | 11K | |
| dgs-holmes-pose.opus | 2022-02-01 01:37 | 8.3K | |
| dgs-holmes-snap.opus | 2022-02-01 01:37 | 6.1K | |
| dgs-holmes-whooshsnap.opus | 2022-02-01 01:37 | 8.9K | |
| dgs-hosonaga-cough-2.opus | 2022-02-01 01:37 | 3.4K | |
| dgs-hosonaga-cough-3.opus | 2022-02-01 01:37 | 5.0K | |
| dgs-hosonaga-cough-double.opus | 2022-02-01 01:37 | 4.2K | |
| dgs-hosonaga-cough-heavy.opus | 2022-02-01 01:37 | 12K | |
| dgs-hosonaga-cough.opus | 2022-02-01 01:37 | 2.0K | |
| dgs-hosonaga-pour.opus | 2022-02-01 01:37 | 20K | |
| dgs-hosonaga-toitsume.opus | 2022-02-01 01:37 | 7.3K | |
| dgs-hutch-dynamicentry.opus | 2022-02-01 01:37 | 46K | |
| dgs-hutch-gun-catch.opus | 2022-02-01 01:37 | 3.4K | |
| dgs-hutch-gun-ready.opus | 2022-02-01 01:37 | 1.6K | |
| dgs-hutch-run-suicide.opus | 2022-02-01 01:37 | 5.2K | |
| dgs-hutch-run.opus | 2022-02-01 01:37 | 13K | |
| dgs-iris-launcher-2.opus | 2022-02-01 01:37 | 5.3K | |
| dgs-iris-launcher-objection.opus | 2022-02-01 01:37 | 8.6K | |
| dgs-iris-launcher.opus | 2022-02-01 01:37 | 5.1K | |
| dgs-jezail-bite.opus | 2022-02-01 01:37 | 5.5K | |
| dgs-jezail-bottledrop-fast.opus | 2022-02-01 01:37 | 25K | |
| dgs-jezail-bottledrop.opus | 2022-02-01 01:37 | 53K | |
| dgs-jezail-breakdown-short.opus | 2022-02-01 01:37 | 76K | |
| dgs-jezail-breakdown.opus | 2022-02-01 01:37 | 262K | |
| dgs-jezail-faint.opus | 2022-02-01 01:37 | 20K | |
| dgs-jezail-gasping.opus | 2022-02-01 01:37 | 18K | |
| dgs-jezail-point-2.opus | 2022-02-01 01:37 | 24K | |
| dgs-jezail-point.opus | 2022-02-01 01:37 | 6.3K | |
| dgs-jezail-shutup.opus | 2022-02-01 01:37 | 7.8K | |
| dgs-joan-muzai.opus | 2022-02-01 01:37 | 9.8K | |
| dgs-joan-toitsume.opus | 2022-02-01 01:37 | 7.4K | |
| dgs-joan-yuzai.opus | 2022-02-01 01:37 | 10K | |
| dgs-josephine-muzai.opus | 2022-02-01 01:37 | 9.6K | |
| dgs-josephine-stab.opus | 2022-02-01 01:37 | 4.2K | |
| dgs-josephine-yuzai.opus | 2022-02-01 01:37 | 10K | |
| dgs-jr-end.opus | 2022-02-01 01:37 | 68K | |
| dgs-jr-holdit.opus | 2022-02-01 01:37 | 37K | |
| dgs-jr-init.opus | 2022-02-01 01:37 | 25K | |
| dgs-ladyfirst-giddyup.opus | 2022-02-01 01:37 | 14K | |
| dgs-ladyfirst-proteststart.opus | 2022-02-01 01:37 | 7.4K | |
| dgs-mae-muzai.opus | 2022-02-01 01:37 | 9.6K | |
| dgs-mae-scrub-2.opus | 2022-02-01 01:37 | 8.5K | |
| dgs-mae-scrub.opus | 2022-02-01 01:37 | 10K | |
| dgs-mae-yuzai.opus | 2022-02-01 01:37 | 10K | |
| dgs-matilda-1beep.opus | 2022-02-01 01:37 | 2.5K | |
| dgs-matilda-1boop.opus | 2022-02-01 01:37 | 2.1K | |
| dgs-matilda-2beep.opus | 2022-02-01 01:37 | 4.3K | |
| dgs-matilda-2boop.opus | 2022-02-01 01:37 | 3.3K | |
| dgs-matilda-4beep.opus | 2022-02-01 01:37 | 6.6K | |
| dgs-matilda-4boop.opus | 2022-02-01 01:37 | 6.8K | |
| dgs-matilda-ding.opus | 2022-02-01 01:38 | 6.8K | |
| dgs-matilda-fluster.opus | 2022-02-01 01:38 | 16K | |
| dgs-matilda-intense.opus | 2022-02-01 01:38 | 5.9K | |
| dgs-matilda-muzai.opus | 2022-02-01 01:38 | 9.6K | |
| dgs-matilda-sweat.opus | 2022-02-01 01:38 | 6.4K | |
| dgs-matilda-transmit-old.opus | 2022-02-01 01:38 | 5.4K | |
| dgs-matilda-transmit.opus | 2022-02-01 01:38 | 5.4K | |
| dgs-matilda-typewriter-2.opus | 2022-02-01 01:38 | 3.1K | |
| dgs-matilda-typewriter.opus | 2022-02-01 01:38 | 2.9K | |
| dgs-matilda-whack.opus | 2022-02-01 01:38 | 9.4K | |
| dgs-matilda-yuzai.opus | 2022-02-01 01:38 | 9.8K | |
| dgs-megundal-coin-toss.opus | 2022-02-01 01:38 | 5.9K | |
| dgs-megundal-coin.opus | 2022-02-01 01:38 | 6.9K | |
| dgs-megundal-facehand.opus | 2022-02-01 01:38 | 2.0K | |
| dgs-megundal-fingeropen.opus | 2022-02-01 01:38 | 2.4K | |
| dgs-megundal-jojo.opus | 2022-02-01 01:38 | 8.6K | |
| dgs-narcissus-desktap.opus | 2022-02-01 01:38 | 5.0K | |
| dgs-narcissus-muzai.opus | 2022-02-01 01:38 | 24K | |
| dgs-narcissus-rose.opus | 2022-02-01 01:38 | 2.9K | |
| dgs-narcissus-yuzai.opus | 2022-02-01 01:38 | 23K | |
| dgs-niko-breakdown.opus | 2022-02-01 01:38 | 81K | |
| dgs-oreil-bottle-place.opus | 2022-02-01 01:38 | 2.2K | |
| dgs-oreil-bottle-slam.opus | 2022-02-01 01:38 | 4.8K | |
| dgs-oreil-muzai.opus | 2022-02-01 01:38 | 13K | |
| dgs-oreil-yuzai.opus | 2022-02-01 01:38 | 13K | |
| dgs-oscar-bend.opus | 2022-02-01 01:38 | 9.9K | |
| dgs-oscar-bite.opus | 2022-02-01 01:38 | 33K | |
| dgs-oscar-muzai.opus | 2022-02-01 01:38 | 9.4K | |
| dgs-oscar-swing.opus | 2022-02-01 01:38 | 2.0K | |
| dgs-oscar-toitsume.opus | 2022-02-01 01:38 | 7.6K | |
| dgs-oscar-yuzai.opus | 2022-02-01 01:38 | 9.5K | |
| dgs-roylott-shuffle.opus | 2022-02-01 01:38 | 2.8K | |
| dgs-roylott-snip.opus | 2022-02-01 01:38 | 4.6K | |
| dgs-roylott-transform-2.opus | 2022-02-01 01:38 | 47K | |
| dgs-roylott-transform.opus | 2022-02-01 01:38 | 47K | |
| dgs-ryu-chotto.opus | 2022-02-01 01:38 | 14K | |
| dgs-ryu-hai.opus | 2022-02-01 01:38 | 12K | |
| dgs-ryu-kokoda.opus | 2022-02-01 01:38 | 12K | |
| dgs-ryu-shimata.opus | 2022-02-01 01:38 | 25K | |
| dgs-ryu-shuffle.opus | 2022-02-01 01:38 | 15K | |
| dgs-ryu-smack.opus | 2022-02-01 01:38 | 12K | |
| dgs-sanmon-damage.opus | 2022-02-01 01:38 | 16K | |
| dgs-sanmon-pissed.opus | 2022-02-01 01:38 | 3.6K | |
| dgs-sanmon-pull.opus | 2022-02-01 01:38 | 5.5K | |
| dgs-shiv-damage.opus | 2022-02-01 01:38 | 5.9K | |
| dgs-shiv-muzai.opus | 2022-02-01 01:38 | 12K | |
| dgs-shiv-stab.opus | 2022-02-01 01:38 | 1.7K | |
| dgs-shiv-stuck.opus | 2022-02-01 01:38 | 23K | |
| dgs-shiv-toss.opus | 2022-02-01 01:38 | 3.5K | |
| dgs-shiv-yuzai.opus | 2022-02-01 01:38 | 12K | |
| dgs-snap.opus | 2022-02-01 01:38 | 4.3K | |
| dgs-spotlight-close.opus | 2022-02-01 01:38 | 4.6K | |
| dgs-spotlight-open.opus | 2022-02-01 01:38 | 7.5K | |
| dgs-stroganov-snake-angry-long.opus | 2022-02-01 01:38 | 30K | |
| dgs-stroganov-snake-angry.opus | 2022-02-01 01:38 | 5.3K | |
| dgs-stroganov-snake-content-long.opus | 2022-02-01 01:38 | 13K | |
| dgs-stroganov-snake-content.opus | 2022-02-01 01:38 | 7.7K | |
| dgs-stroganov-snake-furious-long.opus | 2022-02-01 01:38 | 22K | |
| dgs-stroganov-snake-furious.opus | 2022-02-01 01:38 | 5.0K | |
| dgs-stroganov-snake-normal-long.opus | 2022-02-01 01:38 | 17K | |
| dgs-stroganov-snake-normal.opus | 2022-02-01 01:38 | 3.7K | |
| dgs-surprise-2.opus | 2022-02-01 01:38 | 15K | |
| dgs-surprise-3.opus | 2022-02-01 01:38 | 14K | |
| dgs-surprise-4.opus | 2022-02-01 01:38 | 29K | |
| dgs-surprise.opus | 2022-02-01 01:38 | 15K | |
| dgs-susato-book-flip.opus | 2022-02-01 01:38 | 25K | |
| dgs-susato-book-idea.opus | 2022-02-01 01:38 | 3.6K | |
| dgs-susato-book-post.opus | 2022-02-01 01:38 | 4.3K | |
| dgs-susato-book.opus | 2022-02-01 01:38 | 5.5K | |
| dgs-tinpillar-brocake.opus | 2022-02-01 01:38 | 14K | |
| dgs-tinpillar-dualeat.opus | 2022-02-01 01:38 | 3.6K | |
| dgs-tinpillar-nemmy-damage.opus | 2022-02-01 01:38 | 5.0K | |
| dgs-tinpillar-nemmy-eat.opus | 2022-02-01 01:38 | 3.6K | |
| dgs-tinpillar-pose-old.opus | 2022-02-01 01:38 | 11K | |
| dgs-tinpillar-pose.opus | 2022-02-01 01:38 | 8.3K | |
| dgs-tinpillar-tully-damage.opus | 2022-02-01 01:38 | 4.8K | |
| dgs-tinpillar-tully-eat.opus | 2022-02-01 01:38 | 3.3K | |
| dgs-vortex-longtwirl.opus | 2022-02-01 01:38 | 4.9K | |
| dgs-vortex-stick-roll-back.opus | 2022-02-01 01:38 | 2.7K | |
| dgs-vortex-stick-roll.opus | 2022-02-01 01:38 | 4.7K | |
| dgs-vortex-watch-close.opus | 2022-02-01 01:38 | 2.3K | |
| dgs-vortex-watch-open.opus | 2022-02-01 01:38 | 2.3K | |
| dgs-vortex-watch-screw.opus | 2022-02-01 01:38 | 8.0K | |
| dgs-vortex-watch-second-lp.opus | 2022-02-01 01:38 | 5.8K | |
| dgs2-altamont-close.opus | 2022-02-01 01:38 | 1.4K | |
| dgs2-altamont-hit.opus | 2022-02-01 01:38 | 2.5K | |
| dgs2-altamont-open.opus | 2022-02-01 01:38 | 2.1K | |
| dgs2-altamont-swoosh.opus | 2022-02-01 01:38 | 2.0K | |
| dgs2-altamont-umbrellasmack.opus | 2022-02-01 01:38 | 2.7K | |
| dgs2-decargo-choke.opus | 2022-02-01 01:38 | 8.6K | |
| dgs2-decargo-pose.opus | 2022-02-01 01:38 | 8.2K | |
| dgs2-decargo-tug.opus | 2022-02-01 01:38 | 3.0K | |
| dgs2-drebber-break.opus | 2022-02-01 01:38 | 9.4K | |
| dgs2-drebber-damage-2.opus | 2022-02-01 01:38 | 7.1K | |
| dgs2-drebber-damage-3.opus | 2022-02-01 01:38 | 10K | |
| dgs2-drebber-damage.opus | 2022-02-01 01:38 | 4.4K | |
| dgs2-drebber-examine.opus | 2022-02-01 01:38 | 20K | |
| dgs2-drebber-fall.opus | 2022-02-01 01:38 | 8.8K | |
| dgs2-drebber-nod.opus | 2022-02-01 01:38 | 3.1K | |
| dgs2-drebber-robotnoise-2.opus | 2022-02-01 01:38 | 9.0K | |
| dgs2-drebber-robotnoise.opus | 2022-02-01 01:38 | 2.1K | |
| dgs2-drebber-shake.opus | 2022-02-01 01:38 | 6.3K | |
| dgs2-drebber-slam.opus | 2022-02-01 01:38 | 9.6K | |
| dgs2-drebber-smirk.opus | 2022-02-01 01:38 | 6.6K | |
| dgs2-goulloyne-mask-off.opus | 2022-02-01 01:38 | 3.3K | |
| dgs2-goulloyne-mask-on.opus | 2022-02-01 01:38 | 3.8K | |
| dgs2-heita-camera-snap-quick.opus | 2022-02-01 01:38 | 4.4K | |
| dgs2-heita-camera-snap.opus | 2022-02-01 01:38 | 5.7K | |
| dgs2-heita-camera-swing.opus | 2022-02-01 01:38 | 29K | |
| dgs2-heita-hat-throw.opus | 2022-02-01 01:38 | 13K | |
| dgs2-heita-notepad-write.opus | 2022-02-01 01:38 | 5.0K | |
| dgs2-heita-pencil-break.opus | 2022-02-01 01:38 | 2.4K | |
| dgs2-heita-suspenders-pull.opus | 2022-02-01 01:38 | 8.7K | |
| dgs2-heita-suspenders-snap.opus | 2022-02-01 01:38 | 4.6K | |
| dgs2-rozaic-potbubble.opus | 2022-02-01 01:38 | 10K | |
| dgs2-rozaic-roll.opus | 2022-02-01 01:38 | 4.3K | |
| dgs2-rumba-pop.opus | 2022-02-01 01:38 | 3.4K | |
| dgs2-venus-cracker-boom.opus | 2022-02-01 01:38 | 3.8K | |
| dgs2-venus-cracker-catch.opus | 2022-02-01 01:38 | 4.0K | |
| dgs2-venus-damage.opus | 2022-02-01 01:38 | 3.8K | |
| dgs2-venus-match.opus | 2022-02-01 01:38 | 8.0K | |
| dgs2-venus-smooch.opus | 2022-02-01 01:38 | 1.2K | |
| dgs2-venus-toss.opus | 2022-02-01 01:38 | 15K | |
| dgs2-yuujin-aibou.opus | 2022-02-01 01:38 | 33K | |
| dgs2-yuujin-tap.opus | 2022-02-01 01:38 | 13K | |
| diego_armando_slam_special.opus | 2022-02-01 01:38 | 10K | |
| dirt.mp3 | 2024-01-28 02:54 | 42K | |
| disciple/ | 2022-02-01 02:00 | - | |
| disword.opus | 2022-02-01 01:38 | 98K | |
| dmitri/ | 2022-02-01 02:00 | - | |
| dobinbough/ | 2022-02-01 02:00 | - | |
| door.mp3 | 2024-01-28 02:54 | 62K | |
| dr/ | 2022-02-01 02:01 | - | |
| dr2-koma-laugh.opus | 2022-02-01 01:38 | 100K | |
| drannouncement.opus | 2022-02-01 01:38 | 20K | |
| drebber/ | 2022-02-01 02:01 | - | |
| drv3-nishishi.opus | 2022-02-01 01:38 | 14K | |
| dunk.opus | 2022-02-01 01:38 | 2.0M | |
| dunk_inst.opus | 2022-02-01 01:38 | 2.0M | |
| elizabeth/ | 2022-02-01 02:01 | - | |
| ellen/ | 2022-02-01 02:01 | - | |
| eltnum-finalgun.opus | 2022-02-01 01:38 | 99K | |
| eltnum-longgun.opus | 2022-02-01 01:38 | 28K | |
| eltnum-walkin.opus | 2022-02-01 01:38 | 20K | |
| ema/ | 2022-02-01 02:01 | - | |
| encore.opus | 2022-02-01 01:38 | 2.3M | |
| encore_inst.opus | 2022-02-01 01:38 | 2.2M | |
| et-badum.opus | 2022-02-01 01:38 | 6.4K | |
| et-bark.opus | 2022-02-01 01:38 | 6.1K | |
| et-bip-2.opus | 2022-02-01 01:38 | 1.2K | |
| et-bip-3.opus | 2022-02-01 01:38 | 1.2K | |
| et-bip.opus | 2022-02-01 01:38 | 1.1K | |
| et-bleep.opus | 2022-02-01 01:38 | 1.4K | |
| et-bling-2.opus | 2022-02-01 01:38 | 6.9K | |
| et-blink.opus | 2022-02-01 01:38 | 1.4K | |
| et-bvvt.opus | 2022-02-01 01:38 | 1.7K | |
| et-cancel.opus | 2022-02-01 01:38 | 1.7K | |
| et-chug.opus | 2022-02-01 01:38 | 2.6K | |
| et-damage-2.opus | 2022-02-01 01:38 | 5.0K | |
| et-damage.opus | 2022-02-01 01:38 | 4.4K | |
| et-deskslam-2.opus | 2022-02-01 01:38 | 12K | |
| et-deskslam.opus | 2022-02-01 01:38 | 4.6K | |
| et-dink.opus | 2022-02-01 01:38 | 1.9K | |
| et-dramapound.opus | 2022-02-01 01:38 | 3.6K | |
| et-evidenceshoop.opus | 2022-02-01 01:38 | 1.9K | |
| et-explosion.opus | 2022-02-01 01:38 | 14K | |
| et-fwashing.opus | 2022-02-01 01:38 | 8.3K | |
| et-fwasshing.opus | 2022-02-01 01:38 | 4.6K | |
| et-gallery-cheer.opus | 2022-02-01 01:38 | 21K | |
| et-gallery-gavel-2.opus | 2022-02-01 01:38 | 17K | |
| et-gallery-gavel.opus | 2022-02-01 01:38 | 15K | |
| et-gallery.opus | 2022-02-01 01:38 | 13K | |
| et-gavel-triple.opus | 2022-02-01 01:38 | 8.9K | |
| et-gavel.opus | 2022-02-01 01:38 | 2.4K | |
| et-grinding-2.opus | 2022-02-01 01:38 | 3.5K | |
| et-grinding.opus | 2022-02-01 01:38 | 4.0K | |
| et-guilty.opus | 2022-02-01 01:38 | 7.7K | |
| et-gunshot-2.opus | 2022-02-01 01:38 | 6.4K | |
| et-gunshot-3.opus | 2022-02-01 01:38 | 5.8K | |
| et-gunshot-4.opus | 2022-02-01 01:38 | 5.7K | |
| et-gunshot.opus | 2022-02-01 01:38 | 9.2K | |
| et-happyping.opus | 2022-02-01 01:38 | 4.4K | |
| et-judge-opening.opus | 2022-02-01 01:38 | 74K | |
| et-lightbang.opus | 2022-02-01 01:38 | 3.2K | |
| et-lightbulb.opus | 2022-02-01 01:38 | 5.4K | |
| et-lock.opus | 2022-02-01 01:38 | 4.8K | |
| et-locksbreak.opus | 2022-02-01 01:38 | 7.2K | |
| et-longwoosh.opus | 2022-02-01 01:38 | 17K | |
| et-loudbang.opus | 2022-02-01 01:38 | 4.1K | |
| et-maaagical-2.opus | 2022-02-01 01:38 | 10K | |
| et-maaagical-3.opus | 2022-02-01 01:38 | 12K | |
| et-maaagical.opus | 2022-02-01 01:38 | 14K | |
| et-meekins-damage.opus | 2022-02-01 01:38 | 8.9K | |
| et-meow.opus | 2022-02-01 01:38 | 5.5K | |
| et-notguilty.opus | 2022-02-01 01:38 | 28K | |
| et-objection.opus | 2022-02-01 01:38 | 7.9K | |
| et-pageturn.opus | 2022-02-01 01:38 | 3.2K | |
| et-peep.opus | 2022-02-01 01:38 | 1.5K | |
| et-peep2.opus | 2022-02-01 01:38 | 1.5K | |
| et-phone-2.opus | 2022-02-01 01:38 | 1.2K | |
| et-phone-3.opus | 2022-02-01 01:38 | 1.2K | |
| et-phone-4.opus | 2022-02-01 01:38 | 1.2K | |
| et-phone-5.opus | 2022-02-01 01:38 | 1.2K | |
| et-phone-beep.opus | 2022-02-01 01:38 | 2.1K | |
| et-phone.opus | 2022-02-01 01:38 | 1.2K | |
| et-photosnap.opus | 2022-02-01 01:38 | 3.1K | |
| et-pichoop.opus | 2022-02-01 01:38 | 1.6K | |
| et-powder.opus | 2022-02-01 01:38 | 4.1K | |
| et-psyche.opus | 2022-02-01 01:38 | 4.5K | |
| et-roar.opus | 2022-02-01 01:38 | 5.8K | |
| et-saveblip.opus | 2022-02-01 01:38 | 3.5K | |
| et-scenechange.opus | 2022-02-01 01:38 | 3.5K | |
| et-scroll.opus | 2022-02-01 01:38 | 1.5K | |
| et-selectblip-2.opus | 2022-02-01 01:38 | 2.2K | |
| et-selectblip.opus | 2022-02-01 01:38 | 1.3K | |
| et-selectjingle.opus | 2022-02-01 01:38 | 8.5K | |
| et-shattering.opus | 2022-02-01 01:38 | 8.0K | |
| et-shock-2.opus | 2022-02-01 01:38 | 5.7K | |
| et-shock.opus | 2022-02-01 01:38 | 3.7K | |
| et-shook.opus | 2022-02-01 01:38 | 3.1K | |
| et-shook2.opus | 2022-02-01 01:38 | 2.5K | |
| et-shoomp.opus | 2022-02-01 01:38 | 3.8K | |
| et-shooop.opus | 2022-02-01 01:38 | 1.7K | |
| et-sirens.opus | 2022-02-01 01:38 | 14K | |
| et-smack.opus | 2022-02-01 01:38 | 3.1K | |
| et-splatter.opus | 2022-02-01 01:38 | 11K | |
| et-stab-2.opus | 2022-02-01 01:38 | 4.3K | |
| et-stab.opus | 2022-02-01 01:38 | 4.4K | |
| et-supershock.opus | 2022-02-01 01:38 | 6.4K | |
| et-swing.opus | 2022-02-01 01:38 | 2.8K | |
| et-swing2.opus | 2022-02-01 01:38 | 2.3K | |
| et-swingtwice.opus | 2022-02-01 01:38 | 3.1K | |
| et-swoop-2.opus | 2022-02-01 01:38 | 2.2K | |
| et-swoop.opus | 2022-02-01 01:38 | 2.1K | |
| et-thwap.opus | 2022-02-01 01:38 | 2.0K | |
| et-typewriter.opus | 2022-02-01 01:38 | 1.6K | |
| et-ween.opus | 2022-02-01 01:38 | 11K | |
| et-whack.opus | 2022-02-01 01:38 | 3.5K | |
| et-wham.opus | 2022-02-01 01:38 | 6.5K | |
| et-whimper.opus | 2022-02-01 01:38 | 5.3K | |
| et-whip.opus | 2022-02-01 01:38 | 11K | |
| et-whoops.opus | 2022-02-01 01:38 | 6.0K | |
| et-wipe.opus | 2022-02-01 01:38 | 2.2K | |
| et-yip.opus | 2022-02-01 01:38 | 2.9K | |
| et-zooma.opus | 2022-02-01 01:38 | 3.5K | |
| fall.opus | 2022-02-01 01:38 | 8.6K | |
| favijsgabuzzino.opus | 2022-02-01 01:38 | 360K | |
| filch/ | 2022-02-01 02:01 | - | |
| florent/ | 2022-02-01 02:01 | - | |
| flynch/ | 2022-02-01 02:05 | - | |
| freshlovania.opus | 2022-02-01 01:38 | 928K | |
| furio/ | 2022-02-01 02:01 | - | |
| garan/ | 2022-02-01 02:01 | - | |
| gaspen/ | 2022-02-01 02:01 | - | |
| glitcher.opus | 2022-02-01 01:38 | 2.1M | |
| glitcher_inst.opus | 2022-02-01 01:38 | 2.0M | |
| goblinjr.mp3 | 2024-01-28 02:54 | 55K | |
| gonnacry.mp3 | 2024-01-28 02:54 | 25K | |
| gotts/ | 2022-02-01 02:01 | - | |
| gt-gunshot.opus | 2022-02-01 01:38 | 4.6K | |
| gustavia/ | 2022-02-01 02:01 | - | |
| guy/ | 2022-02-01 02:01 | - | |
| halfxehanort.opus | 2022-02-01 01:38 | 66K | |
| heat.opus | 2022-02-01 01:38 | 79K | |
| helloworld.opus | 2022-02-01 01:38 | 1.7M | |
| helloworld_inst.opus | 2022-02-01 01:38 | 1.7M | |
| hemlock/ | 2022-02-01 02:01 | - | |
| herman/ | 2022-02-01 02:01 | - | |
| hugh/ | 2022-02-01 02:01 | - | |
| huzza.opus | 2022-02-01 01:38 | 470K | |
| ic-nani.opus | 2022-02-01 01:38 | 9.1K | |
| ic-objection.opus | 2022-02-01 01:38 | 11K | |
| ic-unexplosion.opus | 2022-02-01 01:38 | 3.8K | |
| iris watson/ | 2022-02-01 02:01 | - | |
| izanamidivinestart.opus | 2022-02-01 01:38 | 22K | |
| izanamidivinestartloop.opus | 2022-02-01 01:38 | 17K | |
| izanamihoopstart.opus | 2022-02-01 01:38 | 13K | |
| izanamiimperatorstart.opus | 2022-02-01 01:38 | 12K | |
| izanamiimperatorstart2.opus | 2022-02-01 01:38 | 9.1K | |
| izanamiringflurry.opus | 2022-02-01 01:38 | 27K | |
| izanamiskullstart.opus | 2022-02-01 01:38 | 21K | |
| izanamiturnaway.opus | 2022-02-01 01:38 | 7.9K | |
| jfa-wellington-breakdown.opus | 2022-02-01 01:38 | 16K | |
| jingle2dgs.opus | 2022-02-01 01:38 | 116K | |
| jingle2dgs2.opus | 2022-02-01 01:38 | 126K | |
| jingleaa.opus | 2022-02-01 01:38 | 41K | |
| jingleaai.opus | 2022-02-01 01:38 | 68K | |
| jingleaai2.opus | 2022-02-01 01:38 | 72K | |
| jingleaj.opus | 2022-02-01 01:38 | 78K | |
| jingledd.opus | 2022-02-01 01:38 | 86K | |
| jingledgs-2.opus | 2022-02-01 01:38 | 118K | |
| jingledgs.opus | 2022-02-01 01:38 | 117K | |
| jingledgs2-2.opus | 2022-02-01 01:38 | 76K | |
| jingledgs2-beta.opus | 2022-02-01 01:38 | 114K | |
| jingledgs2.opus | 2022-02-01 01:38 | 104K | |
| jinglejfa.opus | 2022-02-01 01:38 | 69K | |
| jinglesoj.opus | 2022-02-01 01:38 | 108K | |
| jinglet_t.opus | 2022-02-01 01:38 | 44K | |
| jinxie/ | 2022-02-01 02:01 | - | |
| jjba-stand.opus | 2022-02-01 01:38 | 15K | |
| jjba-standreverse.opus | 2022-02-01 01:39 | 14K | |
| joan garrideb/ | 2022-02-01 02:01 | - | |
| joggingepico.mp3 | 2024-01-28 02:54 | 75K | |
| judgment.opus | 2022-02-01 01:39 | 514K | |
| juniper/ | 2022-02-01 02:01 | - | |
| junko/ | 2022-02-01 02:01 | - | |
| juror-verdict.opus | 2022-02-01 01:39 | 6.2K | |
| kanji/ | 2022-02-01 02:01 | - | |
| kariya-callitaday.opus | 2022-02-01 01:39 | 8.0K | |
| kariya-gameon.opus | 2022-02-01 01:39 | 9.8K | |
| kariya-hm.opus | 2022-02-01 01:39 | 2.3K | |
| kariya-laugh.opus | 2022-02-01 01:39 | 3.6K | |
| kariya-neverwudda.opus | 2022-02-01 01:39 | 9.6K | |
| kariya-playnicenow.opus | 2022-02-01 01:39 | 6.6K | |
| kariya-takewhatyaget.opus | 2022-02-01 01:39 | 7.4K | |
| kariya-zing.opus | 2022-02-01 01:39 | 8.0K | |
| k a r l s o n v i b e (1).opus | 2022-02-01 01:39 | 1.0M | |
| kazuma/ | 2022-02-01 02:02 | - | |
| ken and koromaru/ | 2022-02-01 02:02 | - | |
| kira/ | 2022-02-01 02:02 | - | |
| kitewhistle.opus | 2022-02-01 01:39 | 123K | |
| klavierdd/ | 2022-02-01 02:02 | - | |
| knightley/ | 2022-02-01 02:02 | - | |
| kokichi/ | 2022-02-01 02:02 | - | |
| kyouma.opus | 2022-02-01 01:39 | 44K | |
| labrys/ | 2022-02-01 02:02 | - | |
| lance/ | 2022-02-01 02:02 | - | |
| lo-fi.opus | 2022-02-01 01:39 | 1.4M | |
| madscientist.opus | 2022-02-01 01:39 | 297K | |
| maiday/ | 2022-02-01 02:02 | - | |
| maki/ | 2022-02-01 02:02 | - | |
| makotobounce.opus | 2022-02-01 01:39 | 11K | |
| makotobouncetn.opus | 2022-02-01 01:39 | 18K | |
| makotohappy.opus | 2022-02-01 01:39 | 11K | |
| makotointro.opus | 2022-02-01 01:39 | 12K | |
| makotointrotn.opus | 2022-02-01 01:39 | 19K | |
| makotonormal.opus | 2022-02-01 01:39 | 16K | |
| makotoora.opus | 2022-02-01 01:39 | 25K | |
| makotopose.opus | 2022-02-01 01:39 | 36K | |
| makotoposetn.opus | 2022-02-01 01:39 | 25K | |
| makotoready.opus | 2022-02-01 01:39 | 33K | |
| makotoshock.opus | 2022-02-01 01:39 | 8.1K | |
| makotosuperhappy.opus | 2022-02-01 01:39 | 24K | |
| makotothonk.opus | 2022-02-01 01:39 | 19K | |
| makotovictory.opus | 2022-02-01 01:39 | 21K | |
| makotowiggle.opus | 2022-02-01 01:39 | 30K | |
| mamemomi/ | 2022-02-01 02:02 | - | |
| margaret/ | 2022-02-01 02:02 | - | |
| marie/ | 2022-02-01 02:02 | - | |
| marsh/ | 2022-02-01 02:02 | - | |
| matilda/ | 2022-02-01 02:02 | - | |
| matrixprova.ogg | 2023-09-18 19:30 | 46K | |
| maurice/ | 2022-02-01 02:02 | - | |
| mayaplvsaa/ | 2022-02-01 02:02 | - | |
| mayuri/ | 2022-02-01 02:02 | - | |
| means/ | 2022-02-01 02:02 | - | |
| megumin/ | 2022-02-01 02:03 | - | |
| meow.opus | 2022-02-01 01:39 | 5.5K | |
| micbreak.opus | 2022-02-01 01:39 | 27K | |
| mickey.opus | 2022-02-01 01:39 | 68K | |
| mikotoba/ | 2022-02-01 02:03 | - | |
| mitsuru/ | 2022-02-01 02:03 | - | |
| mj-badbreakdown.opus | 2022-02-01 01:39 | 79K | |
| mj-moonwalk.opus | 2022-02-01 01:39 | 42K | |
| monster_inst.opus | 2022-02-01 01:39 | 1.9M | |
| mr-alfendicutin.opus | 2022-02-01 01:39 | 36K | |
| mr-alfenditransformation.opus | 2022-02-01 01:39 | 21K | |
| mymight.opus | 2022-02-01 01:39 | 16K | |
| myproblem.mp3 | 2024-01-28 02:54 | 56K | |
| mysteryroom/ | 2022-02-01 02:03 | - | |
| nahyuta/ | 2022-02-01 02:03 | - | |
| naoto/ | 2022-02-01 02:03 | - | |
| narratordgs.opus | 2022-02-01 01:39 | 4.2K | |
| narratordgs/ | 2022-02-01 02:03 | - | |
| neoblammed.opus | 2022-02-01 01:39 | 1.1M | |
| neophilly.opus | 2022-02-01 01:39 | 1.4M | |
| neopico.opus | 2022-02-01 01:39 | 1.2M | |
| neopolitan-challenge.opus | 2022-02-01 01:39 | 6.6K | |
| neopolitan-damage-1.opus | 2022-02-01 01:39 | 6.7K | |
| neopolitan-damage-2.opus | 2022-02-01 01:39 | 6.7K | |
| neopolitan-doubt.opus | 2022-02-01 01:39 | 5.7K | |
| neopolitan-dynamic-3.opus | 2022-02-01 01:39 | 8.9K | |
| neopolitan-fall.opus | 2022-02-01 01:39 | 9.6K | |
| neopolitan-giggle.opus | 2022-02-01 01:39 | 11K | |
| neopolitan-outfitchangefull.opus | 2022-02-01 01:39 | 26K | |
| neopolitan-parasolopen-2.opus | 2022-02-01 01:39 | 15K | |
| neopolitan-parasolopen.opus | 2022-02-01 01:39 | 8.7K | |
| neopolitan-resonance.opus | 2022-02-01 01:39 | 34K | |
| neopolitan-sigh.opus | 2022-02-01 01:39 | 8.4K | |
| neopolitan-smug.opus | 2022-02-01 01:39 | 16K | |
| neopolitan-superdamange.opus | 2022-02-01 01:39 | 9.9K | |
| newman/ | 2022-02-01 02:03 | - | |
| nnocpt.opus | 2022-02-01 01:39 | 47K | |
| objection.opus | 2022-02-01 01:39 | 8.5K | |
| okibelieveyou.opus | 2022-02-01 01:39 | 17K | |
| oldbag/ | 2022-02-01 02:03 | - | |
| olivia/ | 2022-02-01 02:03 | - | |
| orla/ | 2022-02-01 02:03 | - | |
| oscar fairplay/ | 2022-02-01 02:03 | - | |
| overhead.opus | 2022-02-01 01:39 | 1.5M | |
| p4u-adachi-and.opus | 2022-02-01 01:39 | 17K | |
| p4u-adachi-brats.opus | 2022-02-01 01:39 | 14K | |
| p4u-adachi-damage.opus | 2022-02-01 01:39 | 23K | |
| p4u-adachi-enoughshit.opus | 2022-02-01 01:39 | 26K | |
| p4u-adachi-getlost.opus | 2022-02-01 01:39 | 14K | |
| p4u-adachi-hotheaded.opus | 2022-02-01 01:39 | 39K | |
| p4u-adachi-laugh.opus | 2022-02-01 01:39 | 20K | |
| p4u-adachi-laugh2.opus | 2022-02-01 01:39 | 11K | |
| p4u-adachi-magatsu.opus | 2022-02-01 01:39 | 36K | |
| p4u-adachi-mangle.opus | 2022-02-01 01:39 | 15K | |
| p4u-adachi-misery.opus | 2022-02-01 01:39 | 9.7K | |
| p4u-adachi-myface.opus | 2022-02-01 01:39 | 8.8K | |
| p4u-adachi-outtamyface.opus | 2022-02-01 01:39 | 25K | |
| p4u-adachi-perish.opus | 2022-02-01 01:39 | 4.8K | |
| p4u-adachi-reality.opus | 2022-02-01 01:39 | 12K | |
| p4u-adachi-shittingme.opus | 2022-02-01 01:39 | 16K | |
| p4u-adachi-shock.opus | 2022-02-01 01:39 | 17K | |
| p4u-adachi-shred.opus | 2022-02-01 01:39 | 6.1K | |
| p4u-adachi-smile.opus | 2022-02-01 01:39 | 8.9K | |
| p4u-adachi-thatsit.opus | 2022-02-01 01:39 | 18K | |
| p4u-adachi-understand.opus | 2022-02-01 01:39 | 23K | |
| p4u-adachi-uwah.opus | 2022-02-01 01:39 | 8.4K | |
| p4u-adachi-uwah2.opus | 2022-02-01 01:39 | 22K | |
| p4u-adachi-uwah3.opus | 2022-02-01 01:39 | 23K | |
| p4u-adachi-walkin.opus | 2022-02-01 01:39 | 21K | |
| p4u-adachi-whatajoke.opus | 2022-02-01 01:39 | 40K | |
| p4u-adachi-wonthitme.opus | 2022-02-01 01:39 | 17K | |
| p4u-aigis-breakdown.opus | 2022-02-01 01:39 | 19K | |
| p4u-aigis-dynamic.opus | 2022-02-01 01:39 | 7.3K | |
| p4u-aigis-salute.opus | 2022-02-01 01:39 | 12K | |
| p4u-aigis-spin.opus | 2022-02-01 01:39 | 15K | |
| parker/ | 2022-02-01 02:03 | - | |
| patricia/ | 2022-02-01 02:03 | - | |
| patrick/ | 2022-02-01 02:03 | - | |
| percieve-start.opus | 2022-02-01 01:39 | 14K | |
| philly.opus | 2022-02-01 01:39 | 1.2M | |
| pico.opus | 2022-02-01 01:39 | 1.0M | |
| pierce/ | 2022-02-01 02:03 | - | |
| pizza.mp3 | 2024-01-28 02:54 | 64K | |
| pl-answeris.opus | 2022-02-01 01:39 | 18K | |
| pl-hint.opus | 2022-02-01 01:39 | 6.7K | |
| pl-incomingpuzzle.opus | 2022-02-01 01:39 | 13K | |
| pl-layton-anotherpuzzle.opus | 2022-02-01 01:39 | 13K | |
| pl-layton-ashamed.opus | 2022-02-01 01:39 | 14K | |
| pl-layton-everypuzzle.opus | 2022-02-01 01:39 | 12K | |
| pl-layton-explanation.opus | 2022-02-01 01:39 | 13K | |
| pl-layton-leadupwin.opus | 2022-02-01 01:39 | 45K | |
| pl-layton-puzzle.opus | 2022-02-01 01:39 | 63K | |
| pl-layton-theory.opus | 2022-02-01 01:39 | 31K | |
| pl-leaduplose.opus | 2022-02-01 01:39 | 37K | |
| pl-leadupwin.opus | 2022-02-01 01:39 | 45K | |
| pl-losepuzzle.opus | 2022-02-01 01:39 | 20K | |
| pl-winpuzzle.opus | 2022-02-01 01:39 | 54K | |
| pl/ | 2022-02-01 02:06 | - | |
| plum/ | 2022-02-01 02:03 | - | |
| plvspw-barnham-attack.opus | 2022-02-01 01:39 | 12K | |
| plvspw-barnham-bless.opus | 2022-02-01 01:39 | 11K | |
| plvspw-barnham-book.opus | 2022-02-01 01:39 | 5.0K | |
| plvspw-barnham-cheer.opus | 2022-02-01 01:39 | 49K | |
| plvspw-barnham-damagetn.opus | 2022-02-01 01:39 | 4.5K | |
| plvspw-barnham-point.opus | 2022-02-01 01:39 | 17K | |
| plvspw-barnham-pointtn.opus | 2022-02-01 01:39 | 12K | |
| plvspw-barnhamcheer.opus | 2022-02-01 01:39 | 68K | |
| plvspw-luke-leaduplose.opus | 2022-02-01 01:39 | 40K | |
| plvspw-luke-leadupwin.opus | 2022-02-01 01:39 | 47K | |
| plvspw-maya-pipehit.opus | 2022-02-01 01:39 | 16K | |
| plvspw-maya-puzzlesolved.opus | 2022-02-01 01:39 | 91K | |
| ponco/ | 2022-02-01 02:03 | - | |
| poppedewaewae.mp3 | 2024-01-28 02:54 | 31K | |
| punched.opus | 2022-02-01 01:39 | 75K | |
| ram.opus | 2022-02-01 01:39 | 1.7M | |
| ram_inst.opus | 2022-02-01 01:39 | 1.6M | |
| ranpo/ | 2022-02-01 02:03 | - | |
| rayfa/ | 2023-08-24 19:38 | - | |
| raygun-anime.opus | 2022-02-01 01:39 | 72K | |
| retinz/ | 2022-02-01 02:03 | - | |
| rezero respawn.opus | 2022-02-01 01:39 | 25K | |
| richard/ | 2022-02-01 02:03 | - | |
| ridelle/ | 2022-02-01 02:03 | - | |
| rise/ | 2022-02-01 02:03 | - | |
| rising1.mp3 | 2023-09-18 19:30 | 2.7M | |
| rola/ | 2022-02-01 02:03 | - | |
| roses.opus | 2022-02-01 01:39 | 1.1M | |
| rozaic/ | 2022-02-01 02:03 | - | |
| saber.opus | 2022-02-01 01:39 | 133K | |
| sasha buckler/ | 2022-02-01 02:04 | - | |
| sayaka/ | 2022-02-01 02:04 | - | |
| scuttlebutt/ | 2022-02-01 02:04 | - | |
| seishirou/ | 2022-02-01 02:04 | - | |
| senpai.opus | 2022-02-01 01:39 | 1.2M | |
| senpai_dies.opus | 2022-02-01 01:39 | 82K | |
| seth-attack.opus | 2022-02-01 01:39 | 62K | |
| sf-q-break.opus | 2022-02-01 01:39 | 13K | |
| sf-q-breathe.opus | 2022-02-01 01:39 | 22K | |
| sf-q-hm-2.opus | 2022-02-01 01:39 | 13K | |
| sf-q-hm.opus | 2022-02-01 01:39 | 8.3K | |
| sf-q-mumble.opus | 2022-02-01 01:39 | 26K | |
| sf-q-sigh.opus | 2022-02-01 01:39 | 12K | |
| sf-q-turnon.opus | 2022-02-01 01:39 | 24K | |
| sfx-aa-jingle.opus | 2022-02-01 01:39 | 33K | |
| sfx-albabreakdown.opus | 2022-02-01 01:39 | 58K | |
| sfx-albadamage.opus | 2022-02-01 01:39 | 10K | |
| sfx-albatransform.opus | 2022-02-01 01:39 | 25K | |
| sfx-anotherpuzzle.opus | 2022-02-01 01:39 | 13K | |
| sfx-answeris.opus | 2022-02-01 01:39 | 18K | |
| sfx-anubisbark.opus | 2022-02-01 01:39 | 3.0K | |
| sfx-anubisgrowl.opus | 2022-02-01 01:39 | 6.9K | |
| sfx-apollo-facedesk.opus | 2022-02-01 01:39 | 6.6K | |
| sfx-apollopro-electro.opus | 2022-02-01 01:39 | 33K | |
| sfx-arm.opus | 2022-02-01 01:39 | 9.3K | |
| sfx-ashamed.opus | 2022-02-01 01:39 | 14K | |
| sfx-athena-doubleslam.opus | 2022-02-01 01:39 | 15K | |
| sfx-athena-fist.opus | 2022-02-01 01:39 | 4.5K | |
| sfx-athena-matrixstart.opus | 2022-02-01 01:39 | 39K | |
| sfx-athena-peace.opus | 2022-02-01 01:39 | 4.1K | |
| sfx-atmeybreakdown.opus | 2022-02-01 01:39 | 27K | |
| sfx-auchi-breakdown.opus | 2022-02-01 01:39 | 12K | |
| sfx-auchi-confident.opus | 2022-02-01 01:39 | 2.9K | |
| sfx-auchi-confidentslam.opus | 2022-02-01 01:39 | 8.6K | |
| sfx-auchi-damage.opus | 2022-02-01 01:39 | 5.2K | |
| sfx-auchi-deskslam.opus | 2022-02-01 01:39 | 2.7K | |
| sfx-auchi-headslam.opus | 2022-02-01 01:39 | 3.2K | |
| sfx-aura-chop.opus | 2022-02-01 01:39 | 15K | |
| sfx-aura-close.opus | 2022-02-01 01:39 | 7.2K | |
| sfx-aura-laugh.opus | 2022-02-01 01:39 | 18K | |
| sfx-aura-open.opus | 2022-02-01 01:39 | 5.6K | |
| sfx-aura-shoot.opus | 2022-02-01 01:39 | 10K | |
| sfx-badum-dd.opus | 2022-02-01 01:39 | 9.7K | |
| sfx-badum.opus | 2022-02-01 01:39 | 6.4K | |
| sfx-bailiffgun.opus | 2022-02-01 01:39 | 8.2K | |
| sfx-balloon-deflate.opus | 2022-02-01 01:39 | 44K | |
| sfx-balloon-inflate.opus | 2022-02-01 01:39 | 35K | |
| sfx-barok-glass-throw.opus | 2022-02-01 01:39 | 10K | |
| sfx-barok-legslam.opus | 2022-02-01 01:39 | 11K | |
| sfx-barok-pour-out.opus | 2022-02-01 01:39 | 53K | |
| sfx-barok-superobjection.opus | 2022-02-01 01:39 | 23K | |
| sfx-barok-uncloak.opus | 2022-02-01 01:39 | 12K | |
| sfx-barok-wine-catch.opus | 2022-02-01 01:39 | 10K | |
| sfx-barok-wine-crush.opus | 2022-02-01 01:39 | 12K | |
| sfx-barok-wine-pour.opus | 2022-02-01 01:39 | 20K | |
| sfx-barok-wine-throw.opus | 2022-02-01 01:39 | 20K | |
| sfx-bazooka.opus | 2022-02-01 01:39 | 16K | |
| sfx-begininvestigation-aai.opus | 2022-02-01 01:39 | 25K | |
| sfx-betty-bat.opus | 2022-02-01 01:39 | 50K | |
| sfx-betty-hit.opus | 2022-02-01 01:39 | 41K | |
| sfx-betty-reveal.opus | 2022-02-01 01:39 | 33K | |
| sfx-bigclap.opus | 2022-02-01 01:39 | 2.4K | |
| sfx-blackquill-break.opus | 2022-02-01 01:39 | 22K | |
| sfx-blackquill-deskslam.opus | 2022-02-01 01:39 | 24K | |
| sfx-blackquill-doubleslam.opus | 2022-02-01 01:39 | 13K | |
| sfx-blackquill-headtap.opus | 2022-02-01 01:39 | 32K | |
| sfx-blackquill-slash.opus | 2022-02-01 01:39 | 6.3K | |
| sfx-bleep.opus | 2022-02-01 01:39 | 1.4K | |
| sfx-bling2.opus | 2022-02-01 01:39 | 6.9K | |
| sfx-blink.opus | 2022-02-01 01:39 | 1.4K | |
| sfx-blipddfemale.opus | 2022-02-01 01:39 | 1.6K | |
| sfx-blipddmale.opus | 2022-02-01 01:39 | 2.0K | |
| sfx-blipdrfemale.opus | 2022-02-01 01:39 | 1.4K | |
| sfx-blipdrmale.opus | 2022-02-01 01:39 | 1.4K | |
| sfx-blipfemale.opus | 2022-02-01 01:39 | 1.3K | |
| sfx-blipgtfemale.opus | 2022-02-01 01:39 | 1.3K | |
| sfx-blipgtmale.opus | 2022-02-01 01:39 | 1.3K | |
| sfx-bliphex.opus | 2022-02-01 01:39 | 2.7K | |
| sfx-bliplayton.opus | 2022-02-01 01:39 | 1.8K | |
| sfx-blipluke.opus | 2022-02-01 01:39 | 1.6K | |
| sfx-blipmale.opus | 2022-02-01 01:39 | 1.3K | |
| sfx-blipmetal.opus | 2022-02-01 01:39 | 1.3K | |
| sfx-blipnarratordgs.opus | 2022-02-01 01:39 | 4.0K | |
| sfx-bliporla.opus | 2022-02-01 01:39 | 2.6K | |
| sfx-blipplfemale.opus | 2022-02-01 01:39 | 3.1K | |
| sfx-blipplmale.opus | 2022-02-01 01:39 | 1.5K | |
| sfx-blipplmaledeep.opus | 2022-02-01 01:39 | 3.3K | |
| sfx-blipplmalehigh.opus | 2022-02-01 01:39 | 1.4K | |
| sfx-bliprobot.opus | 2022-02-01 01:39 | 2.0K | |
| sfx-blipsniper.opus | 2022-02-01 01:39 | 3.1K | |
| sfx-bliptonate.opus | 2022-02-01 01:39 | 3.5K | |
| sfx-bliptypewriter.opus | 2022-02-01 01:39 | 1.6K | |
| sfx-blipweeb.opus | 2022-02-01 01:39 | 1.7K | |
| sfx-blipyokai.opus | 2022-02-01 01:39 | 1.9K | |
| sfx-blipyttd.opus | 2022-02-01 01:39 | 2.4K | |
| sfx-blipzelda.opus | 2022-02-01 01:39 | 1.9K | |
| sfx-bonnieandkarin-breakdown.opus | 2022-02-01 01:39 | 19K | |
| sfx-bonnieandkarin-canehit.opus | 2022-02-01 01:39 | 3.6K | |
| sfx-bonnieandkarin-hairslap.opus | 2022-02-01 01:39 | 6.6K | |
| sfx-bonny-bunny.opus | 2022-02-01 01:39 | 19K | |
| sfx-bonny-canehit.opus | 2022-02-01 01:39 | 14K | |
| sfx-bonny-damage.opus | 2022-02-01 01:39 | 23K | |
| sfx-bonny-nothing.opus | 2022-02-01 01:39 | 7.2K | |
| sfx-bonny-toss.opus | 2022-02-01 01:39 | 5.9K | |
| sfx-bonny-twirl.opus | 2022-02-01 01:39 | 28K | |
| sfx-bonny-whap.opus | 2022-02-01 01:39 | 15K | |
| sfx-bonny-wink.opus | 2022-02-01 01:39 | 13K | |
| sfx-bonnybetty-carried.opus | 2022-02-01 01:39 | 43K | |
| sfx-bonnybetty-parasol.opus | 2022-02-01 01:39 | 35K | |
| sfx-bonnybetty-reveal.opus | 2022-02-01 01:39 | 9.1K | |
| sfx-bonnybunny2.opus | 2022-02-01 01:39 | 28K | |
| sfx-bowl-foiled.opus | 2022-02-01 01:39 | 62K | |
| sfx-breakdown.opus | 2022-02-01 01:39 | 19K | |
| sfx-cammy-breakdown.opus | 2022-02-01 01:39 | 153K | |
| sfx-cancel.opus | 2022-02-01 01:39 | 1.7K | |
| sfx-catch-shug.opus | 2022-02-01 01:39 | 11K | |
| sfx-chocolatemilk.opus | 2022-02-01 01:39 | 6.7K | |
| sfx-chug.opus | 2022-02-01 01:39 | 2.6K | |
| sfx-chugslam.opus | 2022-02-01 01:39 | 8.7K | |
| sfx-chugspit.opus | 2022-02-01 01:39 | 8.9K | |
| sfx-clap.opus | 2022-02-01 01:39 | 20K | |
| sfx-coat.opus | 2022-02-01 01:39 | 3.9K | |
| sfx-coffeeslide-left.opus | 2022-02-01 01:39 | 7.7K | |
| sfx-coffeeslide.opus | 2022-02-01 01:39 | 6.8K | |
| sfx-con-damage.opus | 2022-02-01 01:39 | 5.2K | |
| sfx-confrontation-aai.opus | 2022-02-01 01:39 | 17K | |
| sfx-cornetto.opus | 2022-02-01 01:39 | 37K | |
| sfx-courtopen.opus | 2022-02-01 01:39 | 74K | |
| sfx-crackle.opus | 2022-02-01 01:39 | 4.1K | |
| sfx-damage-big.opus | 2022-02-01 01:39 | 9.4K | |
| sfx-damage.opus | 2023-08-24 19:37 | 12K | |
| sfx-damage2.opus | 2022-02-01 01:39 | 5.0K | |
| sfx-damagebrushel.opus | 2022-02-01 01:39 | 9.1K | |
| sfx-daryanbreakdown.opus | 2022-02-01 01:39 | 54K | |
| sfx-datz-jump.opus | 2022-02-01 01:39 | 12K | |
| sfx-debestedamage.opus | 2022-02-01 01:39 | 14K | |
| sfx-deskslam-dd.opus | 2023-08-24 19:38 | 7.8K | |
| sfx-deskslam-shattering.opus | 2022-02-01 01:39 | 9.8K | |
| sfx-deskslam.opus | 2022-02-01 01:39 | 5.7K | |
| sfx-dgs-surprise.opus | 2023-08-24 19:38 | 34K | |
| sfx-dgs-surprise2.opus | 2023-08-24 19:38 | 32K | |
| sfx-dgs-surprise3.opus | 2023-08-24 19:38 | 32K | |
| sfx-dgs-surprise4.opus | 2022-02-01 01:39 | 29K | |
| sfx-dhurke-damage.opus | 2022-02-01 01:39 | 7.0K | |
| sfx-dhurke-extend.opus | 2022-02-01 01:39 | 3.3K | |
| sfx-dhurke-furious.opus | 2022-02-01 01:39 | 15K | |
| sfx-dhurke-heartrest.opus | 2022-02-01 01:39 | 5.0K | |
| sfx-dhurke-shot.opus | 2022-02-01 01:39 | 16K | |
| sfx-dingding.opus | 2022-02-01 01:39 | 11K | |
| sfx-dink.opus | 2022-02-01 01:39 | 1.9K | |
| sfx-dramapound-dd.opus | 2022-02-01 01:39 | 7.9K | |
| sfx-dramapound.opus | 2023-08-24 19:38 | 3.1K | |
| sfx-emasojglasses.opus | 2022-02-01 01:40 | 3.4K | |
| sfx-emasojphone.opus | 2022-02-01 01:40 | 5.4K | |
| sfx-emasojsadeat.opus | 2022-02-01 01:40 | 4.1K | |
| sfx-ev.opus | 2022-02-01 01:40 | 82K | |
| sfx-everydayproblem.opus | 2022-02-01 01:40 | 7.6K | |
| sfx-everydayproblem2.opus | 2022-02-01 01:40 | 7.3K | |
| sfx-everypuzzle.opus | 2022-02-01 01:40 | 12K | |
| sfx-evidencecollect-dd.opus | 2022-02-01 01:40 | 25K | |
| sfx-evidencecollect.opus | 2022-02-01 01:40 | 8.5K | |
| sfx-evidenceshoop.opus | 2022-02-01 01:40 | 1.9K | |
| sfx-evidenceupdate-dd.opus | 2022-02-01 01:40 | 22K | |
| sfx-evilmanfred-defeat.opus | 2022-02-01 01:40 | 35K | |
| sfx-evilmanfred-guilty.opus | 2022-02-01 01:40 | 16K | |
| sfx-evilmanfred-headbang.opus | 2022-02-01 01:40 | 9.3K | |
| sfx-evilmanfred-notguilty.opus | 2022-02-01 01:40 | 48K | |
| sfx-evilmanfred-pyronlazer.opus | 2022-02-01 01:40 | 10K | |
| sfx-evilmanfred-ragingdemon.opus | 2022-02-01 01:40 | 84K | |
| sfx-evilmanfred-roar.opus | 2022-02-01 01:40 | 34K | |
| sfx-evilmanfred-scream.opus | 2022-02-01 01:40 | 52K | |
| sfx-evilmanfred-thinking.opus | 2022-02-01 01:40 | 5.9K | |
| sfx-evilmanfred-transform.opus | 2022-02-01 01:40 | 59K | |
| sfx-explosion-dd.opus | 2022-02-01 01:40 | 8.9K | |
| sfx-explosion-dd.wav | 2023-08-24 19:38 | 86K | |
| sfx-explosion-faint.opus | 2022-02-01 01:40 | 23K | |
| sfx-explosion.opus | 2022-02-01 01:40 | 14K | |
| sfx-extend.opus | 2022-02-01 01:40 | 3.2K | |
| sfx-fallthud.opus | 2022-02-01 01:40 | 15K | |
| sfx-fan.opus | 2022-02-01 01:40 | 17K | |
| sfx-flapping.opus | 2022-02-01 01:40 | 6.4K | |
| sfx-flop.opus | 2022-02-01 01:40 | 5.3K | |
| sfx-fulbright-badgepull-short.opus | 2022-02-01 01:40 | 10K | |
| sfx-fulbright-badgepull.opus | 2022-02-01 01:40 | 21K | |
| sfx-fulbright-fist.opus | 2022-02-01 01:40 | 4.2K | |
| sfx-furio.opus | 2022-02-01 01:40 | 8.4K | |
| sfx-fwashing.opus | 2022-02-01 01:40 | 8.3K | |
| sfx-fwasshing.opus | 2022-02-01 01:40 | 4.6K | |
| sfx-gallery.opus | 2022-02-01 01:40 | 13K | |
| sfx-gallerycheer.opus | 2022-02-01 01:40 | 21K | |
| sfx-gallerycheergavel.opus | 2022-02-01 01:40 | 23K | |
| sfx-gallerygavel.opus | 2022-02-01 01:40 | 16K | |
| sfx-gallerytriplegavel.opus | 2022-02-01 01:40 | 20K | |
| sfx-gant-breakdown.opus | 2022-02-01 01:40 | 33K | |
| sfx-gant-clap.opus | 2022-02-01 01:40 | 25K | |
| sfx-gaspen-yeah!.opus | 2022-02-01 01:40 | 21K | |
| sfx-gaspenbreakdown.opus | 2022-02-01 01:40 | 119K | |
| sfx-gaspenshine.opus | 2022-02-01 01:40 | 9.1K | |
| sfx-gatling.opus | 2022-02-01 01:40 | 63K | |
| sfx-gavel-dd.opus | 2022-02-01 01:40 | 4.2K | |
| sfx-gavel-soj.opus | 2022-02-01 01:40 | 9.1K | |
| sfx-gavel.opus | 2022-02-01 01:40 | 2.4K | |
| sfx-gavelopen.opus | 2022-02-01 01:40 | 3.4K | |
| sfx-gear2.opus | 2022-02-01 01:40 | 30K | |
| sfx-gear4.opus | 2022-02-01 01:40 | 61K | |
| sfx-gina-coat.opus | 2022-02-01 01:40 | 4.5K | |
| sfx-gina-coin.opus | 2022-02-01 01:40 | 12K | |
| sfx-gina-gun-lock.opus | 2022-02-01 01:40 | 48K | |
| sfx-gina-gun-lock_fire.opus | 2022-02-01 01:40 | 71K | |
| sfx-gina-gun-stance.opus | 2022-02-01 01:40 | 5.0K | |
| sfx-gina-gunfire.opus | 2022-02-01 01:40 | 13K | |
| sfx-gina-problem.opus | 2022-02-01 01:40 | 7.8K | |
| sfx-gina-tantrum.opus | 2022-02-01 01:40 | 3.3K | |
| sfx-goddessgavel.opus | 2022-02-01 01:40 | 4.9K | |
| sfx-goulloyne-mask-off.opus | 2022-02-01 01:40 | 3.3K | |
| sfx-goulloyne-mask-on.opus | 2022-02-01 01:40 | 3.8K | |
| sfx-guilty-dd.opus | 2022-02-01 01:40 | 20K | |
| sfx-guilty.opus | 2022-02-01 01:40 | 28K | |
| sfx-guitar.opus | 2022-02-01 01:40 | 26K | |
| sfx-guitarpound.opus | 2022-02-01 01:40 | 42K | |
| sfx-guitarrif.opus | 2022-02-01 01:40 | 8.5K | |
| sfx-gunload.opus | 2022-02-01 01:40 | 2.6K | |
| sfx-gunshot.opus | 2022-02-01 01:40 | 9.2K | |
| sfx-gunshot2.opus | 2022-02-01 01:40 | 6.4K | |
| sfx-gunshot3.opus | 2022-02-01 01:40 | 5.8K | |
| sfx-gunshot4.opus | 2022-02-01 01:40 | 5.7K | |
| sfx-gunshot5.opus | 2022-02-01 01:40 | 7.3K | |
| sfx-gunshot5.wav | 2023-08-24 19:38 | 51K | |
| sfx-gunshotstab.opus | 2022-02-01 01:40 | 14K | |
| sfx-happyping.opus | 2022-02-01 01:40 | 4.4K | |
| sfx-havealook.opus | 2022-02-01 01:40 | 14K | |
| sfx-heavyslam.opus | 2022-02-01 01:40 | 12K | |
| sfx-hint.opus | 2022-02-01 01:40 | 6.7K | |
| sfx-hold-it-mr-holmes-init.opus | 2022-02-01 01:40 | 37K | |
| sfx-holmes-pose.opus | 2022-02-01 01:40 | 8.3K | |
| sfx-holmes-snap.opus | 2022-02-01 01:40 | 6.1K | |
| sfx-hosonaga-doublecough.opus | 2022-02-01 01:40 | 4.2K | |
| sfx-hosonaga-heavycough.opus | 2022-02-01 01:40 | 12K | |
| sfx-hosonaga-pour.opus | 2022-02-01 01:40 | 20K | |
| sfx-hosonaga-problem.opus | 2022-02-01 01:40 | 7.3K | |
| sfx-huang-breakdown.opus | 2022-02-01 01:40 | 45K | |
| sfx-incomingpuzzle.opus | 2022-02-01 01:40 | 13K | |
| sfx-infinitetwirl.opus | 2022-02-01 01:40 | 50K | |
| sfx-inga-dismiss.opus | 2022-02-01 01:40 | 8.6K | |
| sfx-inga-empty.opus | 2022-02-01 01:40 | 8.6K | |
| sfx-inga-gunshot-triple.opus | 2022-02-01 01:40 | 20K | |
| sfx-inga-gunshot.opus | 2022-02-01 01:40 | 16K | |
| sfx-inga-run.opus | 2022-02-01 01:40 | 15K | |
| sfx-inga-summon.opus | 2022-02-01 01:40 | 57K | |
| sfx-insight.opus | 2022-02-01 01:40 | 87K | |
| sfx-intro.opus | 2022-02-01 01:40 | 24K | |
| sfx-investigationcomplete-aai.opus | 2022-02-01 01:40 | 37K | |
| sfx-jay-breakdown.opus | 2022-02-01 01:40 | 47K | |
| sfx-jay-decloak.opus | 2022-02-01 01:40 | 3.4K | |
| sfx-jay-punch.opus | 2022-02-01 01:40 | 1.9K | |
| sfx-jay-punched.opus | 2022-02-01 01:40 | 4.2K | |
| sfx-jay-punches.opus | 2022-02-01 01:40 | 9.2K | |
| sfx-jay-weightloss.opus | 2022-02-01 01:40 | 16K | |
| sfx-jezail-bite.opus | 2022-02-01 01:40 | 5.5K | |
| sfx-jezail-bottledrop-fast.opus | 2022-02-01 01:40 | 25K | |
| sfx-jezail-bottledrop.opus | 2022-02-01 01:40 | 53K | |
| sfx-jezail-breakdown.opus | 2022-02-01 01:40 | 262K | |
| sfx-jezail-faint.opus | 2022-02-01 01:40 | 20K | |
| sfx-jezail-gasping.opus | 2022-02-01 01:40 | 18K | |
| sfx-jezail-point.opus | 2022-02-01 01:40 | 6.3K | |
| sfx-jiggle.opus | 2022-02-01 01:40 | 15K | |
| sfx-jinxie-charm.opus | 2022-02-01 01:40 | 12K | |
| sfx-jinxie-charmreverse.opus | 2022-02-01 01:40 | 10K | |
| sfx-jinxie-smack.opus | 2022-02-01 01:40 | 4.1K | |
| sfx-jinxie-smackreverse.opus | 2022-02-01 01:40 | 4.3K | |
| sfx-joint-reasoning-init.opus | 2022-02-01 01:40 | 25K | |
| sfx-jurorslam.opus | 2022-02-01 01:40 | 6.4K | |
| sfx-jurytestimony.opus | 2022-02-01 01:40 | 37K | |
| sfx-katonk.opus | 2022-02-01 01:40 | 2.6K | |
| sfx-kiss.opus | 2022-02-01 01:40 | 5.1K | |
| sfx-kristophdeskslam.opus | 2022-02-01 01:40 | 52K | |
| sfx-lightbulb-dd.opus | 2022-02-01 01:40 | 13K | |
| sfx-lightbulb-dd.wav | 2023-08-24 19:38 | 78K | |
| sfx-lightbulb.opus | 2022-02-01 01:40 | 5.4K | |
| sfx-losepuzzle.opus | 2022-02-01 01:40 | 20K | |
| sfx-luffy-axe.opus | 2022-02-01 01:40 | 76K | |
| sfx-luffy-gear4.opus | 2022-02-01 01:40 | 53K | |
| sfx-luffy-pistol.opus | 2022-02-01 01:40 | 24K | |
| sfx-maaagical.opus | 2022-02-01 01:40 | 14K | |
| sfx-maaagical2.opus | 2022-02-01 01:40 | 10K | |
| sfx-maaagical3.opus | 2022-02-01 01:40 | 12K | |
| sfx-matrixswipe.opus | 2022-02-01 01:40 | 5.3K | |
| sfx-matt-breakdown.opus | 2022-02-01 01:40 | 42K | |
| sfx-meekinsdamage.opus | 2022-02-01 01:40 | 8.9K | |
| sfx-megaslamdouble.opus | 2022-02-01 01:40 | 9.1K | |
| sfx-megundal-clapping.opus | 2022-02-01 01:40 | 26K | |
| sfx-megundal-coin.opus | 2022-02-01 01:40 | 35K | |
| sfx-megundal-cointoss.opus | 2022-02-01 01:40 | 5.9K | |
| sfx-megundal-cover.opus | 2022-02-01 01:40 | 2.0K | |
| sfx-megundal-coveruncover.opus | 2022-02-01 01:40 | 2.4K | |
| sfx-megundal-problem.opus | 2022-02-01 01:40 | 8.6K | |
| sfx-megundal-uncover.opus | 2022-02-01 01:40 | 13K | |
| sfx-metalman-behindhead.opus | 2022-02-01 01:40 | 30K | |
| sfx-metalman-breakdown.opus | 2022-02-01 01:40 | 472K | |
| sfx-metalman-crazyfingers.opus | 2022-02-01 01:40 | 43K | |
| sfx-metalman-damage.opus | 2022-02-01 01:40 | 10K | |
| sfx-metalman-headbang.opus | 2022-02-01 01:40 | 23K | |
| sfx-metalman-kiss.opus | 2022-02-01 01:40 | 3.7K | |
| sfx-metalman-playing.opus | 2022-02-01 01:40 | 91K | |
| sfx-metalman-playing2.opus | 2022-02-01 01:40 | 39K | |
| sfx-metalman-shred.opus | 2022-02-01 01:40 | 19K | |
| sfx-metalman-shredding.opus | 2022-02-01 01:40 | 103K | |
| sfx-metalman-single.opus | 2022-02-01 01:40 | 23K | |
| sfx-metalman-sweating1.opus | 2022-02-01 01:40 | 130K | |
| sfx-metalman-sweating2.opus | 2022-02-01 01:40 | 136K | |
| sfx-metalman-transform.opus | 2022-02-01 01:40 | 117K | |
| sfx-metalman-upanddown.opus | 2022-02-01 01:40 | 36K | |
| sfx-metalpose.opus | 2022-02-01 01:40 | 7.9K | |
| sfx-mrhat.opus | 2022-02-01 01:40 | 13K | |
| sfx-nahyuta-beads.opus | 2022-02-01 01:40 | 5.3K | |
| sfx-nahyuta-breakdown.opus | 2022-02-01 01:40 | 53K | |
| sfx-nahyuta-chant.opus | 2022-02-01 01:40 | 45K | |
| sfx-nahyuta-clap-echo.opus | 2022-02-01 01:40 | 17K | |
| sfx-nahyuta-clap.opus | 2022-02-01 01:40 | 4.5K | |
| sfx-nahyuta-deskslam.opus | 2022-02-01 01:40 | 17K | |
| sfx-nahyuta-mantra.opus | 2022-02-01 01:40 | 13K | |
| sfx-nahyuta-point.opus | 2022-02-01 01:40 | 6.0K | |
| sfx-nahyuta-prepoint.opus | 2022-02-01 01:40 | 6.2K | |
| sfx-nahyuta-scroll-in.opus | 2022-02-01 01:40 | 6.2K | |
| sfx-nahyuta-scroll-out.opus | 2022-02-01 01:40 | 8.9K | |
| sfx-neveryields.opus | 2022-02-01 01:40 | 21K | |
| sfx-neveryieldsfull.opus | 2022-02-01 01:40 | 74K | |
| sfx-nicole-damage.opus | 2022-02-01 01:40 | 6.3K | |
| sfx-nosale.opus | 2022-02-01 01:40 | 13K | |
| sfx-notguilty-dd.opus | 2022-02-01 01:40 | 18K | |
| sfx-notguilty.opus | 2022-02-01 01:40 | 30K | |
| sfx-objection-dd.opus | 2022-02-01 01:40 | 10K | |
| sfx-objection.opus | 2023-08-24 19:38 | 7.0K | |
| sfx-objection.wav | 2023-08-24 19:38 | 57K | |
| sfx-olga-breakdown.opus | 2022-02-01 01:40 | 29K | |
| sfx-olga-breakdown2.opus | 2022-02-01 01:40 | 19K | |
| sfx-olga-damage.opus | 2022-02-01 01:40 | 18K | |
| sfx-olga-damage2.opus | 2022-02-01 01:40 | 5.2K | |
| sfx-orla-appear.opus | 2022-02-01 01:40 | 10K | |
| sfx-orla-bellyslap.opus | 2022-02-01 01:40 | 20K | |
| sfx-orla-chomp.opus | 2022-02-01 01:40 | 4.7K | |
| sfx-orla-clap.opus | 2022-02-01 01:40 | 19K | |
| sfx-orla-leave.opus | 2022-02-01 01:40 | 25K | |
| sfx-orla-spray.opus | 2022-02-01 01:40 | 5.9K | |
| sfx-owenfall.opus | 2022-02-01 01:40 | 9.4K | |
| sfx-pageturn.opus | 2022-02-01 01:40 | 3.2K | |
| sfx-pageturnx2.opus | 2022-02-01 01:40 | 5.4K | |
| sfx-patrick-salute.opus | 2022-02-01 01:40 | 22K | |
| sfx-paulcarriageclose.opus | 2022-02-01 01:40 | 7.9K | |
| sfx-paulcarriageenter.opus | 2022-02-01 01:40 | 52K | |
| sfx-paulcarriageenterfull.opus | 2022-02-01 01:40 | 67K | |
| sfx-paulcarriageopen.opus | 2022-02-01 01:40 | 8.9K | |
| sfx-paulclean.opus | 2022-02-01 01:40 | 23K | |
| sfx-paulfix.opus | 2022-02-01 01:40 | 32K | |
| sfx-paulscrunch.opus | 2022-02-01 01:40 | 8.9K | |
| sfx-paulwalkin.opus | 2022-02-01 01:40 | 33K | |
| sfx-paulwalkout.opus | 2022-02-01 01:40 | 33K | |
| sfx-payne-breakdown.opus | 2022-02-01 01:40 | 95K | |
| sfx-photosnap.opus | 2022-02-01 01:40 | 3.1K | |
| sfx-pichoop.opus | 2022-02-01 01:40 | 1.6K | |
| sfx-portsmanbreak.opus | 2022-02-01 01:40 | 60K | |
| sfx-pullout.opus | 2022-02-01 01:40 | 4.4K | |
| sfx-ratatata.opus | 2022-02-01 01:40 | 33K | |
| sfx-rayfa-damage.opus | 2022-02-01 01:40 | 13K | |
| sfx-rayfa-dod1.opus | 2022-02-01 01:40 | 73K | |
| sfx-rayfa-dod2.opus | 2022-02-01 01:40 | 78K | |
| sfx-rayfa-dod3.opus | 2022-02-01 01:40 | 61K | |
| sfx-rayfa-dod4.opus | 2022-02-01 01:40 | 77K | |
| sfx-rayfa-faint.opus | 2022-02-01 01:40 | 28K | |
| sfx-rayfa-pray.opus | 2022-02-01 01:40 | 61K | |
| sfx-rayfa-prepare.opus | 2022-02-01 01:40 | 72K | |
| sfx-rayfa-staffslam.opus | 2022-02-01 01:40 | 12K | |
| sfx-realization-dd.opus | 2022-02-01 01:40 | 15K | |
| sfx-realization-dd.wav | 2023-08-24 19:38 | 125K | |
| sfx-realization.opus | 2022-02-01 01:40 | 6.3K | |
| sfx-reasoning.opus | 2022-02-01 01:40 | 68K | |
| sfx-rebuttal-aai.opus | 2022-02-01 01:40 | 16K | |
| sfx-rebuttal.opus | 2022-02-01 01:40 | 15K | |
| sfx-reddbling.opus | 2022-02-01 01:40 | 12K | |
| sfx-regina-breakdown.opus | 2022-02-01 01:40 | 28K | |
| sfx-reload.opus | 2022-02-01 01:40 | 11K | |
| sfx-reportsound.opus | 2022-02-01 01:40 | 2.5K | |
| sfx-respite.opus | 2022-02-01 01:40 | 65K | |
| sfx-retinz-cardburn.opus | 2022-02-01 01:40 | 14K | |
| sfx-retinz-cloak.opus | 2022-02-01 01:40 | 8.1K | |
| sfx-retinz-coinflip.opus | 2022-02-01 01:40 | 27K | |
| sfx-retinz-fire.opus | 2022-02-01 01:40 | 19K | |
| sfx-rimes-breakdown.opus | 2022-02-01 01:40 | 334K | |
| sfx-rimes-damage.opus | 2022-02-01 01:40 | 31K | |
| sfx-rimes-devour.opus | 2022-02-01 01:40 | 17K | |
| sfx-rimes-rap.opus | 2022-02-01 01:40 | 75K | |
| sfx-rimes-rap2.opus | 2022-02-01 01:40 | 45K | |
| sfx-rimes-rapdone.opus | 2022-02-01 01:40 | 15K | |
| sfx-rimes-rapdone2.opus | 2022-02-01 01:40 | 14K | |
| sfx-rimes-transform.opus | 2022-02-01 01:40 | 133K | |
| sfx-roar.opus | 2022-02-01 01:40 | 5.8K | |
| sfx-roger-camera.opus | 2022-02-01 01:40 | 7.8K | |
| sfx-roger-card.opus | 2022-02-01 01:40 | 3.9K | |
| sfx-roger-card2.opus | 2022-02-01 01:40 | 3.4K | |
| sfx-roger-coin.opus | 2022-02-01 01:40 | 4.7K | |
| sfx-roger-money.opus | 2022-02-01 01:40 | 6.7K | |
| sfx-roger-sign.opus | 2022-02-01 01:40 | 4.6K | |
| sfx-roger-sleeves.opus | 2022-02-01 01:40 | 12K | |
| sfx-rumba-pop.opus | 2022-02-01 01:40 | 3.4K | |
| sfx-ryuunosuke-damage.opus | 2022-02-01 01:40 | 22K | |
| sfx-ryuunosuke-doubleslap.opus | 2022-02-01 01:40 | 14K | |
| sfx-ryuunosuke-newslam.opus | 2022-02-01 01:40 | 4.3K | |
| sfx-ryuunosuke-slap.opus | 2023-08-24 19:38 | 8.8K | |
| sfx-saveblip.opus | 2022-02-01 01:40 | 3.5K | |
| sfx-sbirotto.opus | 2022-02-01 01:40 | 897K | |
| sfx-scenechange.opus | 2022-02-01 01:40 | 3.5K | |
| sfx-scroll.opus | 2022-02-01 01:40 | 1.5K | |
| sfx-selectblip.opus | 2022-02-01 01:40 | 1.3K | |
| sfx-selectblip2.opus | 2022-02-01 01:40 | 2.2K | |
| sfx-selectjingle.opus | 2022-02-01 01:40 | 8.5K | |
| sfx-shattering.opus | 2022-02-01 01:40 | 8.0K | |
| sfx-shoomp.opus | 2022-02-01 01:40 | 3.7K | |
| sfx-shottwice.opus | 2022-02-01 01:40 | 19K | |
| sfx-simonfall.opus | 2022-02-01 01:40 | 21K | |
| sfx-sir.wav | 2023-08-24 19:38 | 85K | |
| sfx-sitdown.opus | 2022-02-01 01:40 | 14K | |
| sfx-slash.opus | 2022-02-01 01:40 | 13K | |
| sfx-slashtosheathe.opus | 2022-02-01 01:40 | 21K | |
| sfx-sleeve.opus | 2022-02-01 01:40 | 6.6K | |
| sfx-smack.opus | 2023-08-24 19:38 | 6.1K | |
| sfx-smack.wav | 2023-08-24 19:38 | 7.2K | |
| sfx-smallclap.opus | 2022-02-01 01:40 | 1.1K | |
| sfx-souseki-dance2.opus | 2022-02-01 01:40 | 4.6K | |
| sfx-souseki-dance3.opus | 2022-02-01 01:40 | 6.7K | |
| sfx-souseki-dance4.opus | 2022-02-01 01:40 | 11K | |
| sfx-souseki-danceangry.opus | 2022-02-01 01:40 | 9.6K | |
| sfx-souseki-dancelong.opus | 2022-02-01 01:40 | 21K | |
| sfx-souseki-dancemedium.opus | 2022-02-01 01:40 | 14K | |
| sfx-souseki-danceworried.opus | 2022-02-01 01:40 | 8.5K | |
| sfx-spinwhack.opus | 2022-02-01 01:40 | 20K | |
| sfx-squee.opus | 2022-02-01 01:40 | 12K | |
| sfx-stab-dd.opus | 2022-02-01 01:40 | 5.7K | |
| sfx-stab-dd.wav | 2023-08-24 19:38 | 43K | |
| sfx-stab.opus | 2022-02-01 01:40 | 4.4K | |
| sfx-stab.wav | 2023-08-24 19:38 | 28K | |
| sfx-stab2.opus | 2023-08-24 19:38 | 4.6K | |
| sfx-superchug.opus | 2022-02-01 01:40 | 14K | |
| sfx-superdeskslam.opus | 2022-02-01 01:40 | 17K | |
| sfx-supershock.opus | 2022-02-01 01:40 | 6.4K | |
| sfx-surprised-dd.opus | 2022-02-01 01:40 | 15K | |
| sfx-surprised-dd.wav | 2023-08-24 19:38 | 78K | |
| sfx-susato-book.opus | 2022-02-01 01:40 | 5.5K | |
| sfx-susato-bookflip.opus | 2022-02-01 01:40 | 25K | |
| sfx-susato-bookidea.opus | 2022-02-01 01:40 | 3.6K | |
| sfx-swoop.opus | 2022-02-01 01:40 | 2.1K | |
| sfx-taperecorder-dd.opus | 2022-02-01 01:40 | 38K | |
| sfx-taser.opus | 2022-02-01 01:40 | 12K | |
| sfx-taze.opus | 2022-02-01 01:40 | 4.6K | |
| sfx-testimony.opus | 2022-02-01 01:40 | 9.8K | |
| sfx-testimony2.opus | 2022-02-01 01:41 | 16K | |
| sfx-thought.opus | 2022-02-01 01:41 | 14K | |
| sfx-thud.opus | 2022-02-01 01:41 | 3.6K | |
| sfx-thud2.opus | 2022-02-01 01:41 | 2.1K | |
| sfx-thud3.opus | 2022-02-01 01:41 | 2.4K | |
| sfx-thud4.opus | 2022-02-01 01:41 | 4.2K | |
| sfx-thump-3.opus | 2022-02-01 01:41 | 2.0K | |
| sfx-thump.opus | 2022-02-01 01:41 | 1.9K | |
| sfx-thump2.opus | 2022-02-01 01:41 | 2.0K | |
| sfx-thump3.opus | 2022-02-01 01:41 | 2.0K | |
| sfx-thunder.opus | 2022-02-01 01:41 | 6.3K | |
| sfx-thwap.opus | 2022-02-01 01:41 | 2.0K | |
| sfx-tobias-crush.opus | 2022-02-01 01:41 | 7.5K | |
| sfx-tobias-devour.opus | 2022-02-01 01:41 | 41K | |
| sfx-tobias-eat.opus | 2022-02-01 01:41 | 26K | |
| sfx-tobias-problem.opus | 2022-02-01 01:41 | 8.8K | |
| sfx-tobias-problem2.opus | 2022-02-01 01:41 | 7.7K | |
| sfx-tobias-teadown.opus | 2022-02-01 01:41 | 3.5K | |
| sfx-toowen.opus | 2022-02-01 01:41 | 75K | |
| sfx-triplegavel-dd.opus | 2022-02-01 01:41 | 9.1K | |
| sfx-triplegavel-fast.opus | 2022-02-01 01:41 | 8.9K | |
| sfx-triplegavel-soj.opus | 2022-02-01 01:41 | 17K | |
| sfx-triplegavel.opus | 2022-02-01 01:41 | 6.9K | |
| sfx-tripleslam.opus | 2022-02-01 01:41 | 9.2K | |
| sfx-triplesmack.opus | 2022-02-01 01:41 | 4.6K | |
| sfx-trucypantiesappear.opus | 2022-02-01 01:41 | 29K | |
| sfx-tvoff.opus | 2022-02-01 01:41 | 34K | |
| sfx-tvturnon.opus | 2022-02-01 01:41 | 15K | |
| sfx-twirl.opus | 2022-02-01 01:41 | 3.3K | |
| sfx-twirllong.opus | 2022-02-01 01:41 | 6.7K | |
| sfx-twirlwhack.opus | 2022-02-01 01:41 | 34K | |
| sfx-uendobreakdown.opus | 2022-02-01 01:41 | 217K | |
| sfx-uendodamage.opus | 2022-02-01 01:41 | 8.3K | |
| sfx-uendofanclap.opus | 2022-02-01 01:41 | 4.2K | |
| sfx-uendofanhit.opus | 2022-02-01 01:41 | 3.3K | |
| sfx-uendofantoss.opus | 2022-02-01 01:41 | 47K | |
| sfx-uendopatches.opus | 2022-02-01 01:41 | 45K | |
| sfx-uendosip.opus | 2022-02-01 01:41 | 9.6K | |
| sfx-uendospittake.opus | 2022-02-01 01:41 | 8.0K | |
| sfx-uncloakdramapound.opus | 2022-02-01 01:41 | 16K | |
| sfx-unsolved.opus | 2022-02-01 01:41 | 70K | |
| sfx-vera-draw.opus | 2022-02-01 01:41 | 5.4K | |
| sfx-vera-open.opus | 2022-02-01 01:41 | 3.0K | |
| sfx-vera-sketch.opus | 2022-02-01 01:41 | 9.1K | |
| sfx-ween.opus | 2022-02-01 01:41 | 11K | |
| sfx-whack.opus | 2022-02-01 01:41 | 3.5K | |
| sfx-whap.opus | 2022-02-01 01:41 | 11K | |
| sfx-whimper.opus | 2022-02-01 01:41 | 5.3K | |
| sfx-whip.opus | 2022-02-01 01:41 | 11K | |
| sfx-whipcrack.opus | 2022-02-01 01:41 | 27K | |
| sfx-whipsnap.opus | 2022-02-01 01:41 | 10K | |
| sfx-wind.opus | 2022-02-01 01:41 | 14K | |
| sfx-winpuzzle.opus | 2022-02-01 01:41 | 54K | |
| sfx-wipe.opus | 2022-02-01 01:41 | 2.2K | |
| sfx-wooshcoat.opus | 2022-02-01 01:41 | 3.8K | |
| sfx-wooshsmack-2.opus | 2022-02-01 01:41 | 6.7K | |
| sfx-wooshsmack.opus | 2022-02-01 01:41 | 3.3K | |
| sfx-yep.opus | 2022-02-01 01:41 | 65K | |
| sfx-yields.opus | 2022-02-01 01:41 | 16K | |
| sfx-yip.opus | 2022-02-01 01:41 | 2.9K | |
| sfx-zooma.opus | 2022-02-01 01:41 | 3.5K | |
| sfx-zoomafast.opus | 2022-02-01 01:41 | 3.2K | |
| shakey/ | 2022-02-01 02:04 | - | |
| sherlock/ | 2022-02-01 02:04 | - | |
| sherlockhd/ | 2023-08-24 19:39 | - | |
| shinjicountdown.mp3 | 2024-01-28 02:54 | 121K | |
| shinjiferito.mp3 | 2024-01-28 02:54 | 93K | |
| shinjifortnite.mp3 | 2024-01-28 02:54 | 240K | |
| shiv/ | 2022-02-01 02:04 | - | |
| shuichi/ | 2022-02-01 02:04 | - | |
| simon/ | 2022-02-01 02:04 | - | |
| slammed.opus | 2022-02-01 01:41 | 1.1M | |
| smack-dd.opus | 2022-02-01 01:41 | 5.3K | |
| smiles/ | 2022-02-01 02:04 | - | |
| soj-amara-appear.opus | 2022-02-01 01:41 | 20K | |
| soj-amara-break.opus | 2022-02-01 01:41 | 112K | |
| soj-amara-damage.opus | 2022-02-01 01:41 | 57K | |
| soj-amara-faint.opus | 2022-02-01 01:41 | 48K | |
| soj-amara-lightning.opus | 2022-02-01 01:41 | 19K | |
| soj-amara-naynasweat.opus | 2022-02-01 01:41 | 11K | |
| soj-amara-shotfaint.opus | 2022-02-01 01:41 | 47K | |
| soj-amara-transform.opus | 2022-02-01 01:41 | 170K | |
| soj-apollo-facedesk.opus | 2022-02-01 01:41 | 6.6K | |
| soj-armie-drone-set.opus | 2022-02-01 01:41 | 4.0K | |
| soj-armie-drone-start.opus | 2022-02-01 01:41 | 17K | |
| soj-armie-fly.opus | 2022-02-01 01:41 | 36K | |
| soj-armie-heliplay.opus | 2022-02-01 01:41 | 18K | |
| soj-armie-helistart.opus | 2022-02-01 01:41 | 3.0K | |
| soj-armie-rollin.opus | 2022-02-01 01:41 | 31K | |
| soj-athena-doubleslam.opus | 2022-02-01 01:41 | 15K | |
| soj-athena-matrix-start.opus | 2022-02-01 01:41 | 39K | |
| soj-athena-matrix-swipe.opus | 2022-02-01 01:41 | 5.3K | |
| soj-athena-transform-2.opus | 2022-02-01 01:41 | 93K | |
| soj-athena-transform.opus | 2022-02-01 01:41 | 65K | |
| soj-betty-bat.opus | 2022-02-01 01:41 | 24K | |
| soj-betty-damage.opus | 2022-02-01 01:41 | 29K | |
| soj-betty-trans.opus | 2022-02-01 01:41 | 33K | |
| soj-betty-umb-close.opus | 2022-02-01 01:41 | 24K | |
| soj-betty-umb-open.opus | 2022-02-01 01:41 | 43K | |
| soj-bonny-betty-twirl.opus | 2022-02-01 01:41 | 91K | |
| soj-bonny-bunny.opus | 2022-02-01 01:41 | 30K | |
| soj-bonny-canehit.opus | 2022-02-01 01:41 | 20K | |
| soj-bonny-damage.opus | 2022-02-01 01:41 | 23K | |
| soj-bonny-nothing.opus | 2022-02-01 01:41 | 7.2K | |
| soj-bonny-toss.opus | 2022-02-01 01:41 | 5.9K | |
| soj-bonny-twirl.opus | 2022-02-01 01:41 | 43K | |
| soj-bonny-untwirl.opus | 2022-02-01 01:41 | 24K | |
| soj-bonny-whap.opus | 2022-02-01 01:41 | 15K | |
| soj-datz-airforce.opus | 2022-02-01 01:41 | 38K | |
| soj-datz-apple.opus | 2022-02-01 01:41 | 61K | |
| soj-datz-blade.opus | 2022-02-01 01:41 | 14K | |
| soj-datz-jump.opus | 2022-02-01 01:41 | 20K | |
| soj-datz-lizard.opus | 2022-02-01 01:41 | 54K | |
| soj-deskslam.opus | 2022-02-01 01:41 | 9.5K | |
| soj-dhurke-damage.opus | 2022-02-01 01:41 | 7.0K | |
| soj-dhurke-furious.opus | 2022-02-01 01:41 | 15K | |
| soj-dhurke-heartrest.opus | 2022-02-01 01:41 | 5.0K | |
| soj-dhurke-neveryields-2.opus | 2022-02-01 01:41 | 22K | |
| soj-dhurke-neveryields-full.opus | 2022-02-01 01:41 | 41K | |
| soj-dhurke-neveryields.opus | 2022-02-01 01:41 | 21K | |
| soj-dhurke-neveryieldsfull-2.opus | 2022-02-01 01:41 | 40K | |
| soj-dhurke-shock.opus | 2022-02-01 01:41 | 5.2K | |
| soj-dhurke-shot-twice.opus | 2022-02-01 01:41 | 19K | |
| soj-dhurke-shot.opus | 2022-02-01 01:41 | 16K | |
| soj-dramapound.opus | 2022-02-01 01:41 | 7.9K | |
| soj-ema-munch-backwards.opus | 2022-02-01 01:41 | 17K | |
| soj-ema-munch.opus | 2022-02-01 01:41 | 18K | |
| soj-garan-break.opus | 2022-02-01 01:41 | 7.7K | |
| soj-garan-insolence.opus | 2022-02-01 01:41 | 19K | |
| soj-garan-point.opus | 2022-02-01 01:41 | 9.7K | |
| soj-garan-slam.opus | 2022-02-01 01:41 | 9.2K | |
| soj-garan-swipe.opus | 2022-02-01 01:41 | 41K | |
| soj-garan-write.opus | 2022-02-01 01:41 | 38K | |
| soj-gaspen-breakdown.opus | 2022-02-01 01:41 | 118K | |
| soj-gaspen-shine.opus | 2022-02-01 01:41 | 9.1K | |
| soj-gavel-kurain.opus | 2022-02-01 01:41 | 11K | |
| soj-gavel.opus | 2022-02-01 01:41 | 8.5K | |
| soj-geiru-breakdown.opus | 2022-02-01 01:41 | 35K | |
| soj-geiru-deflate.opus | 2022-02-01 01:41 | 25K | |
| soj-geiru-gainax.opus | 2022-02-01 01:41 | 21K | |
| soj-geiru-nibble.opus | 2022-02-01 01:41 | 4.6K | |
| soj-geiru-pop.opus | 2022-02-01 01:41 | 5.1K | |
| soj-geiru-swordcrazy.opus | 2022-02-01 01:41 | 7.9K | |
| soj-judge-kurain-opening.opus | 2022-02-01 01:41 | 101K | |
| soj-katonk.opus | 2022-02-01 01:41 | 2.6K | |
| soj-lightbulb.opus | 2022-02-01 01:41 | 15K | |
| soj-nahyuta-clap-dry.opus | 2022-02-01 01:41 | 4.5K | |
| soj-nahyuta-clap.opus | 2022-02-01 01:41 | 17K | |
| soj-nahyuta-dam-st.opus | 2022-02-01 01:41 | 59K | |
| soj-nahyuta-don.opus | 2022-02-01 01:41 | 17K | |
| soj-nahyuta-finger.opus | 2022-02-01 01:41 | 6.0K | |
| soj-nahyuta-in.opus | 2022-02-01 01:41 | 13K | |
| soj-nahyuta-kamae-soft.opus | 2022-02-01 01:41 | 7.1K | |
| soj-nahyuta-kamae.opus | 2022-02-01 01:41 | 5.3K | |
| soj-nahyuta-makimono-out.opus | 2022-02-01 01:41 | 6.2K | |
| soj-nahyuta-makimono.opus | 2022-02-01 01:41 | 8.9K | |
| soj-nahyuta-nage.opus | 2022-02-01 01:41 | 6.2K | |
| soj-nahyuta-satorha-imaoman.opus | 2022-02-01 01:41 | 45K | |
| soj-nahyuta-satorha.opus | 2022-02-01 01:41 | 13K | |
| soj-objection.opus | 2022-02-01 01:41 | 10K | |
| soj-paul-breathnrub.opus | 2022-02-01 01:41 | 23K | |
| soj-paul-carraige.opus | 2022-02-01 01:41 | 71K | |
| soj-paul-carriage-closed.opus | 2022-02-01 01:41 | 52K | |
| soj-paul-fall.opus | 2022-02-01 01:41 | 7.6K | |
| soj-paul-nameplate.opus | 2022-02-01 01:41 | 4.0K | |
| soj-paul-scrunch.opus | 2022-02-01 01:41 | 8.9K | |
| soj-paul-stand-close.opus | 2022-02-01 01:41 | 7.9K | |
| soj-paul-stand-open.opus | 2022-02-01 01:41 | 8.5K | |
| soj-paul-taping-plate.opus | 2022-02-01 01:41 | 32K | |
| soj-paul-walk-in.opus | 2022-02-01 01:41 | 33K | |
| soj-paul-walk-out.opus | 2022-02-01 01:41 | 33K | |
| soj-pees-breakdown.opus | 2022-02-01 01:41 | 520K | |
| soj-pees-chord.opus | 2022-02-01 01:41 | 20K | |
| soj-pees-headbangin.opus | 2022-02-01 01:41 | 11K | |
| soj-pees-magatama-bling.opus | 2022-02-01 01:41 | 9.6K | |
| soj-pees-magatama-kiss.opus | 2022-02-01 01:41 | 3.7K | |
| soj-pees-nervousriff.opus | 2022-02-01 01:41 | 58K | |
| soj-pees-plinking.opus | 2022-02-01 01:41 | 23K | |
| soj-pees-riff.opus | 2022-02-01 01:41 | 59K | |
| soj-pees-rockin.opus | 2022-02-01 01:41 | 42K | |
| soj-pees-shred.opus | 2022-02-01 01:41 | 44K | |
| soj-pees-stylin.opus | 2022-02-01 01:41 | 24K | |
| soj-pees-transform.opus | 2022-02-01 01:41 | 121K | |
| soj-pees-tuneup.opus | 2022-02-01 01:41 | 33K | |
| soj-pees-tuneupriff.opus | 2022-02-01 01:41 | 17K | |
| soj-rayfa-damage.opus | 2022-02-01 01:41 | 16K | |
| soj-rayfa-dod-2.opus | 2022-02-01 01:41 | 78K | |
| soj-rayfa-dod-3.opus | 2022-02-01 01:41 | 61K | |
| soj-rayfa-dod-4.opus | 2022-02-01 01:41 | 77K | |
| soj-rayfa-dod.opus | 2022-02-01 01:41 | 73K | |
| soj-rayfa-faint.opus | 2022-02-01 01:41 | 27K | |
| soj-rayfa-faint2.opus | 2022-02-01 01:41 | 14K | |
| soj-rayfa-flop.opus | 2022-02-01 01:41 | 5.3K | |
| soj-rayfa-hikaeyo.opus | 2022-02-01 01:41 | 18K | |
| soj-rayfa-pray.opus | 2022-02-01 01:41 | 61K | |
| soj-rayfa-prepare.opus | 2022-02-01 01:41 | 77K | |
| soj-rayfa-staffslam.opus | 2022-02-01 01:41 | 20K | |
| soj-rayfa-thatsenough-alt.opus | 2022-02-01 01:41 | 16K | |
| soj-rayfa-thatsenough.opus | 2022-02-01 01:41 | 13K | |
| soj-retinz-burncard.opus | 2022-02-01 01:41 | 23K | |
| soj-retinz-businesscard.opus | 2022-02-01 01:41 | 9.4K | |
| soj-retinz-camera.opus | 2022-02-01 01:41 | 10K | |
| soj-retinz-cape.opus | 2022-02-01 01:41 | 11K | |
| soj-retinz-card-smug.opus | 2022-02-01 01:41 | 11K | |
| soj-retinz-coin-reveal.opus | 2022-02-01 01:41 | 11K | |
| soj-retinz-coin-toss.opus | 2022-02-01 01:41 | 35K | |
| soj-retinz-flame.opus | 2022-02-01 01:41 | 71K | |
| soj-retinz-money.opus | 2022-02-01 01:41 | 14K | |
| soj-retinz-sign.opus | 2022-02-01 01:41 | 8.2K | |
| soj-sarge-arm-2.opus | 2022-02-01 01:41 | 4.3K | |
| soj-sarge-arm.opus | 2022-02-01 01:41 | 4.9K | |
| soj-sarge-cock.opus | 2022-02-01 01:41 | 4.0K | |
| soj-sarge-crash.opus | 2022-02-01 01:41 | 11K | |
| soj-sarge-damage.opus | 2022-02-01 01:41 | 5.2K | |
| soj-sarge-depower.opus | 2022-02-01 01:41 | 10K | |
| soj-sarge-extend.opus | 2022-02-01 01:41 | 5.6K | |
| soj-sarge-hatch.opus | 2022-02-01 01:41 | 4.0K | |
| soj-sarge-hover-dam.opus | 2022-02-01 01:41 | 13K | |
| soj-sarge-hover.opus | 2022-02-01 01:41 | 9.8K | |
| soj-sarge-leave.opus | 2022-02-01 01:41 | 20K | |
| soj-sarge-missile.opus | 2022-02-01 01:41 | 22K | |
| soj-sarge-retract.opus | 2022-02-01 01:41 | 5.8K | |
| soj-sarge-shoot.opus | 2022-02-01 01:41 | 23K | |
| soj-sarge-woozy.opus | 2022-02-01 01:41 | 17K | |
| soj-trucy-magicpantsu.opus | 2022-02-01 01:41 | 29K | |
| soj-uendo-biggestfan.opus | 2022-02-01 01:41 | 45K | |
| soj-uendo-fan.opus | 2022-02-01 01:41 | 2.2K | |
| soj-uendo-patches.opus | 2022-02-01 01:41 | 15K | |
| soj-uendo-point.opus | 2022-02-01 01:41 | 4.7K | |
| soj-uendo-sippy.opus | 2022-02-01 01:41 | 9.6K | |
| soj-uendo-spit.opus | 2022-02-01 01:41 | 6.5K | |
| sorin/ | 2022-02-01 02:04 | - | |
| speak.opus | 2022-02-01 01:41 | 8.4K | |
| spencerintro.opus | 2022-02-01 01:41 | 2.5M | |
| starbuck/ | 2022-02-01 02:04 | - | |
| stickler/ | 2022-02-01 02:04 | - | |
| stillsvibritannia.opus | 2022-02-01 01:41 | 45K | |
| surprise_dgs.opus | 2022-02-01 01:41 | 7.1K | |
| surprise_plvspw.opus | 2022-02-01 01:41 | 11K | |
| susato/ | 2023-09-16 15:49 | - | |
| t&t-chug-stab.opus | 2022-02-01 01:41 | 9.9K | |
| t&t-chug-super-2.opus | 2022-02-01 01:41 | 17K | |
| t&t-chug-super.opus | 2022-02-01 01:41 | 17K | |
| t&t-doubleobjection.opus | 2022-02-01 01:41 | 24K | |
| t&t-furio-breakdown.opus | 2022-02-01 01:41 | 53K | |
| t&t-furio.opus | 2022-02-01 01:41 | 8.4K | |
| t&t-godot-chug-stab.opus | 2022-02-01 01:41 | 14K | |
| t&t-godot-chug-super-2.opus | 2022-02-01 01:41 | 21K | |
| t&t-godot-chug-super.opus | 2022-02-01 01:41 | 20K | |
| t&t-godot-chug.opus | 2022-02-01 01:41 | 5.9K | |
| t&t-godot-slide.opus | 2022-02-01 01:41 | 5.2K | |
| t&t-miaobjection.opus | 2022-02-01 01:41 | 9.0K | |
| t&t-objection-double.opus | 2022-02-01 01:41 | 24K | |
| tahrust/ | 2022-02-01 02:04 | - | |
| takethat.opus | 2022-02-01 01:41 | 18K | |
| tenma/ | 2022-02-01 02:04 | - | |
| theBack.mp3 | 2024-01-28 02:54 | 451K | |
| the king/ | 2022-02-01 02:04 | - | |
| thomas/ | 2022-02-01 02:04 | - | |
| thorns.opus | 2022-02-01 01:41 | 1.3M | |
| thornsvoice.opus | 2022-02-01 01:41 | 1.1M | |
| tinpillar/ | 2022-02-01 02:04 | - | |
| tonate/ | 2022-02-01 02:04 | - | |
| uzukumaru/ | 2022-02-01 02:05 | - | |
| venus/ | 2022-02-01 02:05 | - | |
| vineboom.mp3 | 2024-01-28 02:54 | 21K | |
| viridian/ | 2022-02-01 02:05 | - | |
| vortex/ | 2022-02-01 02:05 | - | |
| vskiryu.opus | 2022-02-01 01:41 | 221K | |
| weiss-damage-1-jp.opus | 2022-02-01 01:41 | 10K | |
| weiss-damage-1.opus | 2022-02-01 01:41 | 7.4K | |
| weiss-damage-2-jp.opus | 2022-02-01 01:41 | 9.8K | |
| weiss-damage-2.opus | 2022-02-01 01:41 | 7.0K | |
| weiss-dynamic-1-jp.opus | 2022-02-01 01:41 | 27K | |
| weiss-dynamic-1.opus | 2022-02-01 01:41 | 25K | |
| weiss-dynamic-3-jp.opus | 2022-02-01 01:41 | 14K | |
| weiss-dynamic-3.opus | 2022-02-01 01:41 | 15K | |
| weiss-howdull-jp.opus | 2022-02-01 01:41 | 15K | |
| weiss-howdull.opus | 2022-02-01 01:41 | 11K | |
| weiss-notsoeasy.opus | 2022-02-01 01:41 | 11K | |
| weiss-poke-jp.opus | 2022-02-01 01:41 | 4.0K | |
| weiss-poke.opus | 2022-02-01 01:41 | 4.1K | |
| weiss-resonance-jp.opus | 2022-02-01 01:41 | 33K | |
| weiss-resonance.opus | 2022-02-01 01:41 | 33K | |
| weiss-slash-jp.opus | 2022-02-01 01:41 | 8.2K | |
| weiss-slash.opus | 2022-02-01 01:41 | 7.9K | |
| weiss-superdamage-jp.opus | 2022-02-01 01:41 | 18K | |
| weiss-superdamage.opus | 2022-02-01 01:41 | 17K | |
| weiss-sword1.opus | 2022-02-01 01:41 | 3.4K | |
| weiss-swordpoint.opus | 2022-02-01 01:41 | 3.6K | |
| whoops.opus | 2022-02-01 01:41 | 6.0K | |
| william/ | 2022-02-01 02:05 | - | |
| winter-horrorland_inst.opus | 2022-02-01 01:41 | 1.6M | |
| yotobidance.opus | 2022-02-01 01:41 | 191K | |
| yttd/ | 2022-02-01 02:05 | - | |
| yu/ | 2022-02-01 02:05 | - | |
| yukari/ | 2022-02-01 02:07 | - | |
| yukiko/ | 2022-02-01 02:05 | - | |
| yuri/ | 2022-02-01 02:05 | - | |
| zacharias/ | 2022-02-01 02:07 | - | |
| zawa-1.opus | 2023-09-16 15:49 | 39K | |
| zawa-2.opus | 2023-09-16 15:49 | 38K | |
| zawa-3.opus | 2023-09-16 15:49 | 26K | |
| zawa-4.opus | 2023-09-16 15:49 | 93K | |
| zawa-5.opus | 2023-09-16 15:49 | 39K | |
| zero/ | 2022-02-01 02:05 | - | |
| zinc/ | 2022-02-01 02:05 | - | |